<- User:Beetstra/listing15 - User:Beetstra/Validation - User:Beetstra/listing17 ->

Data edit

3751 to 3800 edit

Digitoxigenin (3751)
```
Botcommand: addindex 360782628 Digitoxigenin
```
```
For index : Digitoxigenin=360782628
```
* 143-62-4 -> 143-62-4 - NOT VERIFIED

* CAS found on commonchemistry - 143-62-4 - name in list
All names: (+)-Digitoxigenin, 3-╬▓,14-dihidroxi-5-╬▓,14-╬▓-card-20(22)-enolido, 3-╬▓,14-Dihydroxy-5-╬▓,14-╬▓-card-20(22)-enolid, 3-╬▓,14-dihydroxy-5-╬▓,14-╬▓-card-20(22)-enolide, 5╬▓-Card-20(22)-enolide, 3╬▓,14-dihydroxy-, Card-20(22)-enolide, 3,14-dihydroxy-, (3╬▓,5╬▓)-, Digitoxigenin, NSC 407806, ╬ö20:22-3,14,21-Trihydroxynorcholenic acid lactone

* Digitoxigenin found on commonchemistry - Digitoxigenin
* 143-62-4 (Formula: C23H34O4; Name: Card-20(22)-enolide, 3,14-dihydroxy-, (3╬▓,5╬▓)-) Matches CAS (143-62-4) on page

* 71-63-6 (Formula: C41H64O13; Name: Card-20(22)-enolide, 3-[(O-2,6-dideoxy-╬▓-D-ribo-hexopyranosyl-(1ÔåÆ4)-O-2,6-dideoxy-╬▓-D-ribo-hexopyranosyl-(1ÔåÆ4)-2,6-dideoxy-╬▓-D-ribo-hexopyranosyl)oxy]-14-hydroxy-, (3╬▓,5╬▓)-)

* 1672-46-4 (Formula: C23H34O5; Name: Card-20(22)-enolide, 3,12,14-trihydroxy-, (3╬▓,5╬▓,12╬▓)-)

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C24(C(C(C1=CC(=O)OC1)CC2)(CCC5C3(CCC(CC3CCC45)O)C)C)O
Diglycolic_acid (3753)
```
Botcommand: addindex 265859081 Diglycolic_acid
```
```
For index : Diglycolic_acid=265859081
```
* 110-99-6 -> 110-99-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Diglycolic+acid not found on commonchemistry - Diglycolic+acid

* No ChemSpiderID

* PubChem: 8088

* No InChI

* SMILES: C(C(=O)O)OCC(=O)O
Digoxin_Immune_Fab (3757)
* No CASNo

* Digoxin+Immune+Fab not found on commonchemistry - Digoxin+Immune+Fab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dihexyverine (3758)
```
Botcommand: addindex 348540056 Dihexyverine
```
```
For index : Dihexyverine=348540056
```
* 561-77-3 -> 561-77-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihexyverine not found on commonchemistry - Dihexyverine

* No ChemSpiderID

* PubChem: 21788

* No InChI

* No SMILES
Dihydralazine (3760)
```
Botcommand: addindex 353871880 Dihydralazine
```
```
For index : Dihydralazine=353871880
```
* 484-23-1 -> 484-23-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydralazine not found on commonchemistry - Dihydralazine

* No ChemSpiderID (correct: 9813)

* PubChem: 10230

* No InChI

* No SMILES
Dihydrexidine (3761)
```
Botcommand: addindex 360261595 Dihydrexidine
```
```
For index : Dihydrexidine=360261595
```
* 137417-08-4 -> 137417-08-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydrexidine not found on commonchemistry - Dihydrexidine

* No ChemSpiderID

* PubChem: 5311070

* No InChI

* No SMILES
Dihydroactinidiolide (3762)
```
Botcommand: addindex 355645975 Dihydroactinidiolide
```
```
For index : Dihydroactinidiolide=355645975
```
* 17092-92-1 -> 17092-92-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydroactinidiolide not found on commonchemistry - Dihydroactinidiolide

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C2O[C@]1(C)CCCC(C)(C)C1=C2
Dihydroartemisinin (3763)
```
Botcommand: addindex 350586859 Dihydroartemisinin
```
```
For index : Dihydroartemisinin=350586859
```
* 71939-50-9 -> 71939-50-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydroartemisinin not found on commonchemistry - Dihydroartemisinin

* No ChemSpiderID (correct: 96929)

* PubChem: 456410

* No InChI

* SMILES: C[C@@H]1CC[C@H]2[C@H](C(O[C@H]3[C@@]24[C@H]1CC[C@](O3)(OO4)C)O)C
Dihydrobiopterin (3764)
```
Botcommand: addindex 289172984 Dihydrobiopterin
```
```
For index : Dihydrobiopterin=289172984
```
* 6779-87-9 -> 6779-87-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydrobiopterin not found on commonchemistry - Dihydrobiopterin

* No ChemSpiderID

* PubChem: 252

* No InChI

* SMILES: CC(C(C1=NC2=C(NC1)NC(=NC2=O)N)O)O
Dihydrocapsaicin (3765)
```
Botcommand: addindex 349495408 Dihydrocapsaicin
```
```
For index : Dihydrocapsaicin=349495408
```
* 19408-84-5 -> 19408-84-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydrocapsaicin not found on commonchemistry - Dihydrocapsaicin

* No ChemSpiderID

* PubChem: 107982

* No InChI

* SMILES: CC(C)CCCCCCC(=O)NCC1=CC(=C(C=C1)O)OC
Dihydrochalcone (3766)

* No CASNo

* Dihydrochalcone found on commonchemistry - Dihydrochalcone
* 60-82-2 (exact match)
Name in list

All names: 1-Propanone, 3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)-, 2',4',6'-Trihydroxy-3-(4-Hydroxyphenyl)propiophenone, 2',4',6'-Trihydroxy-3-(p-hydroxyphenyl)propiophenone, 3-(4-hidroxifenil)-1-(2,4,6-trihidroxifenil)propan-1-ona, 3-(4-Hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)-1-propanone, 3-(4-Hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-on, 3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one, 3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)propane-1-one, Dihydronaringenin, Floretin, [[Naringenin dihydrochalcone]], NSC 407292, Phloretin, Phloretol, Propiophenone, 2',4',6'-trihydroxy-3-(p-hydroxyphenyl)-, ╬▓-(p-Hydroxyphenyl)-2,4,6-trihydroxypropiophenone, ╬▓-(p-Hydroxyphenyl)phloropropiophenone

* No ChemSpiderID

* PubChem: 64802

* No InChI

* SMILES: C1=CC=C(C=C1)CCC(=O)C2=CC=CC=C2
Dihydrocodeine (3767)
```
Botcommand: addindex 364532423 Dihydrocodeine
```
```
For index : Dihydrocodeine=364532423
```
* 125-28-0 -> 125-28-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydrocodeine found on commonchemistry - Dihydrocodeine
* 76-42-6 (Formula: C18H21NO4; Name: Morphinan-6-one, 4,5-epoxy-14-hydroxy-3-methoxy-17-methyl-, (5╬▒)-)

* 125-29-1 (Formula: C18H21NO3; Name: Morphinan-6-one, 4,5-epoxy-3-methoxy-17-methyl-, (5╬▒)-)

* No ChemSpiderID (correct: 4447600)

* PubChem: 6426647

* No InChI

* No SMILES
Dihydrocortisone (3768)

* No CASNo

* Dihydrocortisone not found on commonchemistry - Dihydrocortisone

* ChemSpiderID: 58997 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* No InChI - (ChemSpider: | InChI=InChI=1/C21H30O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h12,14-15,18,22,26H,3-11H2,1-2H3/t12-,14+,15+,18-,19+,20+,21+/m1/s1 )

* SMILES: O=C3C[C@@]1([C@@](O)(C(=O)CO)CC[C@H]1[C@@H]4CC[C@@H]2CC(=O)CC[C@]2(C)[C@@H]34)C - (ChemSpider: | SMILES=O=C3C[C@@]1([C@@](O)(C(=O)CO)CC[C@H]1[C@@H]4CC[C@@H]2CC(=O)CC[C@]2(C)[C@@H]34)C )
Dihydroergocornine (3769)
```
Botcommand: addindex 290224253 Dihydroergocornine
```
```
For index : Dihydroergocornine=290224253
```
* 25447-65-8 -> 25447-65-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydroergocornine not found on commonchemistry - Dihydroergocornine

* No ChemSpiderID

* PubChem: 168871

* InChI: 1/C31H41N5O5/c1-16(2)26-28(38)35-11-7-10-24(35)31(40)36(26) 29(39)30(41-31,17(3)4)33-27(37)19-12-21-20-8-6-9-22-25(20)18(14-3 2-22)13-23(21)34(5)15-19/h6,8-9,14,16-17,19,21,23-24,26,32,40H,7, 10-13,15H2,1-5H3,(H,33,37)/t19-,21-,23-,24+,26+,30-,31+/m1/s1

* SMILES: CC(C)C1C(=O)N2CCCC2C3(N1C(=O)C(O3)(C(C)C)NC(=O)C4CC5C(CC6=CNC7=CC=CC5=C67)N(C4)C)O
Dihydroergocristine (3770)
```
Botcommand: addindex 360223200 Dihydroergocristine
```
```
For index : Dihydroergocristine=360223200
```
* 17479-19-5 -> 17479-19-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydroergocristine not found on commonchemistry - Dihydroergocristine

* ChemSpiderID: 96884 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 3065

* InChI: 1/C35H41N5O5/c1-20(2)34(37-31(41)23-16-25-24-11-7-12-26-30( 24)22(18-36-26)17-27(25)38(3)19-23)33(43)40-28(15-21-9-5-4-6-10-2 1)32(42)39-14-8-13-29(39)35(40,44)45-34/h4-7,9-12,18,20,23,25,27- 29,36,44H,8,13-17,19H2,1-3H3,(H,37,41)/t23-,25-,27-,28+,29+,34-,3 5+/m1/s1 - (ChemSpider: | InChI=InChI=1/C35H41N5O5/c1-20(2)34(37-31(41)23-16-25-24-11-7-12-26-30(24)22(18-36-26)17-27(25)38(3)19-23)33(43)40-28(15-21-9-5-4-6-10-21)32(42)39-14-8-13-29(39)35(40,44)45-34/h4-7,9-12,18,20,23,25,27-29,36,44H,8,13-17,19H2,1-3H3,(H,37,41)/t23-,25-,27-,28+,29+,34-,35+/m1/s1 )

* SMILES: O=C3N1CCC[C@H]1[C@]2(O)O[C@](C(=O)N2[C@H]3Cc4ccccc4)(NC(=O)[C@@H]7C[C@@H]8c5cccc6c5c(cn6)C[C@H]8N(C)C7)C(C)C - (ChemSpider: | SMILES=O=C3N1CCC[C@H]1[C@]2(O)O[C@](C(=O)N2[C@H]3Cc4ccccc4)(NC(=O)[C@@H]7C[C@@H]8c5cccc6c5c(cn6)C[C@H]8N(C)C7)C(C)C )
Dihydroergocryptine (3771)
```
Botcommand: addindex 354300293 Dihydroergocryptine
```
```
For index : Dihydroergocryptine=354300293
```
* 25447-66-9 -> 25447-66-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydroergocryptine not found on commonchemistry - Dihydroergocryptine

* No ChemSpiderID (correct: 102887)

* PubChem: 114948

* No InChI

* No SMILES
Dihydroergotamine (3772)
```
Botcommand: addindex 362751435 Dihydroergotamine
```
```
For index : Dihydroergotamine=362751435
```
* 511-12-6 -> 511-12-6 - NOT VERIFIED

* CAS found on commonchemistry - 511-12-6 - name in list
All names: 9,10-Dihydroergotamine, DHE, dihidroergotamina, Dihydroergotamin, dihydroergotamine, Ergotaman-3',6',18-trione, 9,10-dihydro-12'-hydroxy-2'-methyl-5'-(phenylmethyl)-, (5'╬▒,10╬▒)-, Ergotaman-3',6',18-trione, 9,10-dihydro-12'-hydroxy-2'-methyl-5'-(phenylmethyl)-, (5'╬▒,10╬▒)-, Ergotamine, 9,10-dihydro-

* Dihydroergotamine found on commonchemistry - Dihydroergotamine
* 511-12-6 (Formula: C33H37N5O5; Name: Ergotaman-3',6',18-trione, 9,10-dihydro-12'-hydroxy-2'-methyl-5'-(phenylmethyl)-, (5'╬▒,10╬▒)-) Matches CAS (511-12-6) on page

* 6190-39-2 (Formula: C33H37N5O5.CH4O3S; Name: Ergotaman-3',6',18-trione, 9,10-dihydro-12'-hydroxy-2'-methyl-5'-(phenylmethyl)-, (5'╬▒,10╬▒)-, monomethanesulfonate (salt))

* No ChemSpiderID (correct: 10091)

* PubChem: 10531

* No InChI

* No SMILES
Dihydroetorphine (3773)
```
Botcommand: addindex 359682316 Dihydroetorphine
```
```
For index : Dihydroetorphine=359682316
```
* 14357-76-7 -> 14357-76-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydroetorphine not found on commonchemistry - Dihydroetorphine

* No ChemSpiderID (correct: 96924)

* PubChem: 107765

* No InChI

* No SMILES
Dihydrofolic_acid (3774)
```
Botcommand: addindex 359303568 Dihydrofolic_acid
```
```
For index : Dihydrofolic_acid=359303568
```
* 4033-27-6 -> 4033-27-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydrofolic+acid found on commonchemistry - Dihydrofolic+acid
* 58-05-9 (exact match)
Name in list

All names: (6R,S)-5-Formyltetrahydrofolate, [[10-Formyl-7,8-dihydrofolic acid]], 5-Formyl-5,6,7,8-tetrahydrofolic acid, 5-formyltetrahydrofolic acid, 5-Formyltetrahydrofolsaure, 5-Formyltetrahydropteroylglutamic acid, acide 5-formyltetrahydrofolique, acido 5-formiltetrahidrofolico, CF, Folinic acid, Folinic acid-SF, [[Glutamic acid, N-[p-[[(2-amino-5-formyl-5,6,7,8-tetrahydro-4-hydroxy-6-pteridinyl)methyl]amino]benzoyl]-, L-]], Leucal, Leucoverin, Leucovorin, Levoleucovorin, [[L-Glutamic acid, N-[4-[[(2-amino-5-formyl-1,4,5,6,7,8-hexahydro-4-oxo-6-pteridinyl)methyl]amino]benzoyl]-]], [[L-Glutamic acid, N-[4-[[(2-amino-5-formyl-3,4,5,6,7,8-hexahydro-4-oxo-6-pteridinyl)methyl]amino]benzoyl]-]], l-Leucovorin, N5-Formyl-5,6,7,8-tetrahydrofolic acid, N5-Formyltetrahydrofolic acid, Welcovorin

* No ChemSpiderID

* PubChem: 661

* No InChI

* No SMILES
Dihydrogossypetin (3775)
```
Botcommand: addindex 316497005 Dihydrogossypetin
```
```
For index : Dihydrogossypetin=316497005
```
* 489-35-0 -> 489-35-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydrogossypetin not found on commonchemistry - Dihydrogossypetin

* No ChemSpiderID

* PubChem: 5460097

* No InChI

* SMILES: C1=CC(=C(C=C1C2C(C(=O)C3=C(O2)C(=C(C=C3O)O)O)O)O)O C1=CC(=C(C=C1[C@@H]2C(C(=O)C3=C(O2)C(=C(C=C3O)O)O)O)O)O
Dihydrokaempferide (3776)
```
Botcommand: addindex 316497116 Dihydrokaempferide
```
```
For index : Dihydrokaempferide=316497116
```
* 3570-69-2 -> 3570-69-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydrokaempferide not found on commonchemistry - Dihydrokaempferide

* No ChemSpiderID

* PubChem: 586387

* No InChI

* SMILES: COC1=CC=C(C=C1)C2C(C(=O)C3=C(C=C(C=C3O2)O)O)O
Dihydrolipoamide (3777)
```
Botcommand: addindex 265836184 Dihydrolipoamide
```
```
For index : Dihydrolipoamide=265836184
```
* 3884-47-7 -> 3884-47-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydrolipoamide found on commonchemistry - Dihydrolipoamide
* 9001-18-7 (exact match)
Name in list

All names: Dehydrogenase, Lipoamid-, Dehydrogenase, lipoamide, deshidrogenasa, lipoamida, deshydrogenase, lipoamide, Diaphorase, [[dihydrolipoamide dehydrogenase]], Dihydrolipoate dehydrogenase, Dihydrolipoic dehydrogenase, Dihydrolipoyl dehydrogenase, Dihydrothioctic dehydrogenase, E.C. 1.6.4.3, E.C. 1.8.1.4, Lipoamide dehydrogenase, Lipoamide dehydrogenase (NADH), Lipoamide oxidoreductase, Lipoamide reductase, Lipoate dehydrogenase, Lipoic acid dehydrogenase, Lipoyl dehydrogenase, ╬▒-Lipoamide dehydrogenase

* ChemSpiderID: 643 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 663

* No InChI - (ChemSpider: | InChI=InChI=1/C8H17NOS2/c9-8(10)4-2-1-3-7(12)5-6-11/h7,11-12H,1-6H2,(H2,9,10) )

* No SMILES - (ChemSpider: | SMILES=O=C(N)CCCCC(S)CCS )
Dihydrolipoic_acid (3778)
```
Botcommand: addindex 278494937 Dihydrolipoic_acid
```
```
For index : Dihydrolipoic_acid=278494937
```
* 462-20-4 -> 462-20-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydrolipoic+acid not found on commonchemistry - Dihydrolipoic+acid

* ChemSpiderID: 408 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 421

* No InChI - (ChemSpider: | InChI=InChI=1/C8H16O2S2/c9-8(10)4-2-1-3-7(12)5-6-11/h7,11-12H,1-6H2,(H,9,10) )

* SMILES: C(CCC(=O)O)CC(CCS)S - (ChemSpider: | SMILES=O=C(O)CCCCC(S)CCS )
Dihydromorin (3779)
```
Botcommand: addindex 311062786 Dihydromorin
```
```
For index : Dihydromorin=311062786
```
* 18422-83-8 -> 18422-83-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydromorin not found on commonchemistry - Dihydromorin

* No ChemSpiderID

* PubChem: 5458714

* No InChI

* SMILES: C1=CC(=C(C=C1O)O)C2C(C(=O)C3=C(C=C(C=C3O2)O)O)O
Dihydromorphine (3780)
```
Botcommand: addindex 360228139 Dihydromorphine
```
```
For index : Dihydromorphine=360228139
```
* 1421-28-9 -> 1421-28-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydromorphine not found on commonchemistry - Dihydromorphine

* No ChemSpiderID (correct: 4514282)

* PubChem: 273032

* No InChI

* No SMILES
Dihydropteroate (3781)
```
Botcommand: addindex 332256932 Dihydropteroate
```
```
For index : Dihydropteroate=332256932
```
* 2134-76-1 -> 2134-76-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydropteroate not found on commonchemistry - Dihydropteroate

* ChemSpiderID: 165 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 170

* No InChI - (ChemSpider: | InChI=InChI=1/C14H14N6O3/c15-14-19-11-10(12(21)20-14)18-9(6-17-11)5-16-8-3-1-7(2-4-8)13(22)23/h1-4,16H,5-6H2,(H,22,23)(H4,15,17,19,20,21) )

* SMILES: C1C(=NC2=C(N1)NC(=NC2=O)N) CNC3=CC=C(C=C3)C(=O)O - (ChemSpider: | SMILES=O=C(O)c1ccc(cc1)NCC/2=N/C=3C(=O)\N=C(/NC=3NC\2)N )
Dihydropyridine (3782)
```
Botcommand: addindex 363159920 Dihydropyridine
```
```
For index : Dihydropyridine=363159920
```
* 3337-17-5 -> 3337-17-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydropyridine found on commonchemistry - Dihydropyridine
* 21829-25-4 (Formula: C17H18N2O6; Name: 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(2-nitrophenyl)-, dimethyl ester)

* 88150-42-9 (Formula: C20H25ClN2O5; Name: 3,5-Pyridinedicarboxylic acid, 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-, 3-ethyl 5-methyl ester)

* No ChemSpiderID (correct: 94619)

* PubChem: 104822

* No InChI

* SMILES: C1C=CNC=C1
Dihydroquinidine (3783)
```
Botcommand: addindex 343510953 Dihydroquinidine
```
```
For index : Dihydroquinidine=343510953
```
* 1435-55-8 -> 1435-55-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydroquinidine not found on commonchemistry - Dihydroquinidine

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dihydroquinine (3784)
```
Botcommand: addindex 343510980 Dihydroquinine
```
```
For index : Dihydroquinine=343510980
```
* 522-66-7 -> 522-66-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydroquinine not found on commonchemistry - Dihydroquinine

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dihydrosanguinarine (3785)
```
Botcommand: addindex 361663198 Dihydrosanguinarine
```
```
For index : Dihydrosanguinarine=361663198
```
* 3606-45-9 -> 3606-45-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydrosanguinarine not found on commonchemistry - Dihydrosanguinarine

* No ChemSpiderID

* PubChem: 124069

* No InChI

* SMILES: CN1CC2=C(C=CC3=C2OCO3)C4=C1C5=CC6=C(C=C5C=C4)OCO6
Dihydrostreptomycin (3786)
```
Botcommand: addindex 297938901 Dihydrostreptomycin
```
```
For index : Dihydrostreptomycin=297938901
```
* 128-46-1 -> 128-46-1 - NOT VERIFIED

* CAS found on commonchemistry - 128-46-1 - name in list
All names: 2,4-Diguanidino-3,5,6-trihydroxycyclohexyl-5-deoxy-2-O-(2-deoxy-2-methylamino-╬▒-L-glucopyranosyl)-3-hydroxymethyl-╬▓-L-lyxo-pentanofuranoside, Abiocine, DHSM, dihidroestreptomicina, dihydrostreptomycin, dihydrostreptomycine, DST, D-Streptamine, O-2-deoxy-2-(methylamino)-╬▒-L-glucopyranosyl-(1ÔåÆ2)-O-5-deoxy-3-C-(hydroxymethyl)-╬▒-L-lyxofuranosyl-(1ÔåÆ4)-N,N'-bis(aminoiminomethyl)-, D-Streptamine, O-2-deoxy-2-(methylamino)-╬▒-L-glucopyranosyl-(1ÔåÆ2)-O-5-deoxy-3-C-(hydroxymethyl)-╬▒-L-lyxofuranosyl-(1ÔåÆ4)-N,N'-bis(aminoiminomethyl)-, D-Streptamine, O-2-deoxy-2-(methylamino)-╬▒-L-glucopyranosyl-(1ÔåÆ2)-O-5-deoxy-3-C-(hydroxymethyl)-╬▒-L-lyxofuranosyl-(1ÔåÆ4)-N1,N3-bis(aminoiminomethyl)-, Streptomycin, deoxydihydrohydroxy-, Streptomycin, dihydro-, Vibriomycin

* Dihydrostreptomycin found on commonchemistry - Dihydrostreptomycin
* 128-46-1 (exact match) Matches CAS (128-46-1) on page
Name in list

All names: 2,4-Diguanidino-3,5,6-trihydroxycyclohexyl-5-deoxy-2-O-(2-deoxy-2-methylamino-╬▒-L-glucopyranosyl)-3-hydroxymethyl-╬▓-L-lyxo-pentanofuranoside, Abiocine, DHSM, dihidroestreptomicina, [[dihydrostreptomycin]], [[dihydrostreptomycine]], DST, D-Streptamine, O-2-deoxy-2-(methylamino)-╬▒-L-glucopyranosyl-(1ÔåÆ2)-O-5-deoxy-3-C-(hydroxymethyl)-╬▒-L-lyxofuranosyl-(1ÔåÆ4)-N,N'-bis(aminoiminomethyl)-, D-Streptamine, O-2-deoxy-2-(methylamino)-╬▒-L-glucopyranosyl-(1ÔåÆ2)-O-5-deoxy-3-C-(hydroxymethyl)-╬▒-L-lyxofuranosyl-(1ÔåÆ4)-N,N'-bis(aminoiminomethyl)-, D-Streptamine, O-2-deoxy-2-(methylamino)-╬▒-L-glucopyranosyl-(1ÔåÆ2)-O-5-deoxy-3-C-(hydroxymethyl)-╬▒-L-lyxofuranosyl-(1ÔåÆ4)-N1,N3-bis(aminoiminomethyl)-, Streptomycin, deoxydihydrohydroxy-, Streptomycin, dihydro-, Vibriomycin

* No ChemSpiderID

* PubChem: 439369

* No InChI

* No SMILES
Dihydrothymine (3789)
```
Botcommand: addindex 338871333 Dihydrothymine
```
```
For index : Dihydrothymine=338871333
```
* 696-04-8 -> 696-04-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydrothymine not found on commonchemistry - Dihydrothymine

* No ChemSpiderID

* PubChem: 93556

* No InChI

* SMILES: CC1CNC(=O)NC1=O
Dihydrouracil (3790)
```
Botcommand: addindex 341575658 Dihydrouracil
```
```
For index : Dihydrouracil=341575658
```
* 504-07-4 -> 504-07-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydrouracil not found on commonchemistry - Dihydrouracil

* No ChemSpiderID

* PubChem: 649

* No InChI

* SMILES: C1CNC(=O)NC1=O
Dihydrouridine (3791)
```
Botcommand: addindex 336409878 Dihydrouridine
```
```
For index : Dihydrouridine=336409878
```
* 5627-05-4 -> 5627-05-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydrouridine not found on commonchemistry - Dihydrouridine

* No ChemSpiderID

* PubChem: 94312

* No InChI

* SMILES: C1CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O
Dihydroxialumini_sodium_carbonate (3792)
* No CASNo

* Dihydroxialumini+sodium+carbonate not found on commonchemistry - Dihydroxialumini+sodium+carbonate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dihydroxymalonic_acid (3795)

* No CASNo

* Dihydroxymalonic+acid not found on commonchemistry - Dihydroxymalonic+acid

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dihydroxyphenylethylene_glycol (3796)
```
Botcommand: addindex 265871722 Dihydroxyphenylethylene_glycol
```
```
For index : Dihydroxyphenylethylene_glycol=265871722
```
* 3343-19-9 -> 3343-19-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydroxyphenylethylene+glycol not found on commonchemistry - Dihydroxyphenylethylene+glycol

* No ChemSpiderID

* PubChem: 91528

* No InChI

* SMILES: C1=CC(=C(C=C1C(CO)O)O)O
Dihydroxyphenylglycine (3797)
```
Botcommand: addindex 299445593 Dihydroxyphenylglycine
```
```
For index : Dihydroxyphenylglycine=299445593
```
* 162870-29-3 -> 162870-29-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Dihydroxyphenylglycine not found on commonchemistry - Dihydroxyphenylglycine

* No ChemSpiderID

* PubChem: 5310986

* No InChI

* SMILES: C1=CC(=C(C=C1[C@@H](C(=O)O)N)O)O
Diindenoperylene (3798)
```
Botcommand: addindex 354052182 Diindenoperylene
```
```
For index : Diindenoperylene=354052182
```
* 188-94-3 -> 188-94-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Diindenoperylene not found on commonchemistry - Diindenoperylene

* No ChemSpiderID

* PubChem: 96712

* No InChI

* SMILES: C1=CC2=C3C=CC4=C5C=CC6=C7C=CC=CC7=C8C6=C5C(=C9C4=C3C(=C2C=C1)C=C9)C=C8
Diiodohydroxypropane (3799)
```
Botcommand: addindex 279476511 Diiodohydroxypropane
```
```
For index : Diiodohydroxypropane=279476511
```
* 534-08-7 -> 534-08-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Diiodohydroxypropane not found on commonchemistry - Diiodohydroxypropane

* No ChemSpiderID

* PubChem: 68295

* No InChI

* SMILES: C(C(CI)O)I
Diiodohydroxyquinoline (3800)
```
Botcommand: addindex 359806438 Diiodohydroxyquinoline
```
```
For index : Diiodohydroxyquinoline=359806438
```
* 83-73-8 -> 83-73-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Diiodohydroxyquinoline not found on commonchemistry - Diiodohydroxyquinoline

* No ChemSpiderID

* PubChem: 3728

* No InChI

* SMILES: C1=CC2=C(C(=C(C=C2I)I)O)N=C1

3801 to 3850 edit

Diiodotyrosine (3802)
```
Botcommand: addindex 357110442 Diiodotyrosine
```
```
For index : Diiodotyrosine=357110442
```
* 66-02-4 -> 66-02-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Diiodotyrosine not found on commonchemistry - Diiodotyrosine

* No ChemSpiderID

* PubChem: 6181

* No InChI

* No SMILES
Diisoheptyl_phthalate (3806)
```
Botcommand: addindex 307738793 Diisoheptyl_phthalate
```
```
For index : Diisoheptyl_phthalate=307738793
```
* 41451-28-9 -> 41451-28-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Diisoheptyl+phthalate not found on commonchemistry - Diisoheptyl+phthalate

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: variable
Diisopinocampheylborane (3808)
```
Botcommand: addindex 362782163 Diisopinocampheylborane
```
```
For index : Diisopinocampheylborane=362782163
```
* 21947-87-5 -> 21947-87-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Diisopinocampheylborane not found on commonchemistry - Diisopinocampheylborane

* No ChemSpiderID

* No PubChem

* InChI: InChI=1/C20H35B/c1-11-15-7-13(19(15,3)4)9-17(11)21-18-10-14-8-16(12(18)2)20(14,5)6/h11-18,21H,7-10H2,1-6H3/t11?,12?,13-,14+,15+,16-,17?,18?

* SMILES: [H]B(C1CC2CC(C1(C))C2(C)(C))C3CC4CC(C3(C))C4(C)(C)
Diisopromine (3809)
```
Botcommand: addindex 348542450 Diisopromine
```
```
For index : Diisopromine=348542450
```
* 5966-41-6 -> 5966-41-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Diisopromine not found on commonchemistry - Diisopromine

* No ChemSpiderID (correct: 20899)

* PubChem: 22262

* No InChI

* No SMILES
Diisopropyl_azodicarboxylate (3810)
```
Botcommand: addindex 290016244 Diisopropyl_azodicarboxylate
```
```
For index : Diisopropyl_azodicarboxylate=290016244
```
* 2446-83-5 -> 2446-83-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Diisopropyl+azodicarboxylate not found on commonchemistry - Diisopropyl+azodicarboxylate

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C(OC(C)C)\N=N/C(OC(C)C)=O
Diisopropyl_tartrate (3813)
```
Botcommand: addindex 342050436 Diisopropyl_tartrate
```
```
For index : Diisopropyl_tartrate=342050436
```
* 2217-15-4 -> 2217-15-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Diisopropyl+tartrate not found on commonchemistry - Diisopropyl+tartrate

* No ChemSpiderID

* PubChem: 102768

* No InChI

* SMILES: CC(C)OC(=O)C(C(C(=O)OC(C)C)O)O
Diisopropylphosphate (3815)
```
Botcommand: addindex 336986973 Diisopropylphosphate
```
```
For index : Diisopropylphosphate=336986973
```
* 1611-31-0 -> 1611-31-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Diisopropylphosphate not found on commonchemistry - Diisopropylphosphate

* ChemSpiderID: 66772 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 74162

* No InChI - (ChemSpider: | InChI=InChI=1/C6H15O4P/c1-5(2)9-11(7,8)10-6(3)4/h5-6H,1-4H3,(H,7,8) )

* SMILES: CC(C)OP(=O)(O)OC(C)C - (ChemSpider: | SMILES=O=P(OC(C)C)(OC(C)C)O )
Diisopropyltryptamine (3816)
```
Botcommand: addindex 359916187 Diisopropyltryptamine
```
```
For index : Diisopropyltryptamine=359916187
```
* 14780-24-6 -> 14780-24-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Diisopropyltryptamine not found on commonchemistry - Diisopropyltryptamine

* No ChemSpiderID (correct: 25060)

* PubChem: 26903

* No InChI

* No SMILES
Diisopropylzinc (3817)
```
Botcommand: addindex 324673775 Diisopropylzinc
```
```
For index : Diisopropylzinc=324673775
```
* 625-81-0 -> 625-81-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Diisopropylzinc not found on commonchemistry - Diisopropylzinc

* No ChemSpiderID

* PubChem: 5207587

* No InChI

* SMILES: C[CH-]C.C[CH-]C.[Zn+2]
Dilazep (3819)

* No CASNo

* Dilazep not found on commonchemistry - Dilazep

* No ChemSpiderID

* PubChem: 3074

* No InChI

* No SMILES
Dilin (3820)

* No CASNo

* Dilin found on commonchemistry - Dilin
* 6144-28-1 (exact match)
Name in list

All names: (Z,Z)-9,12-Octadecadienoic acid, dimer, 9,12-Octadecadienoic acid (9Z,12Z)-, dimer, 9,12-Octadecadienoic acid (Z,Z)-, dimer, 9,12-Octadecadienoic acid, (Z,Z)-, dimer, Acide linoleique, dimerise, Century D 77, cis-9-cis-12-Octadecadienoic acid dimer, [[dilinoleic acid]], Dimeric linoleic acid, Dimerized linoleic acid, Hystrene 3695, Linoleic acid, dimer

* ChemSpiderID: 9550 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 9938

* InChI: InChI=1S/C10H10/c1-2-6-10-8-4-3-7-9(10)5-1/h1-3,5-7H,4,8H2 - (ChemSpider: | InChI=InChI=1/C10H10/c1-2-6-10-8-4-3-7-9(10)5-1/h1-3,5-7H,4,8H2 )

* SMILES: c2ccc1c(\C=C/CC1)c2 - (ChemSpider: | SMILES=c2ccc1c(\C=C/CC1)c2 )
Dillapiole (3821)
```
Botcommand: addindex 350491536 Dillapiole
```
```
For index : Dillapiole=350491536
```
* 484-31-1^{[citation needed]} -> ^[citation needed] 484-31-1^{[citation needed]} - NOT VERIFIED

* The CAS number '484-31-1^{[citation needed]}' is not formatted correctly, please repair the contents of the field CASNo or CAS_number

* Dillapiole not found on commonchemistry - Dillapiole

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Diloxanide_furoate (3822)
```
Botcommand: addindex 359666547 Diloxanide_furoate
```
```
For index : Diloxanide_furoate=359666547
```
* 3736-81-0 -> 3736-81-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Diloxanide+furoate not found on commonchemistry - Diloxanide+furoate

* No ChemSpiderID

* PubChem: 19529

* No InChI

* No SMILES
Dimagnesium_phosphate (3824)
```
Botcommand: addindex 350306039 Dimagnesium_phosphate
```
```
For index : Dimagnesium_phosphate=350306039
```
* 7757-86-0 -> 7757-86-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimagnesium+phosphate not found on commonchemistry - Dimagnesium+phosphate

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=P([O-])(O)[O-].[Mg+2]
Dimaprit (3826)
```
Botcommand: addindex 360226931 Dimaprit
```
```
For index : Dimaprit=360226931
```
* 65119-89-3 -> 65119-89-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimaprit not found on commonchemistry - Dimaprit

* No ChemSpiderID

* PubChem: 3077

* No InChI

* SMILES: CN(C)CCCSC(=N)N
Dimazole (3827)
```
Botcommand: addindex 349805943 Dimazole
```
```
For index : Dimazole=349805943
```
* 95-27-2 -> 95-27-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimazole not found on commonchemistry - Dimazole

* No ChemSpiderID

* PubChem: 8708

* No InChI

* No SMILES
Dimeditiapramine (3828)
```
Botcommand: addindex 346449452 Dimeditiapramine
```
```
For index : Dimeditiapramine=346449452
```
* 57010-31-8 -> 57010-31-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimeditiapramine not found on commonchemistry - Dimeditiapramine

* No ChemSpiderID

* PubChem: 42107

* No InChI

* SMILES: CN(CCCC1(S(=O)(=O)CCCS1(=O)=O)C2=CC(=C(C=C2)OC)OC)CCC3=CC(=C(C=C3)OC)OC
Dimefline (3830)
```
Botcommand: addindex 202200690 Dimefline
```
```
For index : Dimefline=202200690
```
* 1165-48-6 -> 1165-48-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimefline not found on commonchemistry - Dimefline

* No ChemSpiderID

* PubChem: 3078

* No InChI

* No SMILES
Dimemebfe (3831)
```
Botcommand: addindex 353503087 Dimemebfe
```
```
For index : Dimemebfe=353503087
```
* 140853-58-3 -> 140853-58-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimemebfe not found on commonchemistry - Dimemebfe

* No ChemSpiderID

* PubChem: 126589

* No InChI

* No SMILES
Dimemorfan (3832)
```
Botcommand: addindex 349396846 Dimemorfan
```
```
For index : Dimemorfan=349396846
```
* 36309-01-0 -> 36309-01-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimemorfan not found on commonchemistry - Dimemorfan

* No ChemSpiderID (correct: 16735785)

* PubChem: 3037918

* No InChI

* No SMILES
Dimenoxadol (3834)
```
Botcommand: addindex 343853998 Dimenoxadol
```
```
For index : Dimenoxadol=343853998
```
* 509-78-4 -> 509-78-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimenoxadol not found on commonchemistry - Dimenoxadol

* No ChemSpiderID (correct: 16137)

* PubChem: 17036

* No InChI

* No SMILES
Dimepheptanol (3835)

* No CASNo

* Dimepheptanol not found on commonchemistry - Dimepheptanol

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dimetacrine (3838)
```
Botcommand: addindex 352761391 Dimetacrine
```
```
For index : Dimetacrine=352761391
```
* 4757-55-5 -> 4757-55-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimetacrine not found on commonchemistry - Dimetacrine

* ChemSpiderID: 85085 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 94280

* No InChI - (ChemSpider: | InChI=InChI=1/C20H26N2/c1-20(2)16-10-5-7-12-18(16)22(15-9-14-21(3)4)19-13-8-6-11-17(19)20/h5-8,10-13H,9,14-15H2,1-4H3 )

* No SMILES - (ChemSpider: | smiles=c1ccc3c(c1)C(c2c(cccc2)N3CCCN(C)C)(C)C )
Dimethazan (3839)
```
Botcommand: addindex 348901533 Dimethazan
```
```
For index : Dimethazan=348901533
```
* 519-30-2 -> 519-30-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimethazan not found on commonchemistry - Dimethazan

* ChemSpiderID: 10167 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 10612

* No InChI - (ChemSpider: | InChI=InChI=1/C11H17N5O2/c1-13(2)5-6-16-7-12-9-8(16)10(17)15(4)11(18)14(9)3/h7H,5-6H2,1-4H3 )

* No SMILES - (ChemSpider: | smiles=O=C2N(c1ncn(c1C(=O)N2C)CCN(C)C)C )
Dimethenamid (3840)
```
Botcommand: addindex 343221478 Dimethenamid
```
```
For index : Dimethenamid=343221478
```
* 87674-68-8 -> 87674-68-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimethenamid not found on commonchemistry - Dimethenamid

* No ChemSpiderID

* PubChem: 91744

* No InChI

* SMILES: CC1=CSC(=C1N(C(C)COC)C(=O)CCl)C
Dimethisterone (3841)
```
Botcommand: addindex 300581735 Dimethisterone
```
```
For index : Dimethisterone=300581735
```
* 79-64-1 -> 79-64-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimethisterone not found on commonchemistry - Dimethisterone

* No ChemSpiderID

* PubChem: 6607

* No InChI

* SMILES: CC#C[C@@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2C[C@@H](C4=CC(=O)CC[C@]34C)C)C)O
Dimethocaine (3843)
```
Botcommand: addindex 364655968 Dimethocaine
```
```
For index : Dimethocaine=364655968
```
* 94-15-5 -> 94-15-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimethocaine not found on commonchemistry - Dimethocaine

* No ChemSpiderID

* PubChem: 7177

* No InChI

* No SMILES
Dimethoxanate (3844)
```
Botcommand: addindex 349557530 Dimethoxanate
```
```
For index : Dimethoxanate=349557530
```
* 477-93-0 -> 477-93-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimethoxanate not found on commonchemistry - Dimethoxanate

* No ChemSpiderID (correct: 10165)

* PubChem: 10610

* No InChI

* No SMILES
Dimethoxyamphetamine (3845)
* No CASNo

* Dimethoxyamphetamine not found on commonchemistry - Dimethoxyamphetamine

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C1(=CC(=CC=C1CC(C)N)OC)OC
Dimethoxymethamphetamine (3847)

* No CASNo

* Dimethoxymethamphetamine not found on commonchemistry - Dimethoxymethamphetamine

* No ChemSpiderID

* PubChem: 12235308

* No InChI

* No SMILES

3851 to 3900 edit

Dimethyl_dicarbonate (3851)
```
Botcommand: addindex 358318008 Dimethyl_dicarbonate
```
```
For index : Dimethyl_dicarbonate=358318008
```
* 4525-33-1 -> 4525-33-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimethyl+dicarbonate not found on commonchemistry - Dimethyl+dicarbonate

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C(OC(=O)OC)OC
Dimethyl_methylphosphonate (3856)
```
Botcommand: addindex 358347762 Dimethyl_methylphosphonate
```
```
For index : Dimethyl_methylphosphonate=358347762
```
* 756-79-6 -> 756-79-6 - NOT VERIFIED

* CAS found on commonchemistry - 756-79-6 - name in list
All names: Dimethoxymethyl phosphine oxide, Dimethyl methanephosphonate, dimethyl methylphosphonate, Dimethylmethylphosphonat, DMMP, Fran TF 2000, Fyrol DMMP, Metaran, Methanephosphonic acid dimethyl ester, Methylphosphonate de dimethyle, METHYLPHOSPHONATE, DIMETHYL, Methylphosphonic acid dimethyl ester, metilfosfonato de dimetilo, NSC 62240, O,O-Dimethyl methylphosphonate, Phosphonic acid, methyl-, dimethyl ester, Phosphonic acid, P-methyl-, dimethyl ester, Reoflam DMMP

* Dimethyl+methylphosphonate found on commonchemistry - Dimethyl+methylphosphonate
* 756-79-6 (exact match) Matches CAS (756-79-6) on page
Name in list

All names: Dimethoxymethyl phosphine oxide, Dimethyl methanephosphonate, [[dimethyl methylphosphonate]], Dimethylmethylphosphonat, DMMP, Fran TF 2000, Fyrol DMMP, Metaran, Methanephosphonic acid dimethyl ester, Methylphosphonate de dimethyle, METHYLPHOSPHONATE, DIMETHYL, Methylphosphonic acid dimethyl ester, metilfosfonato de dimetilo, NSC 62240, [[O,O-dimethyl methylphosphonate]], Phosphonic acid, methyl-, dimethyl ester, Phosphonic acid, P-methyl-, dimethyl ester, Reoflam DMMP

* No ChemSpiderID

* PubChem: 12958

* No InChI

* SMILES: COP(=O)(C)OC
Dimethyl_phthalate (3857)
```
Botcommand: addindex 304732577 Dimethyl_phthalate
```
```
For index : Dimethyl_phthalate=304732577
```
* 131-11-3 -> 131-11-3 - NOT VERIFIED

* CAS found on commonchemistry - 131-11-3 - name in list
All names: 1,2-Benzenecarboxylic acid, dimethyl ester, 1,2-Benzenedicarboxylic acid dimethyl ester, 1,2-Benzenedicarboxylic acid, 1,2-dimethyl ester, 1,2-Benzenedicarboxylic acid, dimethyl ester, Avolin, Dimethyl 1,2-benzenedicarboxylate, Dimethyl o-phthalate, dimethyl phthalate, Dimethyl pthalate, Dimethylphthalat, DMF (insect repellent), DMP, Fermine, ftalato de dimetilo, Mipax, NSC 15398, NTM, Palatinol M, Phtalate de dimethyle, PHTHALATE, DIMETHYL, Phthalic acid dimethyl ester, Phthalic acid, dimethyl ester, PHTHALSAEURE-DIMETHYLESTER, Repeftal, See also Alkyl phthalates, Solvanom, Solvarone, Unimoll DM

* Dimethyl+phthalate found on commonchemistry - Dimethyl+phthalate
* 131-11-3 (exact match) Matches CAS (131-11-3) on page
Name in list

All names: 1,2-Benzenecarboxylic acid, dimethyl ester, 1,2-Benzenedicarboxylic acid dimethyl ester, 1,2-Benzenedicarboxylic acid, 1,2-dimethyl ester, 1,2-Benzenedicarboxylic acid, dimethyl ester, Avolin, Dimethyl 1,2-benzenedicarboxylate, Dimethyl o-phthalate, [[dimethyl phthalate]], Dimethyl pthalate, Dimethylphthalat, DMF (insect repellent), DMP, Fermine, ftalato de dimetilo, Mipax, NSC 15398, NTM, Palatinol M, Phtalate de dimethyle, PHTHALATE, DIMETHYL, Phthalic acid dimethyl ester, Phthalic acid, dimethyl ester, PHTHALSAEURE-DIMETHYLESTER, Repeftal, See also Alkyl phthalates, Solvanom, Solvarone, Unimoll DM

* No ChemSpiderID

* PubChem: 8554

* No InChI

* SMILES: COC(=O)C1=CC=CC=C1C(=O)OC
Dimethyl_pimelimidate_dihydrochloride (3858)
File:Dimethyl pimelimidate dihydrochloride.svg
```
Botcommand: addindex 307977246 Dimethyl_pimelimidate_dihydrochloride
```
```
For index : Dimethyl_pimelimidate_dihydrochloride=307977246
```
* 58537-94-3 -> 58537-94-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimethyl+pimelimidate+dihydrochloride not found on commonchemistry - Dimethyl+pimelimidate+dihydrochloride

* No ChemSpiderID

* PubChem: 11402688

* No InChI

* SMILES: COC(=N)CCCCCC(=N)OC.Cl.Cl
Dimethyl_sulfite (3861)
```
Botcommand: addindex 350977052 Dimethyl_sulfite
```
```
For index : Dimethyl_sulfite=350977052
```
* 616-42-2 -> 616-42-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimethyl+sulfite not found on commonchemistry - Dimethyl+sulfite

* No ChemSpiderID

* PubChem: 69223

* No InChI

* SMILES: COS(=O)OC
Dimethyl_telluride (3863)
```
Botcommand: addindex 362011853 Dimethyl_telluride
```
```
For index : Dimethyl_telluride=362011853
```
* 593-80-6 -> 593-80-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimethyl+telluride not found on commonchemistry - Dimethyl+telluride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dimethylallyl_pyrophosphate (3868)
```
Botcommand: addindex 355645785 Dimethylallyl_pyrophosphate
```
```
For index : Dimethylallyl_pyrophosphate=355645785
```
* 358-72-5 -> 358-72-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimethylallyl+pyrophosphate not found on commonchemistry - Dimethylallyl+pyrophosphate

* No ChemSpiderID

* PubChem: 647

* No InChI

* SMILES: CC(=CCOP(=O)(O)OP(=O)(O)O)C
Dimethylaminoethanol_bitartrate (3870)
File:Dimethylaminoethanol Bitartrate.pngÔÇÄ
```
Botcommand: addindex 361805861 Dimethylaminoethanol_bitartrate
```
```
For index : Dimethylaminoethanol_bitartrate=361805861
```
* 5988-51-2 -> 5988-51-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimethylaminoethanol+bitartrate not found on commonchemistry - Dimethylaminoethanol+bitartrate

* No ChemSpiderID

* PubChem: 110746

* No InChI

* SMILES: CN(C)CCO.C(C(C(=O)O)O)(C(=O)O)O
Dimethylaminopropionylphenothiazine (3871)
```
Botcommand: addindex 297981451 Dimethylaminopropionylphenothiazine
```
```
For index : Dimethylaminopropionylphenothiazine=297981451
```
* 63834-04-8 -> 63834-04-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimethylaminopropionylphenothiazine not found on commonchemistry - Dimethylaminopropionylphenothiazine

* No ChemSpiderID

* PubChem: 113918

* No InChI

* SMILES: CC(C(=O)N1C2=CC=CC=C2SC3=CC=CC=C31)N(C)C
Dimethylamphetamine (3873)
```
Botcommand: addindex 341368140 Dimethylamphetamine
```
```
For index : Dimethylamphetamine=341368140
```
* 4075-96-1 -> 4075-96-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimethylamphetamine not found on commonchemistry - Dimethylamphetamine

* No ChemSpiderID (correct: 471861)

* PubChem: 20006

* No InChI

* No SMILES
Dimethyldioxirane (3879)
```
Botcommand: addindex 348081950 Dimethyldioxirane
```
```
For index : Dimethyldioxirane=348081950
```
* 74087-85-7 -> 74087-85-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimethyldioxirane not found on commonchemistry - Dimethyldioxirane

* No ChemSpiderID

* PubChem: 115197

* No InChI

* SMILES: CC1(OO1)C
Dimethylheptylpyran (3884)
```
Botcommand: addindex 358153527 Dimethylheptylpyran
```
```
For index : Dimethylheptylpyran=358153527
```
* 32904-22-6 -> 32904-22-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimethylheptylpyran not found on commonchemistry - Dimethylheptylpyran

* No ChemSpiderID (correct: 19960038)

* PubChem: 36276

* No InChI

* No SMILES
Dimethylmercury (3885)
```
Botcommand: addindex 361565627 Dimethylmercury
```
```
For index : Dimethylmercury=361565627
```
* 593-74-8 -> 593-74-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimethylmercury not found on commonchemistry - Dimethylmercury

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dimethylphenylpiperazinium (3887)
```
Botcommand: addindex 355904518 Dimethylphenylpiperazinium
```
```
For index : Dimethylphenylpiperazinium=355904518
```
* 114-28-3 -> 114-28-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimethylphenylpiperazinium not found on commonchemistry - Dimethylphenylpiperazinium

* ChemSpiderID: 4325933 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 5152798

* No InChI - (ChemSpider: | InChI=InChI=1/C12H18N2/c1-10-4-3-5-12(11(10)2)14-8-6-13-7-9-14/h3-5,13H,6-9H2,1-2H3/p+1 )

* No SMILES - (ChemSpider: | smiles=c1(c(c(ccc1)N2CC[NH2+]CC2)C)C )
Dimethylsulfoniopropionate (3888)
```
Botcommand: addindex 345788181 Dimethylsulfoniopropionate
```
```
For index : Dimethylsulfoniopropionate=345788181
```
* 7314-30-9 -> 7314-30-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimethylsulfoniopropionate not found on commonchemistry - Dimethylsulfoniopropionate

* No ChemSpiderID

* PubChem: 23736

* No InChI

* SMILES: C[S+](C)CCC(=O)[O-]
Dimethylthiambutene (3889)
```
Botcommand: addindex 343221686 Dimethylthiambutene
```
```
For index : Dimethylthiambutene=343221686
```
* 524-84-5 -> 524-84-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimethylthiambutene not found on commonchemistry - Dimethylthiambutene

* No ChemSpiderID (correct: 10218)

* PubChem: 153967

* No InChI

* No SMILES
Dimethyltryptamine (3890)
```
Botcommand: addindex 364229793 Dimethyltryptamine
```
```
For index : Dimethyltryptamine=364229793
```
* 61-50-7 -> 61-50-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimethyltryptamine not found on commonchemistry - Dimethyltryptamine

* ChemSpiderID: 5864 (correct: 5864) - CORRECT - Retrieved data from ChemSpider

* PubChem: 6089

* No InChI - (ChemSpider: | InChI=InChI=1/C12H16N2/c1-14(2)8-7-10-9-13-12-6-4-3-5-11(10)12/h3-6,9,13H,7-8H2,1-2H3 )

* No SMILES - (ChemSpider: | smiles=c1cccc2c1c(cn2)CCN(C)C )
Dimethyltubocurarinium_chloride (3891)

* No CASNo

* Dimethyltubocurarinium+chloride not found on commonchemistry - Dimethyltubocurarinium+chloride

* No ChemSpiderID

* PubChem: 21233

* No InChI

* No SMILES
Dimetindene (3894)
File:(┬▒)-Dimetindene Enantiomers Structural Formulae.png
```
Botcommand: addindex 347182465 Dimetindene
```
```
For index : Dimetindene=347182465
```
* 5636-83-9 -> 5636-83-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimetindene not found on commonchemistry - Dimetindene

* No ChemSpiderID (correct: 20541)

* PubChem: 21855

* No InChI

* No SMILES
Dimetofrine (3895)
```
Botcommand: addindex 330989025 Dimetofrine
```
```
For index : Dimetofrine=330989025
```
* 22950-29-4 -> 22950-29-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimetofrine not found on commonchemistry - Dimetofrine

* No ChemSpiderID (correct: 29227)

* PubChem: 31513

* No InChI

* No SMILES
Dimetotiazine (3896)
```
Botcommand: addindex 348482646 Dimetotiazine
```
```
For index : Dimetotiazine=348482646
```
* 7456-24-8 -> 7456-24-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimetotiazine not found on commonchemistry - Dimetotiazine

* No ChemSpiderID

* PubChem: 3089

* No InChI

* No SMILES
Dimetridazole (3897)
```
Botcommand: addindex 300064994 Dimetridazole
```
```
For index : Dimetridazole=300064994
```
* 551-92-8 -> 551-92-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimetridazole not found on commonchemistry - Dimetridazole

* No ChemSpiderID (correct: 2980)

* PubChem: 3090

* No InChI

* No SMILES
Diminazen (3898)
```
Botcommand: addindex 351832837 Diminazen
```
```
For index : Diminazen=351832837
```
* 536-71-0 -> 536-71-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Diminazen not found on commonchemistry - Diminazen

* ChemSpiderID: 2264 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 2354

* No InChI - (ChemSpider: | InChI=InChI=1/C14H15N7/c15-13(16)9-1-5-11(6-2-9)19-21-20-12-7-3-10(4-8-12)14(17)18/h1-8H,(H3,15,16)(H3,17,18)(H,19,20) )

* No SMILES - (ChemSpider: | smiles=N(=N/Nc1ccc(cc1)C(=[N@H])N)\c2ccc(C(=[N@H])N)cc2 )
Dimiracetam (3899)
```
Botcommand: addindex 347865996 Dimiracetam
```
```
For index : Dimiracetam=347865996
```
* 126100-97-8 -> 126100-97-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Dimiracetam not found on commonchemistry - Dimiracetam

* No ChemSpiderID

* PubChem: 65955

* No InChI

* SMILES: C1CC(=O)N2C1NC(=O)C2
Dinaphthylene_dioxide (3900)
```
Botcommand: addindex 364667080 Dinaphthylene_dioxide
```
```
For index : Dinaphthylene_dioxide=364667080
```
* 191-28-6 -> 191-28-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Dinaphthylene+dioxide not found on commonchemistry - Dinaphthylene+dioxide

* ChemSpiderID: 210417 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 240798

* InChI: InChI=1/C20H10O2/c1-3-11-7-9-16-19-17(11)13(5-1)21-15-10-8-12-4-2-6-14(22-16)18(12)20(15)19/h1-10H - (ChemSpider: | InChI=InChI=1/C20H10O2/c1-3-11-7-9-16-19-17(11)13(5-1)21-15-10-8-12-4-2-6-14(22-16)18(12)20(15)19/h1-10H )

* SMILES: O2c1cccc5c1c4c3c2ccc6c3c(Oc4cc5)ccc6 - (ChemSpider: | SMILES=O2c1cccc5c1c4c3c2ccc6c3c(Oc4cc5)ccc6 )

3901 to 3950 edit

Dinapsoline (3901)
```
Botcommand: addindex 360216839 Dinapsoline
```
```
For index : Dinapsoline=360216839
```
* 458563-40-1 -> 458563-40-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Dinapsoline not found on commonchemistry - Dinapsoline

* No ChemSpiderID

* PubChem: 9816455

* No InChI

* No SMILES
Dinitrogen_difluoride (3902)
```
Botcommand: addindex 336383894 Dinitrogen_difluoride
```
```
For index : Dinitrogen_difluoride=336383894
```
* 13812-43-6 -> 13812-43-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Dinitrogen+difluoride not found on commonchemistry - Dinitrogen+difluoride

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: cis: F/N=N\F trans: F\N=N\F
Dinitrogen_trioxide (3905)
```
Botcommand: addindex 356566859 Dinitrogen_trioxide
```
```
For index : Dinitrogen_trioxide=356566859
```
* 10544-73-7 -> 10544-73-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Dinitrogen+trioxide not found on commonchemistry - Dinitrogen+trioxide

* No ChemSpiderID

* PubChem: 61526

* No InChI

* No SMILES
Dinonylnaphthylsulfonic_acid (3906)
```
Botcommand: addindex 317512071 Dinonylnaphthylsulfonic_acid
```
```
For index : Dinonylnaphthylsulfonic_acid=317512071
```
* 25322-17-2 -> 25322-17-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Dinonylnaphthylsulfonic+acid not found on commonchemistry - Dinonylnaphthylsulfonic+acid

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dinoxyline (3908)

* No CASNo

* Dinoxyline not found on commonchemistry - Dinoxyline

* No ChemSpiderID

* PubChem: 9819126

* No InChI

* No SMILES
Dioctyl_adipate (3909)
```
Botcommand: addindex 342582622 Dioctyl_adipate
```
```
For index : Dioctyl_adipate=342582622
```
* 103-23-1 -> 103-23-1 - NOT VERIFIED

* CAS found on commonchemistry - 103-23-1 - name in list
All names: Adimoll DO, Adipate de bis(2-ethylhexyle), ADIPATE, BIS-2-ETHYLHEXYL, ADIPATE, DI (2-ETHYLHEXYL), ADIPATE, DI-(2-ETHYLHEXYL), adipato de bis(2-etilhexilo), Adipic acid, bis(2-ethylhexyl) ester, ADIPINSAEURE-BIS-(2-AETHYLHEXYL)-ESTER, Adipol 2EH, ADO, ADO (lubricating oil), Arlamol DOA, bis(2-ethylhexyl) adipate, Bis(2-ethylhexyl)adipat, BIS(2-ETHYLHEXYL)ADIPATE, Bisoflex DOA, Crodamol DOA, Dermol DOA, Di(2-ethylhexyl) adipate, Diacizer DOA, Diethylhexyl adipate, DIOCTYL ADIPATE, DOA, Effomoll DA, Effomoll DOA, Ergoplast AdDO, Flexol A 26, Hatcol 2908, Hexanedioic acid, 1,6-bis(2-ethylhexyl) ester, Hexanedioic acid, bis(2-ethylhexyl) ester, Hexanedioic acid, bis(2-ethylhexyl)ester, Hexanoic acid bis(2-ethylhexyl) ester, Jayflex DOA 2, K 3220, Kodaflex DOA, Lankroflex DOA, Monoplex DOA, NSC 56775, Octyl adipate, Plasthall DOA, Plastomoll DOA, Reomol DOA, Sansocizer DOA, See also Alkyl phthalates, Sicol 250, SP 100, SP 100 (solvent), Truflex DOA, USS 700, Vestinol OA, Vistone A 10, Wickenol 158, Witamol 320

* Dioctyl+adipate found on commonchemistry - Dioctyl+adipate
* 103-23-1 (exact match) Matches CAS (103-23-1) on page
Name in list

All names: Adimoll DO, Adipate de bis(2-ethylhexyle), ADIPATE, BIS-2-ETHYLHEXYL, ADIPATE, DI (2-ETHYLHEXYL), ADIPATE, DI-(2-ETHYLHEXYL), adipato de bis(2-etilhexilo), Adipic acid, bis(2-ethylhexyl) ester, ADIPINSAEURE-BIS-(2-AETHYLHEXYL)-ESTER, Adipol 2EH, ADO, ADO (lubricating oil), Arlamol DOA, bis(2-ethylhexyl) adipate, Bis(2-ethylhexyl)adipat, BIS(2-ETHYLHEXYL)ADIPATE, Bisoflex DOA, Crodamol DOA, Dermol DOA, Di(2-ethylhexyl) adipate, Diacizer DOA, Diethylhexyl adipate, [[dioctyl adipate]], DOA, Effomoll DA, Effomoll DOA, Ergoplast AdDO, Flexol A 26, Hatcol 2908, Hexanedioic acid, 1,6-bis(2-ethylhexyl) ester, Hexanedioic acid, bis(2-ethylhexyl) ester, Hexanedioic acid, bis(2-ethylhexyl)ester, Hexanoic acid bis(2-ethylhexyl) ester, Jayflex DOA 2, K 3220, Kodaflex DOA, Lankroflex DOA, Monoplex DOA, NSC 56775, Octyl adipate, Plasthall DOA, Plastomoll DOA, Reomol DOA, Sansocizer DOA, See also Alkyl phthalates, Sicol 250, SP 100, SP 100 (solvent), Truflex DOA, USS 700, Vestinol OA, Vistone A 10, Wickenol 158, Witamol 320

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CCCCCCCCOC(=O)CCCCC(=O)OCCCCCCCC
Dioctyl_sodium_sulfosuccinate (3911)
```
Botcommand: addindex 355604395 Dioctyl_sodium_sulfosuccinate
```
```
For index : Dioctyl_sodium_sulfosuccinate=355604395
```
* 577-11-7 -> 577-11-7 - NOT VERIFIED

* CAS found on commonchemistry - 577-11-7 - name in list
All names: 05035TX, 1,4-Bis(2-ethylhexyl) sodium sulfosuccinate, 1,4-BIS(2-ETHYLHEXYL)SULFOSUCCINIC ACID SODIUM SALT, Acrosol OT 100, Adekacol EC 4500, Adekacol EC 8600, Aerosol A 501, Aerosol AOT, Aerosol GPG, Aerosol OT, Aerosol OT 100, Aerosol OT 70, Aerosol OT 70PG, Aerosol OT 75, Aerosol OT 75E, Aerosol OT 75PG, Aerosol OT 94, Aerosol OT-A, Aerosol OT-B, Aerosol OT-S, Airrol CT 1, Airrol CT 1L, Airrol OP, Alcopol O, Alkasurf SS-O 75, Alphasol OT, AOT, AOT 100, AOT I, Astrowet 608, Astrowet O 70PG, Astrowet O 75, B 80, Berol 478, Bis(2-ethylhexyl) sodiosulfosuccinate, Bis(2-ethylhexyl) sodium sulfosuccinate, Bis(2-ethylhexyl) S-sodium sulfosuccinate, Bis(2-ethylhexyl) sulfosuccinate sodium salt, Butanedioic acid, 2-sulfo-, 1,4-bis(2-ethylhexyl) ester, sodium salt (1:1), Butanedioic acid, sulfo-, 1,4-bis(2-ethylhexyl) ester, sodium salt, Butanedioic acid, sulfo-, 1,4-bis(2-ethylhexyl)ester, sodium salt, BUTANEDIOIC ACID, SULFO-, BIS-2-ETHYLHEXYL ESTER, SODIUM SALT, BUTANEDIOIC ACID, SULFO-,1,4-BIS(2-ETHYLHEXYL) ESTER, SODIUM SALT, Butanedioic acid, sulfo-1,4-bis(2-ethylhexyl) este-r, sodium salt, Carabon DA 72, Celanol DOS 65, Celanol DOS 75, Chemax DOSS 70PG, Colace, Comfolax, Complemix, Constonate, Coprol, Coprola, Correctol Stool Softener Laxative, Defilin, DESS, Di(2-ethylhexyl) sulfosuccinate sodium salt, Di(2-ethylhexyl)sulfosuccinic acid, sodium salt, Di-2-ethylhexyl sodium sulfosuccinate, DI-2-ETHYLHEXYL SULFOSUCCINIC ACID SODIUM SALT, Dialose, Dioctlyn, Dioctyl, DIOCTYL SODIUM SULFOSUCCINATE, Dioctyl sulfosuccinate sodium, Dioctyl sulfosuccinate sodium salt, Dioctylal, Dioctyl-Medo Forte, DioctylSodium Sulfosuccinate, Diomedicone, Diosuccin, Diotilan, Diovac, Diox, Disonate, Disposaject, Docusate sodique, docusate sodium, Docusatnatrium, docusato sodico, DOSS, DOSS 70, Doxinate, Doxol, Drewfax 007, DSS, Dulcivac, Dulsivac, Duosol, E 480, Emcol 4500, Empimin OP 70, Empimin OT 75, Freetex OT, Gemtex SC, Gemtex SC 40, Genopur SB 1970J, Geropon DOS, Geropon SDS, Geropon SS-O 75, Geropon WT 27, Humifen WT 27G, Isoprotanc, Karawet DOSS, KM 10-1610, Konlax, Koremul 290, Kosate, Lankropol 4500, Lankropol KO 2, Laxinate, Lumiten I-RA, Lutensit A-BO, Lutensit A-BOS, M 75, Mackanate DOS 75, Manoxol, Manoxol OP, Manoxol OT, Marlinat DF 8, Mervamine, Miconate DOS, Modane Soft, Molatoc, Molcer, Molofac, Monawet M 085P, Monawet MO 65-150, Monawet MO 70, Monawet MO 70E, Monawet MO 70R, Monowet MO 70R, Monowet MO-E 75, Neocol P, Neocol YSK, Neopelex OTP, Nevax, Newcol 290M, Newcol 291EG, Newcol 291M, Newcol 291PG, Newkalgen EP 60P, Newkalgen EP 70G, Nikkol OTP 100, Nikkol OTP 100S, Nikkol OTP 70, Nikkol OTP 75, Nissan Rapisol, Nissan Rapisol A 30, Nissan Rapisol A 80, Nissan Rapisol A 90, Nissan Rapisol B 07, Nissan Rapisol B 30, Nissan Rapisol B 80, Nissan Rapisol B 90, NK-EP 70G, Nonit, Norval, Obston, Octowet, OT, OT 100, OT 70, OT 75, OT 75 (surfactant), OT 75E, OTP 100, OTP 75, PAV 1019, Pelex OT, Pelex OT-P, Pentex 99, Persol KMN 3, Pionin A 51B, Rapisol, Rapisol A 30, Rapisol A 80, Rapisol A 90, Rapisol B 30, Rapisol B 80, Rapisol B 90, Regutol, Revac, Rewopol SBDO 70, Rikakoru M 75, Sanmorin OT, Sanmorin OT 70, Sanmorin OT 70N, Sanseparer 100, SBO, Secosol DOS 70, SN-Wet OT 70, Sobital, Sodium 1,2-bis(2-ethylhexyloxycarbonyl)-1-ethanesulfonate, Sodium 1,4-bis(2-ethylhexyl) sulfosuccinate, Sodium bis(2-ethylhexyl) sulfosuccinate, Sodium bis(ethylhexyl) sulfosuccinate, Sodium di(2-ethylhexyl) sulfosuccinate, Sodium di(ethylhexyl) sulfosuccinate, SODIUM DIOCTYL SULFOSUCCINATE, sodium dioctyl sulfosuccinate aerosol ot 75 sponto ha, Sodium docusate, Softil, Soliwax, Solovet, Solusol, Spilon 8, Succinate STD, Succinic acid, sulfo-, 1,4-bis(2-ethylhexyl) ester, sodium salt, SUCCINIC ACID, SULFO-, 1,4-BIS(2-ETHYLHEXYL) ESTERSODIUM SALT, Sulfimel DOS, SULFOBERNSTEINSAEURE-1,4-BIS-(2-AETHYLHEXYL)-ESTER-NA-SALZ, Sulfobutanedioic acid 1,4-bis(2-ethylhexyl)ester sodium salt, Sulfobutanedioic acid, 1,4-bis(2-ethylhexyl) ester, sodium salt, SULFOSUCCINATE, 2-ETHYLHEXYL, SODIUM, Sulfosuccinic acid bis(2-ethylhexyl)ester sodium salt, Sulfosuccinic acid di-2-ethylhexyl ester sodium salt, Sunnol LDF 110, Surfonic DOS 75PG, SV 102, Talosurf, Tex-Wet 1001, TKB 20, Triton GR 5, Triton GR 5M, Triton GR 7, Triton GR 7M, Triton GR 7ME, Vatsol OT, Velmol, Warcowet 060, Waxsol, Wetaid SR, Yal

* Dioctyl+sodium+sulfosuccinate found on commonchemistry - Dioctyl+sodium+sulfosuccinate
* 577-11-7 (exact match) Matches CAS (577-11-7) on page
Name in list

All names: 05035TX, 1,4-Bis(2-ethylhexyl) sodium sulfosuccinate, 1,4-BIS(2-ETHYLHEXYL)SULFOSUCCINIC ACID SODIUM SALT, Acrosol OT 100, Adekacol EC 4500, Adekacol EC 8600, Aerosol A 501, Aerosol AOT, Aerosol GPG, Aerosol OT, Aerosol OT 100, Aerosol OT 70, Aerosol OT 70PG, Aerosol OT 75, Aerosol OT 75E, Aerosol OT 75PG, Aerosol OT 94, Aerosol OT-A, Aerosol OT-B, Aerosol OT-S, Airrol CT 1, Airrol CT 1L, Airrol OP, Alcopol O, Alkasurf SS-O 75, Alphasol OT, AOT, AOT 100, AOT I, Astrowet 608, Astrowet O 70PG, Astrowet O 75, B 80, Berol 478, Bis(2-ethylhexyl) sodiosulfosuccinate, Bis(2-ethylhexyl) sodium sulfosuccinate, Bis(2-ethylhexyl) S-sodium sulfosuccinate, Bis(2-ethylhexyl) sulfosuccinate sodium salt, Butanedioic acid, 2-sulfo-, 1,4-bis(2-ethylhexyl) ester, sodium salt (1:1), Butanedioic acid, sulfo-, 1,4-bis(2-ethylhexyl) ester, sodium salt, Butanedioic acid, sulfo-, 1,4-bis(2-ethylhexyl)ester, sodium salt, BUTANEDIOIC ACID, SULFO-, BIS-2-ETHYLHEXYL ESTER, SODIUM SALT, BUTANEDIOIC ACID, SULFO-,1,4-BIS(2-ETHYLHEXYL) ESTER, SODIUM SALT, Butanedioic acid, sulfo-1,4-bis(2-ethylhexyl) este-r, sodium salt, Carabon DA 72, Celanol DOS 65, Celanol DOS 75, Chemax DOSS 70PG, Colace, Comfolax, Complemix, Constonate, Coprol, Coprola, Correctol Stool Softener Laxative, Defilin, DESS, Di(2-ethylhexyl) sulfosuccinate sodium salt, Di(2-ethylhexyl)sulfosuccinic acid, sodium salt, Di-2-ethylhexyl sodium sulfosuccinate, DI-2-ETHYLHEXYL SULFOSUCCINIC ACID SODIUM SALT, Dialose, Dioctlyn, Dioctyl, [[dioctyl sodium sulfosuccinate]], Dioctyl sulfosuccinate sodium, Dioctyl sulfosuccinate sodium salt, Dioctylal, Dioctyl-Medo Forte, DioctylSodium Sulfosuccinate, Diomedicone, Diosuccin, Diotilan, Diovac, Diox, Disonate, Disposaject, Docusate sodique, docusate sodium, Docusatnatrium, docusato sodico, DOSS, DOSS 70, Doxinate, Doxol, Drewfax 007, DSS, Dulcivac, Dulsivac, Duosol, E 480, Emcol 4500, Empimin OP 70, Empimin OT 75, Freetex OT, Gemtex SC, Gemtex SC 40, Genopur SB 1970J, Geropon DOS, Geropon SDS, Geropon SS-O 75, Geropon WT 27, Humifen WT 27G, Isoprotanc, Karawet DOSS, KM 10-1610, Konlax, Koremul 290, Kosate, Lankropol 4500, Lankropol KO 2, Laxinate, Lumiten I-RA, Lutensit A-BO, Lutensit A-BOS, M 75, Mackanate DOS 75, Manoxol, Manoxol OP, Manoxol OT, Marlinat DF 8, Mervamine, Miconate DOS, Modane Soft, Molatoc, Molcer, Molofac, Monawet M 085P, Monawet MO 65-150, Monawet MO 70, Monawet MO 70E, Monawet MO 70R, Monowet MO 70R, Monowet MO-E 75, Neocol P, Neocol YSK, Neopelex OTP, Nevax, Newcol 290M, Newcol 291EG, Newcol 291M, Newcol 291PG, Newkalgen EP 60P, Newkalgen EP 70G, Nikkol OTP 100, Nikkol OTP 100S, Nikkol OTP 70, Nikkol OTP 75, Nissan Rapisol, Nissan Rapisol A 30, Nissan Rapisol A 80, Nissan Rapisol A 90, Nissan Rapisol B 07, Nissan Rapisol B 30, Nissan Rapisol B 80, Nissan Rapisol B 90, NK-EP 70G, Nonit, Norval, Obston, Octowet, OT, OT 100, OT 70, OT 75, OT 75 (surfactant), OT 75E, OTP 100, OTP 75, PAV 1019, Pelex OT, Pelex OT-P, Pentex 99, Persol KMN 3, Pionin A 51B, Rapisol, Rapisol A 30, Rapisol A 80, Rapisol A 90, Rapisol B 30, Rapisol B 80, Rapisol B 90, Regutol, Revac, Rewopol SBDO 70, Rikakoru M 75, Sanmorin OT, Sanmorin OT 70, Sanmorin OT 70N, Sanseparer 100, SBO, Secosol DOS 70, SN-Wet OT 70, Sobital, Sodium 1,2-bis(2-ethylhexyloxycarbonyl)-1-ethanesulfonate, Sodium 1,4-bis(2-ethylhexyl) sulfosuccinate, Sodium bis(2-ethylhexyl) sulfosuccinate, Sodium bis(ethylhexyl) sulfosuccinate, Sodium di(2-ethylhexyl) sulfosuccinate, Sodium di(ethylhexyl) sulfosuccinate, SODIUM DIOCTYL SULFOSUCCINATE, sodium dioctyl sulfosuccinate aerosol ot 75 sponto ha, Sodium docusate, Softil, Soliwax, Solovet, Solusol, Spilon 8, Succinate STD, Succinic acid, sulfo-, 1,4-bis(2-ethylhexyl) ester, sodium salt, SUCCINIC ACID, SULFO-, 1,4-BIS(2-ETHYLHEXYL) ESTERSODIUM SALT, Sulfimel DOS, SULFOBERNSTEINSAEURE-1,4-BIS-(2-AETHYLHEXYL)-ESTER-NA-SALZ, Sulfobutanedioic acid 1,4-bis(2-ethylhexyl)ester sodium salt, Sulfobutanedioic acid, 1,4-bis(2-ethylhexyl) ester, sodium salt, SULFOSUCCINATE, 2-ETHYLHEXYL, SODIUM, Sulfosuccinic acid bis(2-ethylhexyl)ester sodium salt, Sulfosuccinic acid di-2-ethylhexyl ester sodium salt, Sunnol LDF 110, Surfonic DOS 75PG, SV 102, Talosurf, Tex-Wet 1001, TKB 20, Triton GR 5, Triton GR 5M, Triton GR 7, Triton GR 7M, Triton GR 7ME, Vatsol OT, Velmol, Warcowet 060, Waxsol, Wetaid SR, Yal

* No ChemSpiderID

* PubChem: 23673837

* No InChI

* SMILES: CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S(=O)(=O)[O-].[Na+]
Diosmectite (3913)
```
Botcommand: addindex 333969823 Diosmectite
```
```
For index : Diosmectite=333969823
```
* 110070-78-5 -> 110070-78-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Diosmectite not found on commonchemistry - Diosmectite

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Diosmetin (3914)
```
Botcommand: addindex 346665564 Diosmetin
```
```
For index : Diosmetin=346665564
```
* 520-34-3 -> 520-34-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Diosmetin not found on commonchemistry - Diosmetin

* No ChemSpiderID

* PubChem: 5281612

* No InChI

* SMILES: COC1=C(C=C(C=C1)C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O
Diosmetinidin (3915)
```
Botcommand: addindex 311425872 Diosmetinidin
```
```
For index : Diosmetinidin=311425872
```
* 64670-94-6 -> 64670-94-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Diosmetinidin not found on commonchemistry - Diosmetinidin

* No ChemSpiderID

* PubChem: 14842006

* No InChI

* SMILES: COC1=C(C=C(C=C1)C2=[O+]C3=CC(=CC(=C3C=C2)O)O)O.[Cl-]
Diosmin (3916)
* No CASNo

* Diosmin not found on commonchemistry - Diosmin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dioxane_tetraketone (3917)
```
Botcommand: addindex 342890110 Dioxane_tetraketone
```
```
For index : Dioxane_tetraketone=342890110
```
* 213967-57-8 -> 213967-57-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Dioxane+tetraketone not found on commonchemistry - Dioxane+tetraketone

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C(O1)C(OC(C1=O)=O)=O
Dioxaphetyl_butyrate (3918)
```
Botcommand: addindex 357098008 Dioxaphetyl_butyrate
```
```
For index : Dioxaphetyl_butyrate=357098008
```
* 467-86-7 -> 467-86-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Dioxaphetyl+butyrate not found on commonchemistry - Dioxaphetyl+butyrate

* No ChemSpiderID

* PubChem: 48194

* No InChI

* No SMILES
Dioxathion (3919)
```
Botcommand: addindex 352634454 Dioxathion
```
```
For index : Dioxathion=352634454
```
* 78-34-2 -> 78-34-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Dioxathion not found on commonchemistry - Dioxathion

* No ChemSpiderID (correct: 6283)

* No PubChem

* No InChI

* No SMILES
Dioxin_(chemical) (3920)
```
Botcommand: addindex 364869891 Dioxin_(chemical)
```
```
For index : Dioxin_(chemical)=364869891
```
* 290-67-5 -> 290-67-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Dioxin+chemical not found on commonchemistry - Dioxin+chemical

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dioxirane (3921)
```
Botcommand: addindex 348143527 Dioxirane
```
```
For index : Dioxirane=348143527
```
* 157-26-6 -> 157-26-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Dioxirane found on commonchemistry - Dioxirane
* 2425-79-8 (exact match)
Name in list

All names: [[[Tetramethylenebis(oxymethylene)]dioxirane]], 1,4-bis(2,3-epoxipropoxi)butano, 1,4-Bis(2,3-epoxypropoxy) butane, 1,4-Bis(2,3-epoxypropoxy)butan, 1,4-Bis(2,3-epoxypropoxy)butane, 1,4-Bis(2,3-epoxypropyloxy)butane, 1,4-BIS-(GLYCIDYLOXY)-BUTAN, 1,4-Bis(glycidyloxy)butane, 1,4-Bis(oxiranylmethyloxy)butane, 1,4-Butane diglycidyl ether, 1,4-Butanediol diglycidyl ether, 1,4-Butylene glycol diglycidyl ether, 1,4-Diglycidyloxybutane, [[2,2'-[1,4-Butanediylbis(oxymethylene)]bis[oxirane]]], [[2,2'-[1,4-Butanediylbis(oxymethylene)]bis[oxirane]]], [[2,2'-[1,4-BUTANEDIYLBIS(OXYMETHYLENE)]BISOXIRANE]], BDDGE, Butane, 1,4-bis(2,3-epoxypropoxy)-, BUTANE-1,4-DIOL DIGLYCIDYL ETHER, Denacol EX 214L, NSC 24834, [[OXIRANE, 2,2'-[1,4-BUTANEDIYLBIS-(OXYMETHYLENE)] BIS-]], [[Oxirane, 2,2'-[1,4-butanediylbis(oxymethylene)]bis-]], [[Oxirane, 2,2'-[1,4-butanediylbis(oxymethylene)]bis-]], [[Oxirane, 2,2'-[1,4-butanediylbis(oxymethylene)]bis-]], See also Glycidol derivatives, Tetramethylene glycol diglycidyl ether

* No ChemSpiderID

* PubChem: 449520

* No InChI

* SMILES: C1OO1
Dioxosuccinic_acid (3923)
* No CASNo

* Dioxosuccinic+acid not found on commonchemistry - Dioxosuccinic+acid

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dioxybenzone (3924)
```
Botcommand: addindex 355690406 Dioxybenzone
```
```
For index : Dioxybenzone=355690406
```
* 131-53-3 -> 131-53-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Dioxybenzone not found on commonchemistry - Dioxybenzone

* No ChemSpiderID (correct: 8251)

* No PubChem

* No InChI

* SMILES: O=C(C2=CC=CC=C2O)C1=C(O)C=C(OC)C=C1
Dioxygen_difluoride (3925)
```
Botcommand: addindex 363952578 Dioxygen_difluoride
```
```
For index : Dioxygen_difluoride=363952578
```
* 7783-44-0 -> 7783-44-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Dioxygen+difluoride not found on commonchemistry - Dioxygen+difluoride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dioxygenyl (3926)
```
Botcommand: addindex 357439273 Dioxygenyl
```
```
For index : Dioxygenyl=357439273
```
* 58238-79-2 -> 58238-79-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Dioxygenyl not found on commonchemistry - Dioxygenyl

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: OO
Diphenadione (3929)
```
Botcommand: addindex 361255184 Diphenadione
```
```
For index : Diphenadione=361255184
```
* 82-66-6 -> 82-66-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Diphenadione not found on commonchemistry - Diphenadione

* No ChemSpiderID

* PubChem: 6719

* No InChI

* No SMILES
Diphenyl_ditelluride (3936)
```
Botcommand: addindex 305797824 Diphenyl_ditelluride
```
```
For index : Diphenyl_ditelluride=305797824
```
* 32294-60-3 -> 32294-60-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Diphenyl+ditelluride not found on commonchemistry - Diphenyl+ditelluride

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C1(TeTeC2=CC=CC=C2)=CC=CC=C1
Diphenyl_oxalate (3938)
```
Botcommand: addindex 303177049 Diphenyl_oxalate
```
```
For index : Diphenyl_oxalate=303177049
```
* 3155-16-6 -> 3155-16-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Diphenyl+oxalate not found on commonchemistry - Diphenyl+oxalate

* No ChemSpiderID

* PubChem: 18475

* No InChI

* SMILES: O=C(Oc1ccccc1)C(=O)Oc2ccccc2
Diphenylalanine (3940)
```
Botcommand: addindex 318040951 Diphenylalanine
```
```
For index : Diphenylalanine=318040951
```
* 149597-92-2 -> 149597-92-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Diphenylalanine not found on commonchemistry - Diphenylalanine

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: OC(C(N)C(C2=CC=CC=C2)C1=CC=CC=C1)=O
Diphenylchlorarsine (3942)
```
Botcommand: addindex 358849850 Diphenylchlorarsine
```
```
For index : Diphenylchlorarsine=358849850
```
* 712-48-1 -> 712-48-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Diphenylchlorarsine not found on commonchemistry - Diphenylchlorarsine

* No ChemSpiderID

* No PubChem

* InChI: 1/C12H10AsCl/c14/h1-10H

* SMILES: Cl[As](C1=CC=CC=C1)C2=CC=CC=C2
Diphenylcyanoarsine (3943)
```
Botcommand: addindex 357629013 Diphenylcyanoarsine
```
```
For index : Diphenylcyanoarsine=357629013
```
* 23525-22-6 -> 23525-22-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Diphenylcyanoarsine not found on commonchemistry - Diphenylcyanoarsine

* No ChemSpiderID

* No PubChem

* InChI: 1/C13H10AsN/c15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H

* SMILES: C1=CC=C(C=C1)[As](C#N)C2=CC=CC=C2
Diphenylethylenediamine (3944)
```
Botcommand: addindex 336113180 Diphenylethylenediamine
```
```
For index : Diphenylethylenediamine=336113180
```
* 35132-20-8 -> 35132-20-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Diphenylethylenediamine not found on commonchemistry - Diphenylethylenediamine

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Diphenylhexatriene (3945)
```
Botcommand: addindex 330837171 Diphenylhexatriene
```
```
For index : Diphenylhexatriene=330837171
```
* 17329-15-6 -> 17329-15-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Diphenylhexatriene not found on commonchemistry - Diphenylhexatriene

* No ChemSpiderID

* PubChem: 5376733

* No InChI

* SMILES: C1=CC=C(C=C1)/C=C/C=C/C=C/C2=CC=CC=C2
Diphenylketene (3946)
```
Botcommand: addindex 327578966 Diphenylketene
```
```
For index : Diphenylketene=327578966
```
* 525-06-4 -> 525-06-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Diphenylketene not found on commonchemistry - Diphenylketene

* No ChemSpiderID

* PubChem: 123069

* No InChI

* SMILES: C1=CC=C(C=C1)C(=C=O)C2=CC=CC=C2
Diphenylmercury (3947)
```
Botcommand: addindex 359885582 Diphenylmercury
```
```
For index : Diphenylmercury=359885582
```
* 587-85-9 -> 587-85-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Diphenylmercury not found on commonchemistry - Diphenylmercury

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Diphenylmethylpiperazine (3950)
```
Botcommand: addindex 356561795 Diphenylmethylpiperazine
```
```
For index : Diphenylmethylpiperazine=356561795
```
* 841-77-0 -> 841-77-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Diphenylmethylpiperazine found on commonchemistry - Diphenylmethylpiperazine
* 298-57-7 (exact match)
Name in list

All names: 1-(3-Phenylallyl)-4-(diphenylmethyl)piperazine, 1-(Diphenylmethyl)-4-(3-phenyl-2-propenyl)piperazine, 1-Benzhydryl-4-cinnamylpiperazine, 1-Cinnamyl-4-(diphenylmethyl)piperazine, 1-Cinnamyl-4-benzhydrylpiperazine, [[1-Cynnamyl-4-diphenylmethylpiperazine]], 1-Diphenylmethyl-4-cinnamoylpiperazine, 516 MD, 516MD, Aplactan, Aplexal, Apotomin, Artate, Carecin, Cerebolan, Cerepar, Cinaperazine, cinarizina, Cinarizine, Cinazyn, Cinnacet, Cinnageron, Cinnarizin, cinnarizine, Cinnipirine, Corathiem, Denapol, Dimitron, Dimitronal, Eglen, Folcodal, Giganten, Glanil, Hilactan, Ixterol, Katoseran, Labyrin, Lazeta, Marisan, Midronal, Mitronal, N-Benzhydryl-N'-cinnamylpiperazine, Olamin, Piperazine, 1-(diphenylmethyl)-4-(3-phenyl-2-propen-1-yl)-, Piperazine, 1-(diphenylmethyl)-4-(3-phenyl-2-propenyl)-, Piperazine, 1-cinnamyl-4-(diphenylmethyl)-, Processine, R 1575, R 516, Sedatromin, Sepan, Siptazin, Spaderizine, Stugeron, Stutgeron, Stutgin, Toliman

* ChemSpiderID: 63238 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 70048

* InChI: InChI=1S/C17H20N2/c1-3-7-15(8-4-1)17(16-9-5-2-6-10-16)19-13-11-18-12-14-19/h1-10,17-18H,11-14H2 - (ChemSpider: | InChI=InChI=1/C17H20N2/c1-3-7-15(8-4-1)17(16-9-5-2-6-10-16)19-13-11-18-12-14-19/h1-10,17-18H,11-14H2 )

* SMILES: c1c(cccc1)C(c2ccccc2)N3CCNCC3 - (ChemSpider: | SMILES=c1c(cccc1)C(c2ccccc2)N3CCNCC3 )

3951 to 4000 edit

Diphenylprolinol (3953)
```
Botcommand: addindex 355726051 Diphenylprolinol
```
```
For index : Diphenylprolinol=355726051
```
* 22348-32-9 -> 22348-32-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Diphenylprolinol not found on commonchemistry - Diphenylprolinol

* No ChemSpiderID

* PubChem: 204386

* No InChI

* No SMILES
Diphenylsilanediol (3955)
```
Botcommand: addindex 357115531 Diphenylsilanediol
```
```
For index : Diphenylsilanediol=357115531
```
* 947-42-2 -> 947-42-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Diphenylsilanediol not found on commonchemistry - Diphenylsilanediol

* No ChemSpiderID

* PubChem: 24867114

* InChI: 1/C12H12O2Si/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13-14H/i1-12,2-12,3-12,4-12,5-12,6-12,7-12,8-12,9-12,10-12,11-12,12-12,13-16,14-16,15-28

* No SMILES
Diphepanol (3956)
```
Botcommand: addindex 362366823 Diphepanol
```
```
For index : Diphepanol=362366823
```
* 510-07-6 -> 510-07-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Diphepanol not found on commonchemistry - Diphepanol

* ChemSpiderID: 84978 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 94161

* InChI: InChI=1S/C20H25NO/c1-17(21-15-9-4-10-16-21)20(22,18-11-5-2-6-12-18)19-13-7-3-8-14-19/h2-3,5-8,11-14,17,22H,4,9-10,15-16H2,1H3 - (ChemSpider: | InChI=InChI=1/C20H25NO/c1-17(21-15-9-4-10-16-21)20(22,18-11-5-2-6-12-18)19-13-7-3-8-14-19/h2-3,5-8,11-14,17,22H,4,9-10,15-16H2,1H3 )

* SMILES: OC(c1ccccc1)(c2ccccc2)C(N3CCCCC3)C - (ChemSpider: | SMILES=OC(c1ccccc1)(c2ccccc2)C(N3CCCCC3)C )
Diphosgene (3957)
```
Botcommand: addindex 323495716 Diphosgene
```
```
For index : Diphosgene=323495716
```
* 503-38-8 -> 503-38-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Diphosgene found on commonchemistry - Diphosgene
* 24936-68-3 (exact match)
Name in list

All names: 121R, 141R, 2,2-(4-Hydroxyphenyl)propane-phosgene copolymer sru, 2,2-Bis(4-hydroxyphenyl)propane disodium salt-phosgene polymer, SRU, 2,2-Bis(4-hydroxyphenyl)propane polycarbonate SRU, 2,2-Bis(4-hydroxyphenyl)propane-carbonic acid copolymer, SRU, 2,2-Bis(4-hydroxyphenyl)propane-carbonic acid polymer, sru, 2,2-Bis(4-hydroxyphenyl)propane-diphenyl carbonate copolymer, sru, 2,2-Bis(4-hydroxyphenyl)propane-phosgene copolymer, SRU, 4,4'-Isopropylidenedi-p-phenylene bis(2,2,2-trichloroethyl) carbonate homopolymer sru, 7022A, 7022PJ, 7022PJ4LV, 7025A, A 1700, A 1900, A 2200, A 2500, A 3000, AD 5503, AD 9000TG, Bayer DE 1-1D, Bayloy, Bis(methyl salicyl) carbonate-bisphenol A copolymer, SRU, Bisphenol A diacetate-dimethyl carbonate copolymer, SRU, Bisphenol A dimethyl carbonate-diphenyl carbonate copolymer, SRU, Bisphenol A disodium salt-phosgene copolymer, SRU, Bisphenol A polycarbonate SRU, Bisphenol A-bis(2,2,2-trichloroethyl) carbonate copolymer SRU, Bisphenol A-bis(2,4,6-trichlorophenyl) carbonate copolymer, sru, Bisphenol A-bisphenol A bis(chloroformate) polymer, SRU, Bisphenol A-bisphenol A bischloroformate copolymer, SRU, Bisphenol A-bisphenol A disodium salt-carbonic acid copolymer, SRU, Bisphenol A-carbon dioxide copolymer, SRU, Bisphenol A-carbon monoxide copolymer, SRU, Bisphenol A-carbonate acid polymer, SRU, Bisphenol A-carbonic acid copolymer, SRU, Bisphenol A-carbonic acid polymer SRU, Bisphenol A-dimethyl carbonate copolymer, SRU, Bisphenol A-diphenyl carbonate copolymer acrylic acid monoester, sru, Bisphenol A-diphenyl carbonate copolymer, SRU, [[Bisphenol A-diphosgene copolymer, SRU]], Bisphenol A-phosgene copolymer, SRU, Bisphenol A-phosgene polymer, SRU, Bisphenol A-triphosgene copolymer, sru, Bistan, Bistan 22-76, Bistan 24-76, Bistan A, Bistan AE 23/76, Bistan AF, Bistan Af/p 6, Bistan Af/p 6/71, Bistan AK 33, Bistan AN, Bistan AS 20, Bistan AW, Bistan AW 3/76, Bistan RT 485, Bistan RT 499, Bistan W 11, Bistan W 6, Bistan W 9, C 110-100, C 1400, Calibre 13, Calibre 200-10, Calibre 200-13, Calibre 200-15, Calibre 200-18, Calibre 200-20, Calibre 210-10, Calibre 22, Calibre 300, Calibre 300-10, Calibre 300-15, Calibre 300-3, Calibre 300-4, Calibre 300-5, Calibre 300-6, Calibre 300-6 waterwhite, Calibre 301, Calibre 301-10, Calibre 301-15, Calibre 302-22, Calibre 7070, Calibre M 300-6, Calibre T 303, Calibre XP 73010.00, Carbonic acid-4,4'-dihydroxydiphenyl-2,2-propane copolymer, SRU, CM 1000, CT 301-260, CT 301-310, D 3, D 3 (polycarbonate), DE 11C, Diflon, Diflon K, Diflon L 2, Diflon MV 32000, Diflon OL, Diphenylolpropane disodium salt-phosgene copolymer, SRU, Durolon A 2600, Durolon I 2600, Durolon V 2700, E 2000, E 2000R, EC 100, FCR 2407, FL 900, FN 1500, FN 2200, FN 2200A, FN 2500A, FN 2700, FN 3000A, GE 141R, H 3000, H 4000, Hilex A, Hyzod, Hyzod M, Idemitsu Polycarbonate A 2200, Idemitsu Polycarbonate A 2500, Idemitsu Polycarbonate A 3000, Idemitsu Polycarbonate N 2200, IR 2200, Iupilon 2000, Iupilon 3000, Iupilon AL 141, Iupilon C 1400, Iupilon E 2000, Iupilon E 2000F, Iupilon H 3000, Iupilon H 400, Iupilon H 4000, Iupilon H 4000F, Iupilon K 1250, Iupilon K 1300, Iupilon K 4000, Iupilon L 1225, Iupilon L 1250, Iupilon NF 2000, Iupilon S 1000, Iupilon S 2000, Iupilon S 2000F, Iupilon S 2200F, Iupilon S 3000, Iupilon S 3000F, Iupilon S 3000FN, Iupilon S 3000R, Iupilon S 4000, K 1285W, K 1300, K 1300W, K 4000, Kimfol, KL 3-1009, L 1225, L 1225L, L 1225WP, L 1225WS, L 1225WX, L 1250, L 1250W, L 1250WP, L 1250WQ, L 1250Y, L 2, L 2 (polycarbonate), L 220, LBW 248, Lexan, Lexan 100, Lexan 100-111, Lexan 101, Lexan 101-111, Lexan 101-112, Lexan 101-131, Lexan 103, Lexan 104, Lexan 105, Lexan 105-111, Lexan 110A, Lexan 120, Lexan 121, Lexan 121R, Lexan 124, Lexan 124R112, Lexan 125, Lexan 125A, Lexan 130, Lexan 131, Lexan 131-111, Lexan 134, Lexan 135, Lexan 135-111, Lexan 135A, Lexan 140, Lexan 141, Lexan 141-111N, Lexan 141-112, Lexan 141B, Lexan 141R, Lexan 143, Lexan 144, Lexan 144R, Lexan 145, Lexan 145-111, Lexan 151, Lexan 153, Lexan 160, Lexan 161, Lexan 164, Lexan 175, Lexan 181, Lexan 200, Lexan 2014, Lexan 220, Lexan 303, Lexan 4535, Lexan 8040-112, Lexan 8050-112, Lexan 8070-112, Lexan 8800, Lexan 9030, Lexan 9034, Lexan EXRL 0065, Lexan FL 900, Lexan G 1382, Lexan Grade 141, Lexan HF 1110-111, Lexan HF 1110R, Lexan HF 1130, Lexan HF 1140-111, Lexan L 105A, Lexan L 220, Lexan LBW 248, Lexan LDS 1990, Lexan LS 2, Lexan LS-II, Lexan ML 3414, Lexan ML 4403-111, Lexan ML 4403III, Lexan ML 4505-111, Lexan ML 4858, Lexan ML 5521, Lexan ML 8199-111N, Lexan ML 9103, Lexan OQ 1050C, Lexan PC 120, Lexan PC 131, Lexan R 141, Lexan RL 5221, Lexan RL 7221, Lexan SP 1210, LG 7621, LW 1250, LX 105, M 2500, M 40, M 60, Macrofol DE 6-4, Makrofol, Makrofol 5905, Makrofol DE, Makrofol DE 1-1, Makrofol DE 11C, Makrofol DE 1-1D, Makrofol DE 1-1SC, Makrofol DE 1-4, Makrofol DE 6-2, Makrofol DPF 5014, Makrofol E, Makrofol G, Makrofol KG, Makrofol KL, Makrofol KL 3-1005/1, Makrofol KL 3-1009, Makrofol KL 3-1011, Makrofol N, Makrofol PCSM, Makrofol PCSM-PS 600, Makrolon, Makrolon 1143, Makrolon 1143FBL, Makrolon 1158, Makrolon 1189, Makrolon 1239, Makrolon 1243, Makrolon 1265, Makrolon 16063068, Makrolon 1804, Makrolon 1805, Makrolon 2005, Makrolon 2045, Makrolon 2100, Makrolon 2205, Makrolon 2207, Makrolon 2400, Makrolon 2400FBL, Makrolon 2401, Makrolon 2405, Makrolon 2407, Makrolon 2407-95/023, Makrolon 2408, Makrolon 2458, Makrolon 2500, Makrolon 2508, Makrolon 2538, Makrolon 2600, Makrolon 2600PC, Makrolon 2605, Makrolon 2606, Makrolon 2608, Makrolon 2608-1000, Makrolon 2620, Makrolon 2647, Makrolon 2658, Makrolon 2800, Makrolon 2803, Makrolon 2803 FBL, Makrolon 2805, Makrolon 2807, Makrolon 2808, Makrolon 283, Makrolon 2847, Makrolon 2858, Makrolon 3000, Makrolon 3000L, Makrolon 3000W, Makrolon 3100, Makrolon 3100-90850N, Makrolon 3100L, Makrolon 3102, Makrolon 3103, Makrolon 3105, Makrolon 3107, Makrolon 3108, Makrolon 3108-550115, Makrolon 3108FBL, Makrolon 3158, Makrolon 3200, Makrolon 3200/12405, Makrolon 3203, Makrolon 3208, Makrolon 5208, Makrolon 5308, Makrolon 5700, Makrolon 5705, Makrolon 5707, Makrolon 5900, Makrolon 6030, Makrolon 6385, Makrolon 6555, Makrolon 6557, Makrolon 7500, Makrolon 8020, Makrolon 8020GV, Makrolon 8030, Makrolon 8030-1, Makrolon 8030GV, Makrolon 8324, Makrolon 8325, Makrolon 8345, Makrolon 9415, Makrolon AI 2447, Makrolon AL 2643, Makrolon AL 2647, Makrolon AP 1, Makrolon C 2608-1000, Makrolon CD 2000, Makrolon CD 2005, Makrolon CD 2005MAS140, Makrolon CHP 1000, Makrolon DP 1-1235, Makrolon FCR, Makrolon FCR 2400, Makrolon FCR 2407, Makrolon FCR 2458-1112, Makrolon FCR 6255, Makrolon HMS 3118, Makrolon LQ 3147, Makrolon LS55/012-00, Makrolon M, Makrolon M 2400, Makrolon M 2800, Makrolon M 3000, Makrolon OD 2015, Makrolon OR 2608, Makrolon R, Makrolon R 2800, Makrolon S, Makrolon Ue 6555, Makrolon Ue 8324, Makrolon VP-Ue 8091, MC 5000, MC 5000 (polycarbonate), Merlon, Merlon 60, Merlon 6560, Merlon HMS 3118, Merlon M, Merlon M 39, Merlon M 40, Merlon M 40F, Merlon M 40HRF-1112, Merlon M 50, Merlon M 50-1512 Black, Merlon M 50F1000, Merlon M 60, MHL 1110, ML 5221-111, ML 5721-111, ML 5831-111, Mobay 39, N 2200, Novarex 7020AD2, Novarex 7022A, Novarex 7022PJ, Novarex 7022PJ4LV, Novarex 7025A, Novarex 7025PJ, Novarex 7027A, Novarex 7030A, Novarex 7030PJ, Novarex 733D, Novarex 8025A, Novarex FN 3000A, Novarex M 7022, Novarex M 7022A, Novarex M 7027B, Orgalan 12200, Paltuf, Panlite 1250, Panlite AD 5503, Panlite AD 5530, Panlite AD 9000TG, Panlite C, Panlite C 1400, Panlite CM 1000, Panlite K 1250, Panlite K 1285, Panlite K 1300, Panlite K 1300W, Panlite L 1225, Panlite L 1225L, Panlite L 1225WP, Panlite L 1225WS, Panlite L 1225WX, Panlite L 1250, Panlite L 1250W, Panlite L 1250WP, Panlite L 1250WQ, Panlite L 1250Y, Panlite PC 1111, Panlite PC 1151, Panlite RL 1225, PC 100, PC 105, PC 110, PC 1151, PC 120, PC 125, PC 135, PC 140, PC 141, PC 145, PC 175, PC 2200R, PC 2400, PC 2800, PC 2805, PC 2858, PC 3200, PC 5221, PC 6705, PC-A, PC-A (polycarbonate), PCSM-PS 600, PK-LT 12, Poly(4,4'-isopropylidenediphenyl carbonate), Poly(4,4'-isopropylidenediphenylene carbonate), Poly(carbonate bisphenol A), sru, Poly(isopropylidenediphenylene carbonate), Poly(oxycarbonyloxy-p-phenyleneisopropylidene-p-phenylene), Poly(oxy-p-phenyleneisopropylidene-p-phenyleneoxycarbonyl), [[Poly[oxy-1,4-phenylene(1-methylethylidene)-1,4-phenyleneoxycarbonyl]]], [[Poly[oxycarbonyloxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]]], Poly-4, 4'-isopropylidenediphenyl carbonate, Polycaace EC 100, Polycarbonate PC, Pureace C 110-100, Rodyne, RT 491, S 1000, S 2000, S 3000, S 3000F, SD 1080, Sinvet 201, Sinvet 220, Sinvet 251, Sinvet 271, Sinvet 301, Sunloid EC 100, Sunloid PC-EC 100, T 100, T 100 (polycarbonate), Toughlon A 1700, Toughlon A 1900, Toughlon A 2200, Toughlon A 2500, Toughlon A 25000, Toughlon A 3000, Toughlon FN 1500, Toughlon FN 1900, Toughlon FN 2200, Toughlon FN 2200A, Toughlon FN 2500A, Toughlon FN 2700, Toughlon FN 2700A, Toughlon IR 2200, Toughlon N 2200, Toughlon R 2500, Trirex 3022, Trirex 3026, Trirex 3030, Tuffak, Wonderlite PC 100, Wonderlite PC 110, Wonderlite PC 175, Xantar F 22UR, Xanter p 22, XP 73009.00, Zelux C

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Diphosphane (3958)

* No CASNo

* Diphosphane not found on commonchemistry - Diphosphane

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Diphosphorus_tetraiodide (3959)
```
Botcommand: addindex 339381419 Diphosphorus_tetraiodide
```
```
For index : Diphosphorus_tetraiodide=339381419
```
* 13455-00-0 -> 13455-00-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Diphosphorus+tetraiodide not found on commonchemistry - Diphosphorus+tetraiodide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Diphthamide (3960)
```
Botcommand: addindex 316301747 Diphthamide
```
```
For index : Diphthamide=316301747
```
* 75645-22-6 -> 75645-22-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Diphthamide not found on commonchemistry - Diphthamide

* No ChemSpiderID

* PubChem: 6438375

* No InChI

* SMILES: C[N+](C)(C)C(CCC1=NC=C(N1)CC(C(=O)[O-])N)C(=O)N
Diphtheria_vaccine (3961)
* No CASNo

* Diphtheria+vaccine not found on commonchemistry - Diphtheria+vaccine

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dipipanone (3963)
```
Botcommand: addindex 347527061 Dipipanone
```
```
For index : Dipipanone=347527061
```
* 467-83-4 -> 467-83-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Dipipanone not found on commonchemistry - Dipipanone

* No ChemSpiderID (correct: 12766)

* PubChem: 13331

* No InChI

* No SMILES
Dipotassium_guanylate (3965)
```
Botcommand: addindex 346345278 Dipotassium_guanylate
```
```
For index : Dipotassium_guanylate=346345278
```
* 3254-39-5 -> 3254-39-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Dipotassium+guanylate not found on commonchemistry - Dipotassium+guanylate

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O[C@H]1[C@@H](O)[C@H](N2C=NC3=C2NC(N)=NC3=O)O[C@@H]1COP([O-])([O-])=O.[K+].[K+]
Dippe (3967)

* No CASNo

* Dippe not found on commonchemistry - Dippe

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Diprenorphine (3968)
```
Botcommand: addindex 359941618 Diprenorphine
```
```
For index : Diprenorphine=359941618
```
* 14357-78-9 -> 14357-78-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Diprenorphine not found on commonchemistry - Diprenorphine

* No ChemSpiderID

* PubChem: 443408

* No InChI

* No SMILES
Dipropanoylmorphine (3969)
```
Botcommand: addindex 343854255 Dipropanoylmorphine
```
```
For index : Dipropanoylmorphine=343854255
```
* 10589-79-4 -> 10589-79-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Dipropanoylmorphine not found on commonchemistry - Dipropanoylmorphine

* No ChemSpiderID (correct: 20053814)

* PubChem: 165894

* No InChI

* No SMILES
Dipropylcyclopentylxanthine (3971)
```
Botcommand: addindex 362765633 Dipropylcyclopentylxanthine
```
```
For index : Dipropylcyclopentylxanthine=362765633
```
* 102146-07-6 -> 102146-07-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Dipropylcyclopentylxanthine not found on commonchemistry - Dipropylcyclopentylxanthine

* No ChemSpiderID

* PubChem: 1329

* No InChI

* No SMILES
Dipropyltryptamine (3973)
```
Botcommand: addindex 345095990 Dipropyltryptamine
```
```
For index : Dipropyltryptamine=345095990
```
* 61-52-9 -> 61-52-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Dipropyltryptamine not found on commonchemistry - Dipropyltryptamine

* No ChemSpiderID (correct: 5866)

* PubChem: 6091

* No InChI

* No SMILES
Diproqualone (3974)
```
Botcommand: addindex 356555532 Diproqualone
```
```
For index : Diproqualone=356555532
```
* 36518-02-2 -> 36518-02-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Diproqualone not found on commonchemistry - Diproqualone

* No ChemSpiderID (correct: 57691)

* PubChem: 64112

* No InChI

* No SMILES
Diproteverine (3975)
```
Botcommand: addindex 315699799 Diproteverine
```
```
For index : Diproteverine=315699799
```
* 69373-95-1 -> 69373-95-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Diproteverine not found on commonchemistry - Diproteverine

* No ChemSpiderID

* PubChem: 50463

* No InChI

* No SMILES
Diquat (3977)
```
Botcommand: addindex 339279664 Diquat
```
```
For index : Diquat=339279664
```
* 85-00-7 -> 85-00-7 - NOT VERIFIED

* CAS found on commonchemistry - 85-00-7 - name in list
All names: 1,1'-Ethylene-2,2'-bipyridinium dibromide, 1,1'-Ethylene-2,2'-bipyridylium dibromide, 1,1'-Ethylene-2,2'-bipyridyllium dibromide, [[6,7-Dihydrodipyrido[1,2-a:2',1'-c]pyrazidiinium dibromide]], [[6,7-Dihydrodipyrido[1,2-a:2',1'-c]pyrazinediium dibromide]], [[6,7-Dihydrodipyrido[1,2-a:2',1'-c]pyrazinium dibromide]], 6,7-Dihydrodipyridol 1,2-a:2',1-cpyrazinedium dibromide, 6,7-Dihydrodipyridol(1,2-a:2',1-c)pyrazinedium dibromide, [[6,7-Dihydropyrido[1,2-a:2',1'-c]pyrazinedium dibromide]], 9,10-Dihydro-8a,10a-diazoniaphenanthrene dibromide, 9,10-Dihydro-8a-10a-diazoniaphenanthrene dibromide, 9-10-Dihydro-8a,10a-diazoniaphenanthrene dibromide, Dibromure de diquat, dibromuro de dicuat, [[Dipyrido[1,2-a:2',1'-c]pyrazinediium, 6,7-dihydro-, dibromide]], [[Dipyrido[1,2-a:2',1'-c]pyrazinediium, 6,7-dihydro-, dibromide]], [[Dipyrido[1,2-a:2',1'-c]pyrazinediium, 6,7-dihydro-, dibromide]], [[Dipyrido[1,2-a:2',1'-c]pyrazinium, 6,7-dihydro-, bromide (1:2)]], Diquat, diquat dibromide, Diquatdibromid, DIQUAT-DIBROMID, Eliminator, Eliminator (herbicide), N,N'-Ethylene-2,2'-bipyridinium dibromide, Ortho-Diquat, PP 100, Reglon, Reglone, Reglone Turbo, Reglox, Reward, salts of diquat, UN 2781, Weedtrine D

* Diquat found on commonchemistry - Diquat
* 2764-72-9 (Formula: C12H12N2; Name: Dipyrido[1,2-a:2',1'-c]pyrazinediium, 6,7-dihydro-)

* 85-00-7 (Formula: C12H12N2.2Br; Name: Dipyrido[1,2-a:2',1'-c]pyrazinediium, 6,7-dihydro-, dibromide) Matches CAS (85-00-7) on page

* 68424-85-1 (Formula: Unspecified; Name: Quaternary ammonium compounds, benzyl-C12-16-alkyldimethyl, chlorides)

* No ChemSpiderID

* PubChem: 6794

* No InChI

* SMILES: C1C[N+]2=CC=CC=C2C3=CC=CC=[N+]31.[Br-].[Br-]
Direct_Blue_1 (3978)

* No CASNo

* Direct+Blue found on commonchemistry - Direct+Blue
* 72-57-1 (Formula: C34H28N6O14S4.4Na; Name: 2,7-Naphthalenedisulfonic acid, 3,3'-[(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[5-amino-4-hydroxy-, tetrasodium salt)

* 90295-11-7 (Formula: Unspecified; Name: Copper, [29H,31H-phthalocyaninato(2-)-╬║N29,╬║N30,╬║N31,╬║N32]-, aminosulfonyl sulfo derivs., sodium salts)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dirithromycin (3980)
```
Botcommand: addindex 364684433 Dirithromycin
```
```
For index : Dirithromycin=364684433
```
* 62013-04-1 -> 62013-04-1 - NOT VERIFIED

* CAS found on commonchemistry - 62013-04-1 - name not in list
All names: [[4,16-Dioxa-14-azabicyclo[11.3.1]heptadecan-5-one, 7-[(2,6-dideoxy-3-C-methyl-3-O-methyl-╬▒-L-ribo-hexopyranosyl)oxy]-3-ethyl-2,10-dihydroxy-15-[(2-methoxyethoxy)methyl]-2,6,8,10,12,17-hexamethyl-9-[[3,4,6-trideoxy-3-(dimethylamino)-╬▓-D-xylo-hexopyranosyl]oxy]-, (1R,2R,3R,6R,7S,8S,9R,10R,12R,13S,15R,17S)-]]

* Dirithromycin not found on commonchemistry - Dirithromycin

* No ChemSpiderID

* PubChem: 5464388

* No InChI

* No SMILES
Dirlotapide (3981)
```
Botcommand: addindex 334446477 Dirlotapide
```
```
For index : Dirlotapide=334446477
```
* 481658-94-0 -> 481658-94-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Dirlotapide not found on commonchemistry - Dirlotapide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dirucotide (3982)
```
Botcommand: addindex 299044477 Dirucotide
```
```
For index : Dirucotide=299044477
```
* 152074-97-0 -> 152074-97-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Dirucotide not found on commonchemistry - Dirucotide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Discodermolide (3983)
```
Botcommand: addindex 353407552 Discodermolide
```
```
For index : Discodermolide=353407552
```
* 127943-53-7 -> 127943-53-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Discodermolide not found on commonchemistry - Discodermolide

* No ChemSpiderID (correct: 558787)

* No PubChem

* No InChI

* SMILES: O=C1[C@H](C)[C@@H](O)[C@@H](C)[C@H] (C[C@H](O)/C=C\[C@H](C)[C@H](O)[C@@H] (C)\C=C(C[C@H](C)[C@@H](O)[C@H](C)[C@@H] (OC(N)=O)[C@@H](C)\C=C/C=C)\C)O1
Disiamylborane (3984)
```
Botcommand: addindex 357502814 Disiamylborane
```
```
For index : Disiamylborane=357502814
```
* 1069-54-1 -> 1069-54-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Disiamylborane not found on commonchemistry - Disiamylborane

* No ChemSpiderID

* PubChem: 6337887

* No InChI

* SMILES: CC(C(C)C)BC(C)C(C)C
Disodium_aurothiomalate (3986)
```
Botcommand: addindex 351098685 Disodium_aurothiomalate
```
```
For index : Disodium_aurothiomalate=351098685
```
* 12244-57-4 -> 12244-57-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Disodium+aurothiomalate not found on commonchemistry - Disodium+aurothiomalate

* No ChemSpiderID

* PubChem: 71443

* No InChI

* No SMILES
Disodium_citrate (3987)
```
Botcommand: addindex 360596942 Disodium_citrate
```
```
For index : Disodium_citrate=360596942
```
* 144-33-2 -> 144-33-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Disodium+citrate not found on commonchemistry - Disodium+citrate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Disodium_glutamate (3988)

* No CASNo

* Disodium+glutamate not found on commonchemistry - Disodium+glutamate

* No ChemSpiderID

* PubChem: 9794116

* No InChI

* SMILES: C(CC(=O)[O-])C(C(=O)[O-])N.[Na+].[Na+]
Disodium_guanylate (3989)
```
Botcommand: addindex 363466933 Disodium_guanylate
```
```
For index : Disodium_guanylate=363466933
```
* 5550-12-9^{[citation needed]} -> ^[citation needed] 5550-12-9^{[citation needed]} - NOT VERIFIED

* The CAS number '5550-12-9^{[citation needed]}' is not formatted correctly, please repair the contents of the field CASNo or CAS_number

* Disodium+guanylate not found on commonchemistry - Disodium+guanylate

* No ChemSpiderID

* PubChem: 21712

* No InChI

* SMILES: C1=NC2=C(N1C3C(C(C(O3)COP(=O)([O-])[O-])O)O)NC(=NC2=O)N.[Na+].[Na+]
Disodium_hydrogen_phosphite (3990)
```
Botcommand: addindex 361844364 Disodium_hydrogen_phosphite
```
```
For index : Disodium_hydrogen_phosphite=361844364
```
* 13708-85-5 -> 13708-85-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Disodium+hydrogen+phosphite not found on commonchemistry - Disodium+hydrogen+phosphite

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=P([O-])([O-])[H].[Na+].[Na+]
Disodium_inosinate (3991)
```
Botcommand: addindex 363021492 Disodium_inosinate
```
```
For index : Disodium_inosinate=363021492
```
* 4691-65-0^{[citation needed]} -> ^[citation needed] 4691-65-0^{[citation needed]} - NOT VERIFIED

* The CAS number '4691-65-0^{[citation needed]}' is not formatted correctly, please repair the contents of the field CASNo or CAS_number

* Disodium+inosinate not found on commonchemistry - Disodium+inosinate

* No ChemSpiderID

* PubChem: 20819

* No InChI

* SMILES: C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)([O-])[O-])O)O.[Na+].[Na+]
Disodium_malonate (3992)

* No CASNo

* Disodium+malonate not found on commonchemistry - Disodium+malonate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Disodium_methyl_arsenate (3993)
```
Botcommand: addindex 265874404 Disodium_methyl_arsenate
```
```
For index : Disodium_methyl_arsenate=265874404
```
* 144-21-8 -> 144-21-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Disodium+methyl+arsenate not found on commonchemistry - Disodium+methyl+arsenate

* No ChemSpiderID

* PubChem: 8947

* No InChI

* SMILES: C[As](=O)([O-])[O-].[Na+].[Na+]
Disodium_octaborate_tetrahydrate (3994)
```
Botcommand: addindex 359849058 Disodium_octaborate_tetrahydrate
```
```
For index : Disodium_octaborate_tetrahydrate=359849058
```
* 12280-03-4 -> 12280-03-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Disodium+octaborate+tetrahydrate not found on commonchemistry - Disodium+octaborate+tetrahydrate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Disodium_tetracarbonylferrate (3998)
```
Botcommand: addindex 308331719 Disodium_tetracarbonylferrate
```
```
For index : Disodium_tetracarbonylferrate=308331719
```
* 14878-31-0 -> 14878-31-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Disodium+tetracarbonylferrate not found on commonchemistry - Disodium+tetracarbonylferrate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Disperse_Orange_1 (4000)
```
Botcommand: addindex 307005137 Disperse_Orange_1
```
```
For index : Disperse_Orange_1=307005137
```
* 2581-69-3 -> 2581-69-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Disperse+Orange not found on commonchemistry - Disperse+Orange

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES

User:Beetstra/listing16

Contents

Data edit

3751 to 3800 edit

3801 to 3850 edit

3851 to 3900 edit

3901 to 3950 edit

3951 to 4000 edit