Wikipedia:WikiProject Pharmacology/Log/2010-09-01

Standard header for logs from CheMoBot

00:00:12 (3, 2, 4) (EDIT) User:Stageivsupporter (contribs, talk) edited Cimetidine (diff, hist)
Added links: http://www.nature.com/bjc/journal/v86/n2/abs/6600048a.html, http://www.cancerprev.org/Meetings/2004/Symposia/1094/138, http://www.nature.com/bjc/journal/v86/n2/abs/6600048a.html
01:44:31 (3, 2, 4) (EDIT) User:Fvasconcellos (contribs, talk) edited Aspirin (diff, hist)
Added links: http://www.heartfoundation.org.au/SiteCollectionDocuments/PP-590%20Diagnosis-Management%20ARF-RHD%20Evidence-Based%20Review.pdf, http://pediatrics.aappublications.org/cgi/pmidlookup?view=long&pmid=15545617, http://www.focusonfirstaid.co.uk/Magazine/issue1
02:10:11 (3, 2, 4) (EDIT) User:71.107.66.106 (contribs, talk) edited JWH-018 (diff, hist)
Added links: http://www.state.ia.us/government/odcp/docs/K2BanAlertUPDATE7-22-10.pdf
03:07:29 (2, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Fencamine (diff, hist)
Changed: 'image' ('Fencamine.svg' -> 'Fencamine.png')
03:07:30 (2, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Fencamine (diff, hist)
Changed: 'legal_status' ('' -> 'Rx-only')
03:07:30 (4, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Fencamine (diff, hist)
Changed: 'IUPAC_name' ('1,3-dimethyl-8-[2-[methyl(1-phenylpropan-2-yl)amino]ethylamino]-7''H''-purine-2,6-dione' -> '1,3,7-trimethyl-8-({2-[methyl(1-phenylpropan-2-yl)amino]ethyl}amino)-3,7-dihydro-1''H''-purine-2,6-dione')
03:07:30 (4, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Fencamine (diff, hist)
Changed: 'molecular_weight' ('355.433 g/mol' -> '384.48 g/mol')
03:07:30 (4, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Fencamine (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
03:07:30 (4, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Fencamine (diff, hist)
Changed: 'smiles' ('CC(CC1=CC=CC=C1)N(C)CCNC2=NC3=C(N2)C(=O)N(C(=O)N3C)C' -> 'O=C2N(c1nc(n(c1C(=O)N2C)C)NCCN(C(C)Cc3ccccc3)C)C')
03:07:31 (4, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Fencamine (diff, hist)
Changed: 'C' ('19' -> '20')
03:07:31 (4, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Fencamine (diff, hist)
Changed: 'H' ('25' -> '28')
03:07:31 (4, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Fencamine (diff, hist)
Changed: 'N' ('5' -> '6')
03:07:31 (4, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Fencamine (diff, hist)
Changed: 'PubChem' ('193038' -> '115374')
03:07:31 (4, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Fencamine (diff, hist)
Changed: 'ChemSpiderID' ('' -> '103208')
03:07:32 (5, 3, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Fencamine (diff, hist)
Changed: 'CAS_number' ('24356-67-0' -> '28947-50-4')
03:21:40 (3, 2, 4) (EDIT) User:My76Strat (contribs, talk) edited Rabies_vaccine (diff, hist)
Added links: http://www.jstor.org/pss/3560403, http://www.neurologyindia.com/article.asp?issn=0028-3886;year=2004;volume=52;issue=1;spage=132;epage=133;aulast=Srivastava
03:30:33 (3, 2, 4) (EDIT) User:Chris Capoccia (contribs, talk) edited Chlorpromazine (diff, hist)
Added links: http://ajp.psychiatryonline.org/cgi/pmidlookup?view=long&pmid=8561204
03:32:38 (3, 2, 4) (EDIT) User:Citation bot (contribs, talk) edited Chlorpromazine (diff, hist)
Added links: http://books.google.com/?id=6O2rPJnyhj0C&printsec=frontcover&dq=isbn=9780674015999&cd=1#v=onepage&q=chlorpromazie, http://books.google.com/?id=6O2rPJnyhj0C&printsec=frontcover&dq=isbn=9780674015999&cd=1#v=onepage&q, http://books.google.com/?id=6O2rPJnyhj0
04:57:40 (2, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'realboxname' ('drugbox' -> '', SET 'drugbox')
04:57:40 (2, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'boxname' ('drugbox' -> '', SET 'drugbox')
04:57:40 (2, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Changed: 'Watchedfields' ('changed' -> '', SET '')
04:57:40 (2, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Changed: 'verifiedrevid' ('263752391' -> '', SET '')
04:57:40 (2, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'width' ('200' -> '', SET '200')
04:57:40 (2, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'image' ('LSD 2D, 3D.png' -> '', SET 'LSD-2D,_3D.png')
04:57:41 (2, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'CASNo_Ref' ('{{cascite}}' -> '', SET '{{cascite}}')
04:57:41 (2, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Changed: 'IUPHAR_ligand' ('17' -> '', SET '')
04:57:41 (2, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'synonyms' ('LSD, LSD-25, lysergide, D-lysergic acid diethyl amide, ''N'',''N''- diethyl- D- lysergamide' -> '', SET 'LSD, LSD-25, lysergide, D-lysergic acid diethyl amide, ''
04:57:41 (2, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'elimination_half-life' ('3â5 hours<ref name="Aghajanian" /><ref name="Papac" />' -> '', SET '3 hours')
04:57:41 (2, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'metabolism' ('Hepatic' -> '', SET 'hepatic')
04:57:45 (2, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'excretion' ('[[Renal]]' -> '', SET 'renal')
04:57:46 (2, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'pregnancy_US' ('C' -> '', SET 'X')
04:57:46 (2, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'legal_AU' ('Schedule 9' -> '', SET 'Schedule 9')
04:57:46 (2, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'legal_CA' ('Schedule III' -> '', SET 'Schedule III')
04:57:47 (2, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'legal_UK' ('Class A' -> '', SET 'Class A')
04:57:47 (2, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'legal_US' ('Schedule I' -> '', SET 'Schedule I')
04:57:48 (4, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'IUPAC_name' ('(6a''R'',9''R'')- ''N'',''N''- diethyl- 7-methyl- 4,6,6a,7,8,9- hexahydroindolo- [4,3-''fg''] quinoline- 9-carboxamide' -> '', SET '(6a''R'',9''R'')- ''N'',''N''- diethyl- 7-methyl- 4,6,6a,7,8,9- hexahydroindolo- [4,3-''fg''] quinoline- 9-c
04:57:48 (4, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'molecular_weight' ('323.43 g/mol' -> '', SET '323.43 g/mol')
04:57:49 (4, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Changed: 'DrugBank' ('DB04829' -> '', SET '')
04:57:49 (4, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'smiles' ('CN1[C@](C2=C[C@@H](C(N(CC)CC)=O)C1)([H])CC3=CNC4=C3C2=CC=C4' -> '', SET 'CN1[C@](C2=C[C@@H](C(N(CC)CC)=O)C1)([H])CC3=CNC4=C3C2=CC=C4')
04:57:49 (4, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'C' ('20' -> '', SET '20')
04:57:49 (4, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'H' ('25' -> '', SET '25')
04:57:50 (4, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'N' ('3' -> '', SET '3')
04:57:50 (4, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'O' ('1' -> '', SET '1')
04:57:50 (4, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'PubChem' ('5761' -> '', SET '5761')
04:57:50 (4, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'melting_point' ('80' -> '', SET '80')
04:57:50 (4, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'ChemSpiderID' ('5558' -> '', SET '5558')
04:57:51 (5, 5, 5) (EDIT) User:Tuxbob (contribs, talk) edited Lysergic_acid_diethylamide (diff, hist)
Deleted: 'CAS_number' ('50-37-3' -> '', SET '50-37-3')
06:18:01 (3, 2, 4) (EDIT) User:Miniroovigilante (contribs, talk) edited Bromocriptine (diff, hist)
Added links: http://www.sciencedirect.com/science?_ob=ArticleURL&_udi=B6T1J-50C10Y3-1&_user=10&_coverDate=09/15/2010&_rdoc=1&_fmt=high&_orig=search&_origin=search&_sort=d&_docanchor=&view=c&_searchStrId=1447039084&_rerunOrigin=google&_acct=C000050221&_version=1&_urlVe
08:50:12 (2, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'realboxname' ('drugbox' -> '')
08:50:12 (2, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'boxname' ('drugbox' -> '')
08:50:12 (2, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'drug_name' ('MDMA' -> '')
08:50:12 (2, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'imagename' ('1 : 1 mixture (racemate) ' -> '')
08:50:13 (2, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'CASNo_Ref' ('{{cascite}}' -> '')
08:50:13 (2, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'image' ('MDMA (simple).svg' -> '')
08:50:13 (2, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'image2' ('MDMA_animation.gif' -> '')
08:50:13 (2, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'synonyms' ('(Â±)-1,3-benzodioxolyl-''N''-methyl-2-propanamine; (Â±)-3,4-methylenedioxy-''N''-methyl-Î±-methyl-2-phenethylamine; DL-3,4-methylenedioxy-''N''-methylamphetamine; methylenedioxymethamphetamine' -> '')
08:50:13 (2, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'elimination_half-life' ('6â10 (though duration of effects is typically actually 3â5 hours)' -> '')
08:50:14 (2, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'metabolism' ('[[Liver|Hepatic]], [[Cytochrome P450 oxidase|CYP450]] extensively involved, especially [[CYP2D6]]' -> '')
08:50:14 (2, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'excretion' ('[[Kidney|Renal]]' -> '')
08:50:14 (2, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'legal_AU' ('S9' -> '')
08:50:14 (2, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'legal_US' ('Schedule I' -> '')
08:50:14 (2, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'legal_UK' ('CD Lic' -> '')
08:50:15 (2, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'legal_CA' ('Schedule III' -> '')
08:50:15 (2, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'routes_of_administration' ('[[Oral]], [[sublingual]], [[insufflation (medicine)|insufflation]], [[inhalation]] ([[vaporization]]), [[injection (medicine)|injection]],<ref>{{cite web|title= Methylenedioxymethamphetamine (MDMA, ecstasy) |url = http://www.n
08:50:15 (4, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'IUPAC_name' ('(''RS'')-1-(benzo[''d''][1,3]dioxol-5-yl)-''N''-methylpropan-2-amine' -> '')
08:50:15 (4, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'molecular_weight' ('193.25 g/mol' -> '')
08:50:16 (4, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'ATC_prefix' ('none' -> '')
08:50:16 (4, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'smiles' ('CC(NC)CC1=CC=C(OCO2)C2=C1' -> '')
08:50:16 (4, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'C' ('11' -> '')
08:50:16 (4, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'H' ('15' -> '')
08:50:16 (4, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'N' ('1' -> '')
08:50:17 (4, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'O' ('2' -> '')
08:50:17 (4, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'PubChem' ('1615' -> '')
08:50:17 (4, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'ChemSpiderID' ('1556' -> '')
08:50:17 (5, 3, 5) (EDIT) User:98.247.16.2 (contribs, talk) edited MDMA (diff, hist)
Changed: 'CAS_number' ('69610-10-2' -> '')
08:50:37 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'realboxname' ('' -> 'drugbox')
08:50:37 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'boxname' ('' -> 'drugbox')
08:50:37 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'drug_name' ('' -> 'MDMA')
08:50:37 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'imagename' ('' -> '1 : 1 mixture (racemate) ')
08:50:37 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'CASNo_Ref' ('' -> '{{cascite}}')
08:50:38 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'image' ('' -> 'MDMA (simple).svg')
08:50:38 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'image2' ('' -> 'MDMA_animation.gif')
08:50:38 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'synonyms' ('' -> '(Â±)-1,3-benzodioxolyl-''N''-methyl-2-propanamine; (Â±)-3,4-methylenedioxy-''N''-methyl-Î±-methyl-2-phenethylamine; DL-3,4-methylenedioxy-''N''-methylamphetamine; methylenedioxymethamphetamine')
08:50:38 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'elimination_half-life' ('' -> '6â10 (though duration of effects is typically actually 3â5 hours)')
08:50:38 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'metabolism' ('' -> '[[Liver|Hepatic]], [[Cytochrome P450 oxidase|CYP450]] extensively involved, especially [[CYP2D6]]')
08:50:39 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'excretion' ('' -> '[[Kidney|Renal]]')
08:50:39 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'legal_AU' ('' -> 'S9')
08:50:39 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'legal_US' ('' -> 'Schedule I')
08:50:39 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'legal_UK' ('' -> 'CD Lic')
08:50:40 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'legal_CA' ('' -> 'Schedule III')
08:50:40 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'routes_of_administration' ('' -> '[[Oral]], [[sublingual]], [[insufflation (medicine)|insufflation]], [[inhalation]] ([[vaporization]]), [[injection (medicine)|injection]],<ref>{{cite web|title= Methylenedioxymethamphetamine (MDMA, ecstasy) |url = http:/
08:50:40 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'error' ('empty' -> '')
08:50:40 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'IUPAC_name' ('' -> '(''RS'')-1-(benzo[''d''][1,3]dioxol-5-yl)-''N''-methylpropan-2-amine')
08:50:40 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'molecular_weight' ('' -> '193.25 g/mol')
08:50:41 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'ATC_prefix' ('' -> 'none')
08:50:41 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'smiles' ('' -> 'CC(NC)CC1=CC=C(OCO2)C2=C1')
08:50:41 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'C' ('' -> '11')
08:50:41 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'H' ('' -> '15')
08:50:41 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'N' ('' -> '1')
08:50:42 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'O' ('' -> '2')
08:50:42 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'PubChem' ('' -> '1615')
08:50:42 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'ChemSpiderID' ('' -> '1556')
08:50:42 (6, 6, 6) (EDIT) User:Fyyer (contribs, talk) edited MDMA (diff, hist)
Changed: 'CAS_number' ('' -> '69610-10-2')
15:49:57 (3, 3, 5) (EDIT) User:Chappyclark (contribs, talk) edited PSI-6130 (diff, hist)
Changed: 'F' ('' -> '1')
15:49:58 (4, 3, 5) (EDIT) User:Chappyclark (contribs, talk) edited PSI-6130 (diff, hist)
Changed: 'C' ('36' -> '10')
15:49:58 (4, 3, 5) (EDIT) User:Chappyclark (contribs, talk) edited PSI-6130 (diff, hist)
Changed: 'H' ('53' -> '14')
15:49:58 (4, 3, 5) (EDIT) User:Chappyclark (contribs, talk) edited PSI-6130 (diff, hist)
Changed: 'N' ('7' -> '3')
15:49:59 (4, 3, 5) (EDIT) User:Chappyclark (contribs, talk) edited PSI-6130 (diff, hist)
Changed: 'O' ('6' -> '4')
15:49:59 (3, 2, 4) (EDIT) User:Chappyclark (contribs, talk) edited PSI-6130 (diff, hist)
Added links: http://pubs.acs.org/doi/abs/10.1021/jm0502788?prevSearch=%255Bauthor%253A%2Bjeremy%2Bl.%2Bclark%255D&searchHistoryKey=, http://journals.prous.com/journals/servlet/xmlxsl/pk_journals.xml_summary_pr?p_JournalId=2&p_RefId=1367744&p_IsPs=N
16:03:31 (3, 2, 4) (EDIT) User:Chappyclark (contribs, talk) edited PSI-6130 (diff, hist)
Added links: http://www.intmedpress.com/serveFile.cfm?sUID=01f7cbfd-f36a-4ff5-ba6e-3eab3035fa55
16:14:07 (3, 2, 4) (EDIT) User:Chappyclark (contribs, talk) edited PSI-6130 (diff, hist)
Added links: http://www.medhelp.org/posts/Hepatitis-C/INFORM-1-R7227-and-R7128-study/show/935635
18:42:34 (4, 3, 5) (EDIT) User:JÃ¼ (contribs, talk) edited Ethyl_glucuronide (diff, hist)
Changed: 'IUPAC_name' ('(2S,3S,4S,5R,6S)-6-ethoxy-3,4,5-trihydroxyoxane-2-carboxylic acid' -> '(2''S'',3''S'',4''S'',5''R'',6''S'')-6-ethoxy-3,4,5-trihydroxyoxane-2-carboxylic acid')
19:18:51 (2, 5, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Lisdexamfetamine (diff, hist)
Deleted: 'width' ('192px' -> '', SET '192px')
19:18:51 (4, 5, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Lisdexamfetamine (diff, hist)
Changed: 'IUPAC_name' ('''N''-[(1''S'')-1-methyl-2-phenylethyl]-L-lysinamide' -> '''N''-[(2''S'')-1-phenylpropan-2-yl]-L-lysinamide', SET '''N''-[(1''S'')-1-methyl-2-phenylethyl]-L-lysinamide')
19:18:52 (4, 5, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Lisdexamfetamine (diff, hist)
Added: 'DrugBank' ('' -> 'DB01255', SET '')
19:18:52 (4, 5, 5) (EDIT) User:El3ctr0nika (contribs, talk) edited Lisdexamfetamine (diff, hist)
Added: 'smiles' ('' -> 'O=S(=O)(O)C.O=S(=O)(O)C.O=C(N[C@H](Cc1ccccc1)C)[C@@H](N)CCCCN', SET '')
19:29:10 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Lisdexamfetamine (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')