Wikipedia:WikiProject Chemicals/Log/2010-05-11

Standard header for logs from CheMoBot

00:25:56 (2, 3, 5) (EDIT) User:142.25.147.98 (contribs, talk) edited Tetrahydrozoline (diff, hist)
Changed: 'OtherNames' ('' -> '{{Chembox Identifiers')
00:25:56 (2, 3, 5) (EDIT) User:142.25.147.98 (contribs, talk) edited Tetrahydrozoline (diff, hist)
Changed: 'Section1' ('{{Chembox Identifiers' -> '')
00:33:00 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Undecylic_acid (diff, hist)
Added: 'verifiedrevid' ('' -> '305083789', SET '')
00:33:00 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Undecylic_acid (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')
01:31:05 (2, 4, 4) (EDIT) User:Tetracube (contribs, talk) edited Antimony_pentafluoride (diff, hist)
Changed: 'NFPA-H' ('3' -> '4', SET '3')
01:42:58 (3, 2, 4) (EDIT) User:Tetracube (contribs, talk) edited Antimony_pentafluoride (diff, hist)
Added links: http://www.inchem.org/documents/icsc/icsc/eics0220.htm
02:16:39 (3, 2, 4) (EDIT) User:139.80.123.38 (contribs, talk) edited Pregnanediol (diff, hist)
Added links: http://www.nlm.nih.gov/medlineplus/ency/article/003914.htm
02:34:54 (2, 4, 5) (EDIT) User:98.212.40.217 (contribs, talk) edited Niacin (diff, hist)
Changed: 'OtherNames' ('pyridine-3-carboxylic acid, nicotinic acid, vitamin B3' -> 'pyridine-3-carboxylic acid, nicotinic ac cv cbvid, vitamin B3', SET 'pyridine-3-carboxylic acid, nicotinic acid, vitamin B3')
02:59:49 (2, 3, 4) (EDIT) User:Benjah-bmm27 (contribs, talk) edited Tetracarbonylhydrocobalt (diff, hist)
Changed: 'ImageFile1' ('' -> 'HCo(CO)4-3D-balls.png')
03:11:45 (2, 4, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Bismuth_chloride (diff, hist)
Changed: 'NFPA-H' ('3' -> '2', SET '3')
03:11:45 (2, 4, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Bismuth_chloride (diff, hist)
Changed: 'NFPA-R' ('2' -> '0', SET '2')
03:18:52 (2, 3, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Bismuth_tribromide (diff, hist)
Changed: 'Appearance' ('' -> 'white to light yellow crystals')
03:18:53 (2, 3, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Bismuth_tribromide (diff, hist)
Changed: 'ShockSens' ('' -> 'N.A.')
03:18:55 (2, 3, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Bismuth_tribromide (diff, hist)
Changed: 'FrictionSens' ('' -> 'N.A.')
03:18:55 (2, 3, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Bismuth_tribromide (diff, hist)
Changed: 'ExplosiveV' ('' -> 'N.A.')
03:20:52 (2, 4, 5) (EDIT) User:N419BH (contribs, talk) edited Niacin (diff, hist)
Changed: 'OtherNames' ('pyridine-3-carboxylic acid, nicotinic ac cv cbvid, vitamin B3' -> 'pyridine-3-carboxylic acid, nicotinic acid, vitamin B3', SET 'pyridine-3-carboxylic acid, nicotinic acid, vitamin B3')
03:32:59 (2, 3, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Bismuth_subcarbonate (diff, hist)
Changed: 'Appearance' ('' -> 'fine white to pale yellow-white powder')
03:33:00 (2, 3, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Bismuth_subcarbonate (diff, hist)
Changed: 'NFPA-H' ('2' -> '1')
03:33:01 (4, 3, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Bismuth_subcarbonate (diff, hist)
Changed: 'Density' ('' -> '6.86 g/cm3')
03:33:01 (4, 3, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Bismuth_subcarbonate (diff, hist)
Changed: 'BoilingPt' ('' -> 'decomposes')
03:49:16 (3, 4, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Bismuth(III)_oxide (diff, hist)
Added: 'ExternalMSDS' ('' -> '[http://www.mallbaker.com/americas/msds/english/b3456_msds_us_default.pdf', SET '')
03:49:17 (3, 4, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Bismuth(III)_oxide (diff, hist)
Changed: 'NFPA-H' ('1' -> '0', SET '1')
03:49:20 (3, 2, 4) (EDIT) User:Chemicalinterest (contribs, talk) edited Bismuth(III)_oxide (diff, hist)
Added links: http://www.mallbaker.com/americas/msds/english/b3456_msds_us_default.pdf
05:02:17 (3, 2, 4) (EDIT) User:FellGleaming (contribs, talk) edited Potassium_iodide (diff, hist)
Added links: http://www.ecolo.org/documents/documents_in_english/Causes.ChernobyJF.doc
05:18:19 (2, 4, 5) (EDIT) User:99.95.24.25 (contribs, talk) edited Sucrose (diff, hist)
Changed: 'Appearance' ('white solid' -> 'white solid jerker', SET 'white solid')
05:18:50 (2, 2, 4) (EDIT) User:Materialscientist (contribs, talk) edited Sucrose (diff, hist)
Changed: 'Appearance' ('white solid jerker' -> 'white solid', SET 'white solid')
05:33:05 (3, 2, 4) (EDIT) User:Wotnow (contribs, talk) edited Fructose (diff, hist)
Added links: http://www.archive.org/stream/biochemistryofse00mann#page/n5/mode/2up
06:59:02 (2, 4, 5) (EDIT) User:Cesium 133 (contribs, talk) edited Benzil (diff, hist)
Changed: 'Section2' ('{{Chembox Properties' -> '{{Chembox Properties}}', SET '{{Chembox Properties')
06:59:03 (2, 5, 5) (EDIT) User:Cesium 133 (contribs, talk) edited Benzil (diff, hist)
Deleted: 'Section3' ('{{Chembox Structure' -> '', SET '{{Chembox Structure')
06:59:03 (2, 5, 5) (EDIT) User:Cesium 133 (contribs, talk) edited Benzil (diff, hist)
Deleted: 'CrystalStruct' ('P31,221<ref>''Acta Cryst.'' B43 398 (1987)</ref>' -> '', SET 'P31,221<ref>''Acta Cryst.'' B43 398 (1987)</ref>')
06:59:03 (2, 5, 5) (EDIT) User:Cesium 133 (contribs, talk) edited Benzil (diff, hist)
Deleted: 'Dipole' ('3.8 [[Debye|D]]<ref>''Spectrochim. Acta'' A60 (8-9) 1805 (2004)</ref>' -> '', SET '3.8 [[Debye|D]]<ref>''Spectrochim. Acta'' A60 (8-9) 1805 (2004)</ref>')
06:59:04 (2, 5, 5) (EDIT) User:Cesium 133 (contribs, talk) edited Benzil (diff, hist)
Deleted: 'Section7' ('{{Chembox Hazards' -> '', SET '{{Chembox Hazards')
06:59:05 (2, 5, 5) (EDIT) User:Cesium 133 (contribs, talk) edited Benzil (diff, hist)
Deleted: 'MainHazards' ('[[Irritant]]' -> '', SET '[[Irritant]]')
06:59:05 (2, 5, 5) (EDIT) User:Cesium 133 (contribs, talk) edited Benzil (diff, hist)
Deleted: 'NFPA-H' ('2' -> '', SET '2')
06:59:05 (2, 5, 5) (EDIT) User:Cesium 133 (contribs, talk) edited Benzil (diff, hist)
Deleted: 'NFPA-F' ('1' -> '', SET '1')
06:59:06 (2, 5, 5) (EDIT) User:Cesium 133 (contribs, talk) edited Benzil (diff, hist)
Deleted: 'NFPA-R' ('0' -> '', SET '0')
06:59:06 (2, 5, 5) (EDIT) User:Cesium 133 (contribs, talk) edited Benzil (diff, hist)
Deleted: 'Section8' ('{{Chembox Related' -> '', SET '{{Chembox Related')
06:59:06 (2, 5, 5) (EDIT) User:Cesium 133 (contribs, talk) edited Benzil (diff, hist)
Deleted: 'Function' ('[[diketone]]s' -> '', SET '[[diketone]]s')
06:59:07 (2, 5, 5) (EDIT) User:Cesium 133 (contribs, talk) edited Benzil (diff, hist)
Deleted: 'OtherFunctn' ('[[biacetyl]]' -> '', SET '[[biacetyl]]')
06:59:07 (4, 5, 5) (EDIT) User:Cesium 133 (contribs, talk) edited Benzil (diff, hist)
Deleted: 'BoilingPt' ('346- 348 Â°C, 654.8-658.4 Â°F, 619-621 K' -> '', SET '346- 348 Â°C, 654.8-658.4 Â°F, 619-621 K')
07:20:07 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Benzil (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
09:25:31 (4, 3, 5) (EDIT) User:CMBJ (contribs, talk) edited Hentriacontylic_acid (diff, hist)
Changed: 'PubChem' ('37982' -> '')
10:56:52 (4, 4, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Trichlorosilane (diff, hist)
Changed: 'Density' ('{{val|1.342|e=3|ul=kg/m3}}' -> '1.342 g/cm3', SET '1.342')
10:58:29 (4, 4, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Silicon_tetrachloride (diff, hist)
Changed: 'Density' ('{{val|1.483|e=3|ul=kg/m3}}' -> '1.483 g/cm3', SET '1.483 g cmâ3')
11:00:45 (2, 4, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Silicon_tetrachloride (diff, hist)
Changed: 'OtherNames' ('Silicon tetrachloride Tetrachlorosilicane' -> 'Silicon tetrachloride Tetrachlorosilane', SET 'Silicon(IV) chloride Silicon chloride')
11:56:05 (3, 2, 4) (EDIT) User:Dolomin (contribs, talk) edited Berberine (diff, hist)
Added links: http://www.ncbi.nlm.nih.gov/pubmed/20455200
12:20:35 (2, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Heptanoic_acid (diff, hist)
Added: 'Reference' ('' -> '<ref name=Merck>''[[Merck Index]]'', 11th Edition, '''4581'''</ref>', SET '')
12:20:35 (2, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Heptanoic_acid (diff, hist)
Added: 'OtherNames' ('' -> 'Enanthic acid; Oenanthic acid; ''n''-Heptylic acid; ''n''-Heptoic acid', SET '')
12:20:35 (2, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Heptanoic_acid (diff, hist)
Added: 'Appearance' ('' -> 'Oily liquid', SET '')
12:20:39 (2, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Heptanoic_acid (diff, hist)
Added: 'Solubility' ('' -> '0.2419 g/100 mL (15 Â°C)', SET '')
12:20:39 (4, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Heptanoic_acid (diff, hist)
Added: 'C' ('' -> '7', SET '')
12:20:39 (4, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Heptanoic_acid (diff, hist)
Added: 'H' ('' -> '14', SET '')
12:20:40 (4, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Heptanoic_acid (diff, hist)
Added: 'O' ('' -> '2', SET '')
12:20:40 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Heptanoic_acid (diff, hist)
Deleted: 'Formula' ('C7H14O2' -> '', SET 'C7H14O2')
12:20:40 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Heptanoic_acid (diff, hist)
Deleted: 'MolarMass' ('130.19 g/mol' -> '', SET '130.19 g/mol')
12:20:40 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Heptanoic_acid (diff, hist)
Changed: 'Density' ('0.910 g/cm3' -> '0.9181 g/cm3 (20 Â°C)', SET '0.910 g/cm3')
12:20:41 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Heptanoic_acid (diff, hist)
Changed: 'MeltingPtC' ('-10.5' -> '-7.5', SET '-10.5')
12:32:02 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Heptanoic_acid (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
12:34:30 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Hentriacontylic_acid (diff, hist)
Changed: 'ImageFile' ('' -> 'hentriacontanoic acid.png')
12:34:30 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Hentriacontylic_acid (diff, hist)
Changed: 'ImageSize' ('' -> '200px')
12:34:30 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Hentriacontylic_acid (diff, hist)
Changed: 'OtherNames' ('' -> 'Henatriacontylic acid; Henatriacontanoic acid')
12:34:30 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Hentriacontylic_acid (diff, hist)
Changed: 'C' ('' -> '31')
12:34:31 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Hentriacontylic_acid (diff, hist)
Changed: 'H' ('' -> '62')
12:34:31 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Hentriacontylic_acid (diff, hist)
Changed: 'O' ('' -> '2')
12:34:31 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Hentriacontylic_acid (diff, hist)
Changed: 'IUPACName' ('hentriacontanoic acid' -> 'Hentriacontanoic acid')
12:34:32 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Hentriacontylic_acid (diff, hist)
Changed: 'SMILES' ('' -> 'OC(CCCCCCCCCCCCCCCCCCCCCCCCCCCCCC)=O')
12:34:32 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Hentriacontylic_acid (diff, hist)
Changed: 'MeltingPt' ('' -> '109.3-109.6 Â°C<ref>{{Cite journal | author = Bowman, R. E. | journal = Journal of the Chemical Society | year = 1951 | pages = P2748-51}}</ref>')
12:34:32 (5, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Hentriacontylic_acid (diff, hist)
Changed: 'CASNo' ('' -> '38232-01-8')
12:40:29 (2, 2, 4) (EDIT) User:Beetstra (contribs, talk) edited Dipicolinic_acid (diff, hist)
Changed: 'InChIKey' ('' -> 'WJJMNDUMQPNECX-UHFFFAOYAM', SET 'WJJMNDUMQPNECX-UHFFFAOYAM')
12:40:29 (4, 2, 4) (EDIT) User:Beetstra (contribs, talk) edited Dipicolinic_acid (diff, hist)
Changed: 'SMILES' ('C1=CC(=NC(=C1)C(=O)O)C(=O)O' -> 'c1cc(nc(c1)C(=O)O)C(=O)O', SET 'c1cc(nc(c1)C(=O)O)C(=O)O')
12:40:30 (4, 2, 4) (EDIT) User:Beetstra (contribs, talk) edited Dipicolinic_acid (diff, hist)
Changed: 'InChI' ('' -> '1/C7H5NO4/c9-6(10)4-2-1-3-5(8-4)7(11)12/h1-3H,(H,9,10)(H,11,12)', SET '1/C7H5NO4/c9-6(10)4-2-1-3-5(8-4)7(11)12/h1-3H,(H,9,10)(H,11,12)')
12:40:30 (4, 2, 4) (EDIT) User:Beetstra (contribs, talk) edited Dipicolinic_acid (diff, hist)
Changed: 'ChemSpiderID' ('' -> '9940', SET '9940')
12:53:23 (3, 2, 4) (EDIT) User:219.119.212.101 (contribs, talk) edited Brilliant_Blue_FCF (diff, hist)
Added links: http://www.fluoron.de/downloads/0177_Brilliant%20Peel_Flyer_E.pdf
12:54:52 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Dipicolinic_acid (diff, hist)
Changed: 'verifiedrevid' ('299493314' -> '361463071', SET '299493314')
13:56:27 (4, 4, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Cobalt(II)_acetate (diff, hist)
Added: 'MeltingPt' ('' -> '140Â°C (loses water)', SET '')
13:56:28 (3, 2, 4) (EDIT) User:Chemicalinterest (contribs, talk) edited Cobalt(II)_acetate (diff, hist)
Added links: http://www.mallbaker.com/americas/msds/english/c4895_msds_us_default.pdf
14:02:39 (3, 3, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Cobalt_carbonate (diff, hist)
Changed: 'Appearance' ('' -> 'red crystalline powder')
14:02:40 (3, 3, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Cobalt_carbonate (diff, hist)
Changed: 'Solubility' ('' -> 'negligible')
14:02:41 (3, 3, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Cobalt_carbonate (diff, hist)
Changed: 'NFPA-H' ('' -> '1')
14:02:42 (3, 3, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Cobalt_carbonate (diff, hist)
Changed: 'NFPA-F' ('' -> '0')
14:02:42 (3, 2, 4) (EDIT) User:Chemicalinterest (contribs, talk) edited Cobalt_carbonate (diff, hist)
Added links: http://www.mallbaker.com/americas/msds/english/c4917_msds_us_default.pdf
14:10:19 (2, 4, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Cobalt(II)_chloride (diff, hist)
Changed: 'OtherNames' ('Cobaltous chloride' -> 'Cobaltous chloride Cobalt dichloride', SET 'Cobaltous chloride')
14:10:21 (2, 4, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Cobalt(II)_chloride (diff, hist)
Changed: 'Appearance' ('''see text''' -> 'rose red crystals (hexahydrate) blue crystals (anhydrous)', SET '''see text''')
14:10:25 (4, 4, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Cobalt(II)_chloride (diff, hist)
Changed: 'IUPACName' ('Cobalt(II) chloride Cobalt dichloride' -> 'Cobalt(II) chloride', SET 'Cobalt(II) chloride Cobalt dichloride')
14:20:39 (3, 2, 4) (EDIT) User:Chemicalinterest (contribs, talk) edited Cobalt(II,III)_oxide (diff, hist)
Added links: http://www.mallbaker.com/americas/msds/english/c4961_msds_us_default.pdf
14:59:34 (2, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Cycloheptane (diff, hist)
Added: 'ImageFile1' ('' -> 'cycloheptane.svg', SET '')
14:59:35 (2, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Cycloheptane (diff, hist)
Added: 'ImageSize1' ('' -> '100px', SET '')
14:59:35 (2, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Cycloheptane (diff, hist)
Added: 'ImageFileL2' ('' -> 'cycloheptane spheres.png', SET '')
14:59:36 (2, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Cycloheptane (diff, hist)
Added: 'ImageSizeL2' ('' -> '120px', SET '')
14:59:36 (2, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Cycloheptane (diff, hist)
Added: 'ImageFileR2' ('' -> 'cycloheptane sticks.png', SET '')
14:59:36 (2, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Cycloheptane (diff, hist)
Added: 'ImageSizeR2' ('' -> '120px', SET '')
14:59:37 (2, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Cycloheptane (diff, hist)
Deleted: 'ImageFile' ('cycloheptane.png' -> '', SET 'cycloheptane.png')
14:59:37 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Cycloheptane (diff, hist)
Added: 'C' ('' -> '7', SET '')
14:59:38 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Cycloheptane (diff, hist)
Added: 'H' ('' -> '14', SET '')
14:59:39 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Cycloheptane (diff, hist)
Deleted: 'Formula' (''''[[Carbon|C]]'''7'''[[Hydrogen|H]]'''14' -> '', SET ''''[[Carbon|C]]'''7'''[[Hydrogen|H]]'''14')
14:59:39 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Cycloheptane (diff, hist)
Deleted: 'MolarMass' ('98.19 g/mol' -> '', SET '98.19 g/mol')
14:59:39 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Cycloheptane (diff, hist)
Deleted: 'MeltingPt' ('-12 Â°C' -> '', SET '-12 Â°C')
14:59:40 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Cycloheptane (diff, hist)
Added: 'MeltingPtC' ('' -> '-12', SET '')
14:59:40 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Cycloheptane (diff, hist)
Deleted: 'BoilingPt' ('118.4 Â°C' -> '', SET '118.4 Â°C')
14:59:40 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Cycloheptane (diff, hist)
Added: 'BoilingPtC' ('' -> '118.4', SET '')
15:00:01 (2, 4, 5) (EDIT) User:Chemicalinterest (contribs, talk) edited Chromium(III)_oxide (diff, hist)
Changed: 'SolubleOther' ('insoluble' -> 'soluble in acids', SET 'insoluble')
15:52:43 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Cycloheptane (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
15:52:44 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Cycloheptane (diff, hist)
Added: 'verifiedrevid' ('' -> '309779804', SET '')
15:52:44 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Cycloheptane (diff, hist)
Added: 'CASNo_Ref' ('' -> '{{cascite}}', SET '')
17:07:22 (2, 4, 5) (EDIT) User:Ephemeronium (contribs, talk) edited Isoprene (diff, hist)
Added: 'ImageNameL1' ('' -> 'Skeletal formula', SET '')
17:07:22 (2, 4, 5) (EDIT) User:Ephemeronium (contribs, talk) edited Isoprene (diff, hist)
Added: 'ImageNameR1' ('' -> 'Space-filling model', SET '')
17:48:54 (2, 2, 4) (EDIT) User:V8rik (contribs, talk) edited Benzil (diff, hist)
Changed: 'Section2' ('{{Chembox Properties}}' -> '{{Chembox Properties', SET '{{Chembox Properties')
17:48:54 (2, 2, 4) (EDIT) User:V8rik (contribs, talk) edited Benzil (diff, hist)
Changed: 'Section3' ('' -> '{{Chembox Structure', SET '{{Chembox Structure')
17:48:55 (2, 2, 4) (EDIT) User:V8rik (contribs, talk) edited Benzil (diff, hist)
Changed: 'CrystalStruct' ('' -> 'P31,221<ref>''Acta Cryst.'' B43 398 (1987)</ref>', SET 'P31,221<ref>''Acta Cryst.'' B43 398 (1987)</ref>')
17:48:55 (2, 2, 4) (EDIT) User:V8rik (contribs, talk) edited Benzil (diff, hist)
Changed: 'Dipole' ('' -> '3.8 [[Debye|D]]<ref>''Spectrochim. Acta'' A60 (8-9) 1805 (2004)</ref>', SET '3.8 [[Debye|D]]<ref>''Spectrochim. Acta'' A60 (8-9) 1805 (2004)</ref>')
17:48:55 (2, 2, 4) (EDIT) User:V8rik (contribs, talk) edited Benzil (diff, hist)
Changed: 'Section7' ('' -> '{{Chembox Hazards', SET '{{Chembox Hazards')
17:48:55 (2, 2, 4) (EDIT) User:V8rik (contribs, talk) edited Benzil (diff, hist)
Changed: 'MainHazards' ('' -> '[[Irritant]]', SET '[[Irritant]]')
17:48:56 (2, 2, 4) (EDIT) User:V8rik (contribs, talk) edited Benzil (diff, hist)
Changed: 'NFPA-H' ('' -> '2', SET '2')
17:48:57 (2, 2, 4) (EDIT) User:V8rik (contribs, talk) edited Benzil (diff, hist)
Changed: 'NFPA-F' ('' -> '1', SET '1')
17:48:58 (2, 2, 4) (EDIT) User:V8rik (contribs, talk) edited Benzil (diff, hist)
Changed: 'NFPA-R' ('' -> '0', SET '0')
17:48:58 (2, 2, 4) (EDIT) User:V8rik (contribs, talk) edited Benzil (diff, hist)
Changed: 'Section8' ('' -> '{{Chembox Related', SET '{{Chembox Related')
17:48:59 (2, 2, 4) (EDIT) User:V8rik (contribs, talk) edited Benzil (diff, hist)
Changed: 'Function' ('' -> '[[diketone]]s', SET '[[diketone]]s')
17:48:59 (2, 2, 4) (EDIT) User:V8rik (contribs, talk) edited Benzil (diff, hist)
Changed: 'OtherFunctn' ('' -> '[[biacetyl]]', SET '[[biacetyl]]')
17:48:59 (4, 2, 4) (EDIT) User:V8rik (contribs, talk) edited Benzil (diff, hist)
Changed: 'BoilingPt' ('' -> '346- 348 Â°C, 654.8-658.4 Â°F, 619-621 K', SET '346- 348 Â°C, 654.8-658.4 Â°F, 619-621 K')
18:44:05 (2, 3, 4) (EDIT) User:Yikrazuul (contribs, talk) edited Hentriacontylic_acid (diff, hist)
Changed: 'ImageFile' ('hentriacontanoic acid.png' -> 'Melissic acid.svg')
18:44:06 (2, 3, 4) (EDIT) User:Yikrazuul (contribs, talk) edited Hentriacontylic_acid (diff, hist)
Changed: 'ImageSize' ('200px' -> '300px')
18:44:08 (2, 3, 4) (EDIT) User:Yikrazuul (contribs, talk) edited Hentriacontylic_acid (diff, hist)
Changed: 'OtherNames' ('Henatriacontylic acid; Henatriacontanoic acid' -> 'Melissic acid; Henatriacontylic acid; Henatriacontanoic acid')
18:44:09 (4, 3, 4) (EDIT) User:Yikrazuul (contribs, talk) edited Hentriacontylic_acid (diff, hist)
Changed: 'PubChem' ('' -> '37982')
18:56:03 (4, 4, 5) (EDIT) User:207.165.135.22 (contribs, talk) edited Cumene (diff, hist)
Changed: 'SMILES' ('CC(C)c1ccccc1' -> 'CC(C)c1ccwill', SET 'CC(C)c1ccccc1')
19:12:37 (3, 2, 4) (EDIT) User:70.240.99.113 (contribs, talk) edited TCEP (diff, hist)
Added links: http://polyorganix.com/productsubcat.php?category=VENFUCBwcm9kdWN0cw==&catid=17
19:25:25 (3, 2, 4) (EDIT) User:Tetracube (contribs, talk) edited Benzene (diff, hist)
Added links: http://www.epa.gov/EPA-AIR/2006/March/Day-29/a2315b.htm
19:29:16 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Benzil (diff, hist)
Changed: 'Watchedfields' ('changed' -> '', SET '')
19:43:24 (3, 2, 4) (EDIT) User:Immunize (contribs, talk) edited DDT (diff, hist)
Added links: http://pubs.acs.org/cgi-bin/abstract.cgi/esthag/asap/abs/es702919n.html, http://www.atsdr.cdc.gov/toxprofiles/tp35.html, http://www.al.com/news/mobileregister/index.ssf?/base/news/1215162908145190.xml&coll=3, http://www.deq.state.or.us/lq/ECSI/ecsidetail.asp?seqnbr=398, http://www.themorningsun.com/stories/012708/loc_tests.shtml, http://www.epa.gov/history/topics/ddt/02.htm, http://www.pops.int/documents/ddt/Global%20status%20of%20DDT%20SSC%2020Oct08.pdf
19:53:11 (3, 2, 4) (EDIT) User:ChemE50 (contribs, talk) edited Tetryl (diff, hist)
Added links: http://smallwarsjournal.com/documents/terrorismhandbook.pdf.
20:37:49 (2, 3, 5) (EDIT) User:Nippoo (contribs, talk) edited Iodine_heptafluoride (diff, hist)
Changed: 'Name' ('Iodine Heptafloride' -> 'Iodine heptafluoride')
21:00:53 (4, 3, 4) (EDIT) User:Nono64 (contribs, talk) edited Malvin (diff, hist)
Changed: 'ExactMass' ('' -> '655.187425')
22:11:29 (3, 2, 4) (EDIT) User:Vrmoniak (contribs, talk) edited Coenzyme_Q10 (diff, hist)
Added links: http://www.naturalmedicinejournal.com/pdf/NMJ_JAN10_NaPh.pdf
22:42:40 (3, 2, 4) (EDIT) User:Wendetha (contribs, talk) edited 1,1-Difluoroethane (diff, hist)
Added links: http://www.ncbi.nlm.nih.gov/pubmed/16501351
22:59:00 (3, 2, 4) (EDIT) User:Wendetha (contribs, talk) edited 1,1-Difluoroethane (diff, hist)
Added links: http://www.ncbi.nlm.nih.gov/sites/entrez, http://www.ncbi.nlm.nih.gov/sites/entrez
23:00:54 (3, 2, 4) (EDIT) User:Mehcp (contribs, talk) edited Acetonitrile (diff, hist)
Added links: http://www.proteochem.com/lcmsacetonitrile1l-p-209.html
23:05:20 (3, 2, 4) (EDIT) User:Wendetha (contribs, talk) edited 1,1-Difluoroethane (diff, hist)
Added links: http://www.ncbi.nlm.nih.gov/pubmed/9397568, http://www.ncbi.nlm.nih.gov/pubmed/17132266
23:05:22 (3, 2, 4) (EDIT) User:Mehcp (contribs, talk) edited Methanol (diff, hist)
Added links: http://www.proteochem.com/lcmsmethanol1l-p-210.html