Wikipedia:WikiProject Chemicals/Log/2011-03-28

Standard header for logs from CheMoBot

00:00:35 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Mepirodipine (diff, hist)
Added: 'verifiedrevid' ('' -> '392582440', SET '')
00:06:05 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Juvabione (diff, hist)
Added: 'verifiedrevid' ('' -> '394208487', SET '')
00:19:31 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Ethyl_methylphenylglycidate (diff, hist)
Added: 'verifiedrevid' ('' -> '379575830', SET '')
00:23:21 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Phenyl_salicylate (diff, hist)
Changed: 'verifiedrevid' ('394127820' -> '412457168', SET '394127820')
00:29:22 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Ethyl_eicosapentaenoic_acid (diff, hist)
Added: 'verifiedrevid' ('' -> '404277290', SET '')
01:09:52 (4, 4, 5) (EDIT) User:174.117.133.43 (contribs, talk) edited Acetylcholine (diff, hist)
Changed: 'O' ('2' -> '3', SET '2')
01:13:25 (4, 2, 5) (EDIT) User:174.117.133.43 (contribs, talk) edited Acetylcholine (diff, hist)
Changed: 'O' ('3' -> '2', SET '2')
01:14:31 (3, 2, 4) (EDIT) User:Topliuchao (contribs, talk) edited Diphenylphosphoryl_azide (diff, hist)
Added links: http://upload.wikimedia.org/wikipedia/commons/b/bf/DPPA_prep.gif
02:23:06 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Cantharidin (diff, hist)
Changed: 'verifiedrevid' ('411936454' -> '413673070', SET '411936454')
02:42:49 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Alpha-endorphin (diff, hist)
Changed: 'verifiedrevid' ('409890809' -> '413081252', SET '409890809')
02:42:50 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Alpha-endorphin (diff, hist)
Deleted: 'Watchedfields' ('changed' -> '', SET 'changed')
03:42:05 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Muconic_acid (diff, hist)
Added: 'verifiedrevid' ('' -> '398801716', SET '')
05:00:30 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Estradiol_17_beta-cypionate (diff, hist)
Added: 'verifiedrevid' ('' -> '351850245', SET '')
05:02:05 (4, 4, 5) (EDIT) User:117.211.1.198 (contribs, talk) edited Ammonium_cerium(IV)_sulfate (diff, hist)
Changed: 'MolarMass' ('596.50424 g/mol' -> '632.55496 g/mol', SET '596.50424 g/mol')
05:09:12 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Methoprene (diff, hist)
Changed: 'verifiedrevid' ('393019165' -> '394991804', SET '393019165')
05:12:51 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Methyl_cinnamate (diff, hist)
Added: 'verifiedrevid' ('' -> '395933124', SET '')
05:13:05 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Ammonium_cerium(IV)_sulfate (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
05:16:34 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Methyl_jasmonate (diff, hist)
Added: 'verifiedrevid' ('' -> '409544042', SET '')
05:19:20 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Methyl_phenylacetate (diff, hist)
Changed: 'verifiedrevid' ('276159007' -> '388258909', SET '276159007')
05:19:20 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Methyl_phenylacetate (diff, hist)
Deleted: 'Watchedfields' ('changed' -> '', SET 'changed')
05:39:21 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Pentyl_butyrate (diff, hist)
Changed: 'verifiedrevid' ('402891122' -> '408042585', SET '402891122')
05:39:42 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Pentyl_pentanoate (diff, hist)
Added: 'verifiedrevid' ('' -> '292802008', SET '')
05:42:47 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Phorbol_12,13-dibutyrate (diff, hist)
Added: 'verifiedrevid' ('' -> '400761335', SET '')
05:46:55 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Thymol_blue (diff, hist)
Changed: 'verifiedrevid' ('401632739' -> '401634248', SET '401632739')
06:02:40 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Pranidipine (diff, hist)
Added: 'verifiedrevid' ('' -> '394521754', SET '')
06:14:22 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Ryodipine (diff, hist)
Added: 'verifiedrevid' ('' -> '346456878', SET '')
07:04:28 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Added: 'ImageFileL1' ('' -> 'Acetylcholine.svg', SET '')
07:04:28 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Added: 'ImageFileL1_Ref' ('' -> '{{chemboximage|correct|??}}', SET '')
07:04:28 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Added: 'ImageSizeL1' ('' -> '121', SET '')
07:04:28 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Added: 'ImageNameL1' ('' -> 'Skeletal formula of acetylcholine', SET '')
07:04:29 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Added: 'ImageFileR1' ('' -> 'ACh-stick.png', SET '')
07:04:29 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Added: 'ImageFileR1_Ref' ('' -> '{{chemboximage|correct|??}}', SET '')
07:04:29 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Added: 'ImageSizeR1' ('' -> '121', SET '')
07:04:29 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Added: 'ImageNameR1' ('' -> 'Stick model of acetylcholine', SET '')
07:04:30 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Added: 'PubChem_Ref' ('' -> '{{Pubchemcite|correct|PubChem}}', SET '')
07:04:30 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Added: 'KEGG_Ref' ('{{keggcite|changed|kegg}}' -> '{{keggcite|correct|kegg}}', SET '')
07:04:30 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Added: 'ChEMBL_Ref' ('{{ebicite|changed|EBI}}' -> '{{ebicite|correct|EBI}}', SET '')
07:04:30 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Added: 'Beilstein' ('' -> '1764436', SET '')
07:04:31 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Added: 'Gmelin' ('' -> '326108', SET '')
07:04:31 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Added: '3DMet' ('' -> 'B00379', SET '')
07:04:31 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Changed: 'SMILES1' ('CC(=O)OCC[N ](C)(C)C' -> 'O=C(OCC[N ](C)(C)C)C', SET 'CC(=O)OCC[N ](C)(C)C')
07:04:31 (2, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Deleted: 'ImageFile1' ('Acetylcholine.svg' -> '', SET 'Acetylcholine.svg')
07:04:32 (2, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Deleted: 'ImageSize1' ('200px' -> '', SET '200px')
07:04:32 (2, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Deleted: 'ImageFile2' ('ACh-stick.png' -> '', SET 'ACh-stick.png')
07:04:32 (2, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Deleted: 'ImageSize2' ('200px' -> '', SET '200px')
07:04:32 (2, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Deleted: 'Section3' ('{{Chembox Hazards' -> '', SET '{{Chembox Hazards')
07:04:33 (2, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Deleted: 'HalfLife' ('approximately 2 minutes' -> '', SET 'approximately 2 minutes')
07:04:33 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Deleted: 'C' ('7' -> '', SET '7')
07:04:33 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Deleted: 'H' ('16' -> '', SET '16')
07:04:33 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Deleted: 'N' ('1' -> '', SET '1')
07:04:34 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Deleted: 'O' ('2' -> '', SET '2')
07:04:34 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Added: 'EINECS' ('' -> '200-128-9', SET '')
07:04:34 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Changed: 'SMILES' ('O=C(OCC[N ](C)(C)C)C' -> 'CC(=O)OCC[N ](C)(C)C', SET 'O=C(OCC[N ](C)(C)C)C')
07:04:34 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Added: 'MeSHName' ('' -> 'Acetylcholine', SET '')
07:04:35 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Added: 'ChEBI' ('' -> '15355', SET '')
07:04:35 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Added: 'Formula' ('' -> 'C7H16NO2 ', SET '')
07:04:35 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Added: 'MolarMass' ('' -> '146.2074 g mol-1', SET '')
07:04:36 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Added: 'ExactMass' ('' -> '146.118103761 g mol-1', SET '')
07:04:36 (5, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Acetylcholine (diff, hist)
Added: 'ChEMBL' ('1184' -> '667', SET '')
07:05:15 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Osmium_dioxide (diff, hist)
Changed: 'verifiedrevid' ('415299979' -> '418073152', SET '415299979')
07:15:28 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Acetylcholine (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
07:15:28 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Acetylcholine (diff, hist)
Added: 'KEGG_Ref' ('{{keggcite|correct|kegg}}' -> '{{keggcite|changed|kegg}}', SET '')
07:15:28 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Acetylcholine (diff, hist)
Added: 'ChEMBL_Ref' ('{{ebicite|correct|EBI}}' -> '{{ebicite|changed|EBI}}', SET '')
07:15:37 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Dimethyl_telluride (diff, hist)
Added: 'verifiedrevid' ('' -> '397666791', SET '')
07:39:47 (2, 4, 5) (EDIT) User:94.112.251.180 (contribs, talk) edited Citric_acid (diff, hist)
Changed: 'OtherNames' ('3-carboxy, 3-hydroxypentanedioic acid. 3-hydroxypentanedioic acid-3-carboxylic acid Hydrogen citrate' -> '3-carboxy-3-hydroxypentanedioic acid', SET '2-hydroxypropane- 1,2,3- tricarboxylic acid 3-hydroxypentanedioic acid-3-ca
08:40:03 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Diphosgene (diff, hist)
Changed: 'verifiedrevid' ('404696768' -> '408776613', SET '404696768')
09:33:02 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Santonic_acid (diff, hist)
Changed: 'verifiedrevid' ('401048309' -> '401049719', SET '401048309')
09:39:58 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Methyl_chloroformate (diff, hist)
Changed: 'verifiedrevid' ('311033559' -> '413070774', SET '311033559')
10:17:42 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Yttrium_nitride (diff, hist)
Added: 'verifiedrevid' ('' -> '366684589', SET '')
10:21:09 (4, 3, 5) (EDIT) User:Tomcangxanhdo (contribs, talk) edited Morphinan (diff, hist)
Changed: 'BoilingPt' ('115Â±0.05Â°C (liquil oil)' -> '115Â±0.05Â°C (liquid oil)')
12:39:37 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Terephthalic_acid (diff, hist)
Changed: 'verifiedrevid' ('401620402' -> '401621752', SET '401620402')
12:43:19 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Bromide (diff, hist)
Added: 'CASNo' ('' -> '24959-67-9', SET '')
12:43:19 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Bromide (diff, hist)
Added: 'PubChem_Ref' ('' -> '{{Pubchemcite|correcyt|pubchem}}', SET '')
12:43:19 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Bromide (diff, hist)
Added: 'KEGG_Ref' ('' -> '{{keggcite|correct|kegg}}', SET '')
12:43:20 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Bromide (diff, hist)
Added: 'Beilstein' ('' -> '3587179', SET '')
12:43:20 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Bromide (diff, hist)
Added: 'Gmelin' ('' -> '14908', SET '')
12:43:20 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Bromide (diff, hist)
Added: 'StdInChIKey_Ref' ('{{stdinchicite|correct|chemspider}}' -> '{{stdinchicite|correct|chemspider}}}}', SET '')
12:43:20 (2, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Bromide (diff, hist)
Changed: 'Section3' ('{{Chembox Hazards' -> '{{Chembox Pharmacology', SET '{{Chembox Hazards')
12:43:21 (4, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Bromide (diff, hist)
Added: 'IUPACName' ('' -> 'Bromide', SET '')
12:43:21 (4, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Bromide (diff, hist)
Added: 'ChEBI' ('' -> '15858', SET '')
12:43:21 (4, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Bromide (diff, hist)
Added: 'Formula' ('' -> 'Br-', SET '')
12:43:21 (4, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Bromide (diff, hist)
Added: 'MolarMass' ('' -> '79.904 g mol-1', SET '')
12:43:22 (4, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Bromide (diff, hist)
Added: 'ExactMass' ('' -> '78.918337647 g mol-1', SET '')
12:43:22 (5, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Bromide (diff, hist)
Added: 'KEGG' ('' -> 'C01324', SET '')
12:45:46 (3, 2, 4) (EDIT) User:Mlwer (contribs, talk) edited Oleandrin (diff, hist)
Added links: http://mct.aacrjournals.org/content/8/8/2319.full
12:50:36 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Tributyl_phosphate (diff, hist)
Changed: 'verifiedrevid' ('401641366' -> '410157069', SET '401641366')
12:50:36 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Tributyl_phosphate (diff, hist)
Changed: 'KEGG_Ref' ('{{keggcite|changed|kegg}}' -> '{{keggcite|correct|kegg}}', SET '{{keggcite|changed|kegg}}')
12:50:37 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Tributyl_phosphate (diff, hist)
Deleted: 'Verifiedfields' ('changed' -> '', SET 'changed')
12:54:08 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Bromide (diff, hist)
Added: 'Verifiedfields' ('' -> 'changed', SET '')
12:54:08 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Bromide (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
12:54:08 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Bromide (diff, hist)
Added: 'KEGG_Ref' ('{{keggcite|correct|kegg}}' -> '{{keggcite|changed|kegg}}', SET '')
12:55:10 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Pyrrole (diff, hist)
Changed: 'verifiedrevid' ('408974067' -> '411843960', SET '408974067')
12:55:10 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Pyrrole (diff, hist)
Added: 'ImageFileL1_Ref' ('' -> '{{chemboximage|correct|??}}', SET '')
12:55:11 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Pyrrole (diff, hist)
Added: 'ImageFileR1_Ref' ('' -> '{{chemboximage|correct|??}}', SET '')
13:00:51 (2, 2, 5) (EDIT) User:Brichcja (contribs, talk) edited Terephthalic_acid (diff, hist)
Changed: 'verifiedrevid' ('401621752' -> '401620402', SET '401620402')
13:02:50 (3, 4, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Bromide (diff, hist)
Added: 'SystematicName' ('' -> 'Bromide<ref>{{Cite web|title = Bromide - PubChem Public Chemical Database|url = http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=259|work = The PubChem Project|location = USA|publisher = National Center for Biotechnology In
13:02:50 (4, 5, 5) (EDIT) User:Plasmic Physics (contribs, talk) edited Bromide (diff, hist)
Changed: 'IUPACName' ('Bromide' -> '', SET '')
13:02:51 (3, 2, 4) (EDIT) User:Plasmic Physics (contribs, talk) edited Bromide (diff, hist)
Added links: http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=259
13:03:03 (3, 2, 4) (EDIT) User:Mlwer (contribs, talk) edited Oleandrin (diff, hist)
Added links: http://www.clinchem.org/cgi/reprint/42/10/1654.pdf
13:12:37 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Terephthalic_acid (diff, hist)
Changed: 'verifiedrevid' ('401620402' -> '401621752', SET '401620402')
13:15:05 (3, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'Watchedfields' ('changed' -> '')
13:15:05 (3, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'verifiedrevid' ('395327150' -> '')
13:15:06 (3, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'CASNo_Ref' ('{{cascite|??|??}}' -> '{{cascite}}')
13:15:06 (3, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'Appearance' ('yellow solid (dimer)<ref name="El_Murr_1979"/>' -> '')
13:15:06 (3, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'Solubility' ('somewhat soluble in [[dichloromethane]] (dimer)<ref name="El_Murr_1979" /> soluble in [[acetonitrile]]<ref name="El_Murr_1979" />' -> '')
13:15:07 (3, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'ImageFile1' ('Rhodocene-2D-skeletal.png' -> '')
13:15:07 (3, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'ImageSize1' ('100px' -> '')
13:15:08 (3, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'ImageName1' ('Skeletal structure of the staggered conformation of rhodocene' -> '')
13:15:08 (3, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'IUPACname' ('rhodocene, bis(Î·5-cyclopentadienyl)rhodium(II)' -> '')
13:15:08 (3, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'ChemSpiderID_Ref' ('{{chemspidercite|correct|chemspider}}' -> '')
13:15:09 (3, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'InChI1' ('1/2C5H5.Rh/c2*1-2-4-5-3-1;/h2*1-5H;/q2*-1; 2' -> '')
13:15:09 (3, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'InChIKey1' ('IWAKCRNSZSPDTB-UHFFFAOYAC' -> '')
13:15:09 (3, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'StdInChI_Ref' ('{{stdinchicite|correct|chemspider}}' -> '')
13:15:09 (3, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'StdInChIKey_Ref' ('{{stdinchicite|correct|chemspider}}' -> '')
13:15:10 (3, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'Rh' ('1' -> '')
13:15:10 (4, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'C' ('10' -> '')
13:15:10 (4, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'H' ('10' -> '')
13:15:10 (4, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'IUPACName' ('' -> 'rhodocene, bis(Î·5-cyclopentadienyl)rhodium(II)')
13:15:11 (4, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'SMILES' ('[cH-]1cccc1.[cH-]1cccc1.[Rh 2]' -> '')
13:15:14 (4, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'InChI' ('' -> 'InChI=1/2C5H5.Rh/c2*1-2-4-5-3-1;/h2*1-5H;')
13:15:15 (4, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'Formula' ('' -> 'C10H10Rh')
13:15:15 (4, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'MolarMass' ('' -> '233.10 g·mol-1')
13:15:16 (4, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'MeltingPt' ('174 Â°C with decomposition (dimer)<ref name="El_Murr_1979" />' -> '')
13:15:17 (5, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'ChemSpiderID' ('2339512' -> '')
13:15:18 (5, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'StdInChI' ('1S/2C5H5.Rh/c2*1-2-4-5-3-1;/h2*1-5H;/q2*-1; 2' -> '')
13:15:18 (5, 3, 5) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'StdInChIKey' ('IWAKCRNSZSPDTB-UHFFFAOYSA-N' -> '')
13:15:19 (3, 2, 4) (EDIT) User:87.95.140.140 (contribs, talk) edited Rhodocene (diff, hist)
Added links: http://www3.interscience.wiley.com/journal/109667209/abstract
13:15:23 (3, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'Watchedfields' ('' -> 'changed')
13:15:24 (3, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'verifiedrevid' ('' -> '395327150')
13:15:24 (3, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'ImageFile1' ('' -> 'Rhodocene-2D-skeletal.png')
13:15:24 (3, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'ImageSize1' ('' -> '100px')
13:15:25 (3, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'ImageName1' ('' -> 'Skeletal structure of the staggered conformation of rhodocene')
13:15:25 (3, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'IUPACname' ('' -> 'rhodocene, bis(Î·5-cyclopentadienyl)rhodium(II)')
13:15:25 (3, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'ChemSpiderID_Ref' ('' -> '{{chemspidercite|correct|chemspider}}')
13:15:25 (3, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'InChI1' ('' -> '1/2C5H5.Rh/c2*1-2-4-5-3-1;/h2*1-5H;/q2*-1; 2')
13:15:26 (3, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'InChIKey1' ('' -> 'IWAKCRNSZSPDTB-UHFFFAOYAC')
13:15:26 (3, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'CASNo_Ref' ('{{cascite}}' -> '{{cascite|??|??}}')
13:15:26 (3, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'StdInChI_Ref' ('' -> '{{stdinchicite|correct|chemspider}}')
13:15:26 (3, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'StdInChIKey_Ref' ('' -> '{{stdinchicite|correct|chemspider}}')
13:15:27 (3, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'Rh' ('' -> '1')
13:15:30 (3, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'Appearance' ('' -> 'yellow solid (dimer)<ref name="El_Murr_1979"/>')
13:15:31 (3, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'Solubility' ('' -> 'somewhat soluble in [[dichloromethane]] (dimer)<ref name="El_Murr_1979" /> soluble in [[acetonitrile]]<ref name="El_Murr_1979" />')
13:15:32 (4, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'C' ('' -> '10')
13:15:32 (4, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'H' ('' -> '10')
13:15:33 (4, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'IUPACName' ('rhodocene, bis(Î·5-cyclopentadienyl)rhodium(II)' -> '')
13:15:33 (4, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'SMILES' ('' -> '[cH-]1cccc1.[cH-]1cccc1.[Rh 2]')
13:15:33 (4, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'InChI' ('InChI=1/2C5H5.Rh/c2*1-2-4-5-3-1;/h2*1-5H;' -> '')
13:15:34 (4, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'Formula' ('C10H10Rh' -> '')
13:15:34 (4, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'MolarMass' ('233.10 g·mol-1' -> '')
13:15:34 (4, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'MeltingPt' ('' -> '174 Â°C with decomposition (dimer)<ref name="El_Murr_1979" />')
13:15:35 (5, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'ChemSpiderID' ('' -> '2339512')
13:15:35 (5, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'StdInChI' ('' -> '1S/2C5H5.Rh/c2*1-2-4-5-3-1;/h2*1-5H;/q2*-1; 2')
13:15:35 (5, 3, 5) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Changed: 'StdInChIKey' ('' -> 'IWAKCRNSZSPDTB-UHFFFAOYSA-N')
13:15:35 (3, 2, 4) (EDIT) User:Reaper Eternal (contribs, talk) edited Rhodocene (diff, hist)
Added links: http://books.google.com.au/books?id=aVyfo52-nRsC&pg=PA41, http://books.google.com.au/books?id=WLb962AKlSEC&pg=PA2, http://books.google.com.au/books?id=NSQy3mFKRM8C&pg=PA262, http://books.google.com.au/books?id=A_DD2-boJiUC&pg=RA1-PA4, http://books.google.
13:27:48 (2, 4, 5) (EDIT) User:Nao1958 (contribs, talk) edited Annonacin (diff, hist)
Changed: 'ImageSize' ('200px' -> '250px', SET '200px')
13:27:51 (4, 4, 5) (EDIT) User:Nao1958 (contribs, talk) edited Annonacin (diff, hist)
Changed: 'MolarMass' ('596.88 g/mol' -> '596.88 g/mol Appearance=', SET '596.88 g/mol')
13:28:50 (2, 2, 5) (EDIT) User:Nao1958 (contribs, talk) edited Annonacin (diff, hist)
Changed: 'ImageSize' ('250px' -> '200px', SET '200px')
13:28:51 (4, 2, 5) (EDIT) User:Nao1958 (contribs, talk) edited Annonacin (diff, hist)
Changed: 'MolarMass' ('596.88 g/mol Appearance=' -> '596.88 g/mol', SET '596.88 g/mol')
13:31:52 (2, 3, 5) (EDIT) User:Mlwer (contribs, talk) edited Oleandrin (diff, hist)
Changed: 'Appearance' ('' -> 'Oleandrin forms colourless, odourless, acicular crystals which are very bitter')
13:33:08 (3, 2, 4) (EDIT) User:Edgar181 (contribs, talk) edited Glucono_delta-lactone (diff, hist)
Added links: http://www.food.gov.uk/safereating/chemsafe/additivesbranch/enumberlist#h_7
13:47:47 (2, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Glucuronolactone (diff, hist)
Changed: 'Reference' ('<ref name="Merck">''Merck Index'', 11th Edition, '''4362'''</ref>' -> '<ref name="Merck">''[[Merck Index]]'', 11th Edition, '''4362'''</ref>', SET '<ref name="Merck">''Merck Index'', 11th Edition, '''4362'''</ref>')
13:47:47 (2, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Glucuronolactone (diff, hist)
Changed: 'OtherNames' ('Glucuronic acid lactone' -> 'Glucuronic acid lactone; Glucurone; Glucurolactone; D-Glucurono-3,6-lactone', SET 'Glucuronic acid lactone')
13:47:47 (2, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Glucuronolactone (diff, hist)
Changed: 'CASNo_Comment' ('{{Citation needed|date=March 2010}}' -> '{{cascite|correct|CAS}}', SET '{{Citation needed|date=March 2010}}')
13:47:48 (4, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Glucuronolactone (diff, hist)
Added: 'C' ('' -> '6', SET '')
13:47:48 (4, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Glucuronolactone (diff, hist)
Added: 'H' ('' -> '8', SET '')
13:47:48 (4, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Glucuronolactone (diff, hist)
Added: 'O' ('' -> '6', SET '')
13:47:49 (4, 4, 4) (EDIT) User:Edgar181 (contribs, talk) edited Glucuronolactone (diff, hist)
Changed: 'IUPACName' ('(''2R'')-2-[(''2S,3R,4S'')-3,4-Dihydroxy-5-oxo -tetrahydrofuran-2-yl]-2-hydroxy-acetaldehyde' -> '(2''R'')-2-[(2''S'',3''R'',4''S'')-3,4-Dihydroxy-5-oxo-tetrahydrofuran-2-yl]-2-hydroxy-acetaldehyde', SET '(''2R'')-2-[(''2S,3R,4S'')-3,4-Dihyd
13:47:50 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Glucuronolactone (diff, hist)
Deleted: 'Formula' ('C6H8O6' -> '', SET 'C6H8O6')
13:47:51 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Glucuronolactone (diff, hist)
Deleted: 'MolarMass' ('176.124' -> '', SET '176.124')
13:47:52 (4, 5, 4) (EDIT) User:Edgar181 (contribs, talk) edited Glucuronolactone (diff, hist)
Added: 'Density' ('' -> '1.76 g/cm3 (30 Â°C)', SET '')
13:58:44 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Glucuronolactone (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
13:58:44 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Glucuronolactone (diff, hist)
Added: 'verifiedrevid' ('' -> '408808918', SET '')
14:04:55 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Tetramethrin (diff, hist)
Changed: 'verifiedrevid' ('402683106' -> '408928455', SET '402683106')
14:04:55 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Tetramethrin (diff, hist)
Changed: 'KEGG_Ref' ('{{keggcite|changed|kegg}}' -> '{{keggcite|correct|kegg}}', SET '{{keggcite|changed|kegg}}')
14:04:55 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Tetramethrin (diff, hist)
Deleted: 'Verifiedfields' ('changed' -> '', SET 'changed')
14:06:36 (4, 3, 5) (EDIT) User:Mlwer (contribs, talk) edited Oleandrin (diff, hist)
Changed: 'MeltingPt' ('' -> '250')
14:08:52 (4, 3, 5) (EDIT) User:Mlwer (contribs, talk) edited Oleandrin (diff, hist)
Changed: 'MeltingPt' ('250' -> '250.0')
14:11:35 (2, 3, 5) (EDIT) User:Mlwer (contribs, talk) edited Oleandrin (diff, hist)
Changed: 'MeltingPtc' ('' -> '250.0')
14:11:35 (4, 3, 5) (EDIT) User:Mlwer (contribs, talk) edited Oleandrin (diff, hist)
Changed: 'MeltingPt' ('250.0' -> '')
14:12:10 (2, 3, 5) (EDIT) User:Mlwer (contribs, talk) edited Oleandrin (diff, hist)
Changed: 'MeltingPtc' ('250.0' -> '')
14:12:10 (4, 3, 5) (EDIT) User:Mlwer (contribs, talk) edited Oleandrin (diff, hist)
Changed: 'MeltingPtC' ('' -> '250.0')
14:13:29 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited ZK-93426 (diff, hist)
Added: 'verifiedrevid' ('' -> '396760747', SET '')
14:20:18 (2, 3, 5) (EDIT) User:Henning Makholm (contribs, talk) edited Methylene (diff, hist)
Changed: 'ImageFile' ('' -> 'Carbene.png')
14:20:18 (2, 3, 5) (EDIT) User:Henning Makholm (contribs, talk) edited Methylene (diff, hist)
Changed: 'ImageSize' ('' -> '50px')
14:22:59 (2, 3, 5) (EDIT) User:Henning Makholm (contribs, talk) edited Methylene (diff, hist)
Changed: 'ImageSize' ('50px' -> '25px')
14:27:49 (4, 4, 5) (EDIT) User:193.174.14.2 (contribs, talk) edited Triphenylphosphine (diff, hist)
Changed: 'MolarMass' ('262.29 g/mol' -> '262.67 g/mol', SET '262.29 g/mol')
14:28:53 (2, 4, 4) (EDIT) User:ChemNerd (contribs, talk) edited N-Acetylserotonin (diff, hist)
Added: 'Name' ('' -> '''N''-Acetylserotonin', SET '')
14:29:03 (4, 2, 5) (EDIT) User:193.174.14.2 (contribs, talk) edited Triphenylphosphine (diff, hist)
Changed: 'MolarMass' ('262.67 g/mol' -> '262.29 g/mol', SET '262.29 g/mol')
14:39:30 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited N-Acetylserotonin (diff, hist)
Added: 'verifiedrevid' ('' -> '415044619', SET '')
15:05:39 (3, 2, 4) (EDIT) User:Monsieurpiggy (contribs, talk) edited Kojibiose (diff, hist)
Added links: http://onlinelibrary.wiley.com/doi/10.1111/j.1365-2621.1966.tb01905.x/abstract/
15:07:32 (3, 2, 4) (EDIT) User:Monsieurpiggy (contribs, talk) edited Sophorose (diff, hist)
Added links: http://onlinelibrary.wiley.com/doi/10.1111/j.1365-2621.1966.tb01905.x/abstract/
15:08:48 (3, 2, 4) (EDIT) User:Monsieurpiggy (contribs, talk) edited Nigerose (diff, hist)
Added links: http://onlinelibrary.wiley.com/doi/10.1111/j.1365-2621.1966.tb01905.x/abstract/
15:12:20 (3, 2, 4) (EDIT) User:Monsieurpiggy (contribs, talk) edited Laminaribiose (diff, hist)
Added links: http://onlinelibrary.wiley.com/doi/10.1111/j.1365-2621.1966.tb01905.x/abstract/
15:18:19 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Acefluranol (diff, hist)
Changed: 'ImageFile' ('' -> 'Acefluranol.svg')
15:18:19 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Acefluranol (diff, hist)
Changed: 'ImageSize' ('' -> '200px')
15:18:20 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Acefluranol (diff, hist)
Changed: 'CASNo' ('80595-73-9' -> '83282-71-7')
15:18:20 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Acefluranol (diff, hist)
Changed: 'CASNo_Ref' ('' -> '{{cascite|correct|CAS}}')
15:18:20 (2, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Acefluranol (diff, hist)
Changed: 'F' ('' -> '2')
15:18:20 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Acefluranol (diff, hist)
Changed: 'C' ('' -> '25')
15:18:21 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Acefluranol (diff, hist)
Changed: 'H' ('' -> '26')
15:18:21 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Acefluranol (diff, hist)
Changed: 'O' ('' -> '8')
15:18:21 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Acefluranol (diff, hist)
Changed: 'IUPACName' ('pentane-2,3-diylbis-6-fluorobenzene-4,1,2-triyl tetraacetate' -> 'Pentane-2,3-diylbis-6-fluorobenzene-4,1,2-triyl tetraacetate')
15:18:22 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Acefluranol (diff, hist)
Changed: 'Formula' ('C25H26F2O8' -> '')
15:18:22 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Acefluranol (diff, hist)
Changed: 'MolarMass' ('492.466' -> '')
15:18:34 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Sophorose (diff, hist)
Added: 'verifiedrevid' ('' -> '385317664', SET '')
15:19:28 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Nigerose (diff, hist)
Added: 'verifiedrevid' ('' -> '350395864', SET '')
15:19:39 (3, 2, 4) (EDIT) User:Monsieurpiggy (contribs, talk) edited Maltose (diff, hist)
Added links: http://onlinelibrary.wiley.com/doi/10.1111/j.1365-2621.1966.tb01905.x/abstract/
15:31:48 (3, 2, 4) (EDIT) User:Edgar181 (contribs, talk) edited Pyruvic_acid (diff, hist)
Added links: http://books.google.com/books?id=Wq45AAAAcAAJ&printsec=frontcover&source=gbs_ge_summary_r&cad=0#v=onepage&q&f=false, http://books.google.com/books?id=Wq45AAAAcAAJ&pg=PA65&ved=0CEoQ6AEwBg#v=onepage&q&f=false, http://books.google.com/books?id=MgA5AAAAIAAJ&p
15:37:31 (3, 2, 4) (EDIT) User:Goorky (contribs, talk) edited Sodium_silicate (diff, hist)
Added links: http://chemsub.online.fr/name/sodium_silicate.html
15:40:49 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Pyruvic_acid (diff, hist)
Changed: 'verifiedrevid' ('408974408' -> '413631436', SET '408974408')
15:53:32 (3, 2, 4) (EDIT) User:Monsieurpiggy (contribs, talk) edited Isomaltose (diff, hist)
Added links: http://onlinelibrary.wiley.com/doi/10.1111/j.1365-2621.1966.tb01905.x/abstract/
15:55:03 (3, 2, 4) (EDIT) User:Monsieurpiggy (contribs, talk) edited Gentiobiose (diff, hist)
Added links: http://onlinelibrary.wiley.com/doi/10.1111/j.1365-2621.1966.tb01905.x/abstract/
15:57:06 (3, 2, 4) (EDIT) User:Goorky (contribs, talk) edited Sodium_silicate (diff, hist)
Added links: http://chemsub.online.fr/name/sodium_metasilicate.html
16:04:53 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Urobilinogen (diff, hist)
Added: 'verifiedrevid' ('' -> '410607788', SET '')
16:07:44 (3, 2, 4) (EDIT) User:Goorky (contribs, talk) edited Sodium_silicate (diff, hist)
Added links: http://chemsub.online.fr/name/silicic_acid,_sodium_salt.html
16:32:17 (2, 4, 5) (EDIT) User:86.24.248.136 (contribs, talk) edited Calcium_bicarbonate (diff, hist)
Changed: 'OtherNames' ('Calcium hydrogen carbonate' -> 'Calcium bicarbonate', SET 'Calcium hydrogen carbonate')
16:32:17 (4, 4, 5) (EDIT) User:86.24.248.136 (contribs, talk) edited Calcium_bicarbonate (diff, hist)
Changed: 'IUPACName' ('Calcium bicarbonate' -> 'Calcium hydrogen carbonate', SET 'Calcium bicarbonate')
16:43:00 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Calcium_bicarbonate (diff, hist)
Added: 'Watchedfields' ('' -> 'changed', SET '')
17:05:36 (3, 2, 4) (EDIT) User:84.72.9.197 (contribs, talk) edited Benzoic_acid (diff, hist)
Added links: http://www.mpbio.com/detailed_info.php?family_key=02101142&country=204
17:47:32 (4, 3, 5) (EDIT) User:Aromaticmoleculessmell (contribs, talk) edited User:UMChemProfessor/Chem538W11Grp2_sandbox (diff, hist)
Changed: 'Formula' ('(C13H10)n' -> '(C13H8)n')
17:47:33 (3, 2, 4) (EDIT) User:Aromaticmoleculessmell (contribs, talk) edited User:UMChemProfessor/Chem538W11Grp2_sandbox (diff, hist)
Added links: http://www.popsci.com/technology/article/2010-06/laser-sensor-can-see-explosives-vapor-trails-even-extremely-low-concentrations
18:23:59 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Nafion (diff, hist)
Added: 'verifiedrevid' ('' -> '415744141', SET '')
18:44:08 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Melanotan_II (diff, hist)
Changed: 'verifiedrevid' ('409581996' -> '410843251', SET '409581996')
18:52:16 (3, 2, 4) (EDIT) User:Mkcas (contribs, talk) edited Cumene (diff, hist)
Added links: http://www.caslab.com/Isopropylbenzene.php5
18:59:37 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'realboxname' ('' -> 'chembox')
18:59:37 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'boxname' ('' -> 'chembox')
18:59:38 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'ImageFile' ('' -> 'Myosmine.svg')
18:59:38 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'ImageSize' ('' -> '150px')
18:59:38 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'OtherNames' ('' -> '3-(1-Pyrrolin-2-yl)pyridine')
18:59:39 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'Section1' ('' -> '{{Chembox Identifiers')
18:59:39 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'CASNo' ('' -> '532-12-7')
18:59:39 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'CASNo_Ref' ('' -> '{{cascite|correct|CAS}}')
18:59:39 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'Section2' ('' -> '{{Chembox Properties')
18:59:39 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'Section3' ('' -> '{{Chembox Hazards')
18:59:40 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'error' ('empty' -> '')
18:59:40 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'C' ('' -> '9')
18:59:40 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'H' ('' -> '10')
18:59:40 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'N' ('' -> '2')
18:59:41 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'IUPACName' ('' -> '3-(3,4-Dihydro-2''H''-pyrrol-5-yl)pyridine')
18:59:41 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'PubChem' ('' -> '442649')
18:59:41 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'SMILES' ('' -> 'n1cccc(c1)/C2=N/CCC2')
18:59:42 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'InChI' ('' -> 'InChI=1S/C9H10N2/c1-3-8(7-10-5-1)9-4-2-6-11-9/h1,3,5,7H,2,4,6H2')
18:59:42 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'ChemSpiderID' ('' -> '391011')
18:59:44 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'realboxname' ('drugbox' -> 'chembox')
18:59:45 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'boxname' ('drugbox' -> 'chembox')
18:59:45 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'IUPAC_name' ('3-(3,4-Dihydro-2H-pyrrol-5-yl)pyridine' -> '')
18:59:45 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'CAS_number' ('532-12-7' -> '')
18:59:45 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'smiles' ('C1(=CCCN1)C2=CC=CN=C2' -> '')
18:59:46 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'IUPACName' ('' -> '3-(3,4-Dihydro-2''H''-pyrrol-5-yl)pyridine')
18:59:46 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'SMILES' ('' -> 'n1cccc(c1)/C2=N/CCC2')
18:59:46 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'InChI' ('' -> 'InChI=1S/C9H10N2/c1-3-8(7-10-5-1)9-4-2-6-11-9/h1,3,5,7H,2,4,6H2')
18:59:46 (6, 6, 6) (EDIT) User:Edgar181 (contribs, talk) edited Myosmine (diff, hist)
Changed: 'ChemSpiderID' ('' -> '391011')
19:02:55 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Cumene (diff, hist)
Added: 'ImageFileL1_Ref' ('' -> '{{chemboximage|correct|??}}', SET '')
19:03:31 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Triformin (diff, hist)
Changed: 'C' ('' -> '6')
19:03:31 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Triformin (diff, hist)
Changed: 'H' ('' -> '8')
19:03:32 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Triformin (diff, hist)
Changed: 'O' ('' -> '6')
19:03:32 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Triformin (diff, hist)
Changed: 'Formula' ('C6H8O6' -> '')
19:03:32 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Triformin (diff, hist)
Changed: 'MolarMass' ('176.124' -> '')
19:03:33 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Triformin (diff, hist)
Changed: 'Density' ('1.32' -> '1.32 g/cm3')
19:03:33 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Triformin (diff, hist)
Changed: 'MeltingPt' ('18°C' -> '')
19:03:33 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Triformin (diff, hist)
Changed: 'MeltingPtC' ('' -> '18')
19:03:33 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Triformin (diff, hist)
Changed: 'BoilingPt' ('266°C' -> '')
19:03:34 (4, 3, 4) (EDIT) User:Edgar181 (contribs, talk) edited Triformin (diff, hist)
Changed: 'BoilingPtC' ('' -> '266')
19:20:32 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Phenylacetaldehyde (diff, hist)
Changed: 'verifiedrevid' ('361561075' -> '397065050', SET '361561075')
19:24:20 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Putrescine (diff, hist)
Changed: 'verifiedrevid' ('408972005' -> '408973251', SET '408972005')
20:09:38 (2, 4, 5) (EDIT) User:Hydrargyrum (contribs, talk) edited Tungsten_carbide (diff, hist)
Added: 'ImageAlt' ('' -> 'Tungsten carbide milling bits', SET '')
20:09:39 (2, 4, 5) (EDIT) User:Hydrargyrum (contribs, talk) edited Tungsten_carbide (diff, hist)
Added: 'ImageCaption' ('' -> 'Tungsten carbide milling bits', SET '')
20:09:39 (2, 5, 5) (EDIT) User:Hydrargyrum (contribs, talk) edited Tungsten_carbide (diff, hist)
Deleted: 'ImageName' ('Tungsten carbide milling bits' -> '', SET 'Tungsten carbide milling bits')
20:29:12 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Ruthenium_tetroxide (diff, hist)
Changed: 'verifiedrevid' ('412324317' -> '413077086', SET '412324317')
20:46:26 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited 2-Methylisoborneol (diff, hist)
Changed: 'verifiedrevid' ('399298178' -> '399299083', SET '399298178')
21:15:57 (2, 4, 4) (EDIT) User:ChemNerd (contribs, talk) edited Borneol (diff, hist)
Changed: 'ImageFileL1' ('Borneol_Structure.png' -> 'Borneol with H.svg', SET 'Borneol_Structure.png')
21:20:58 (2, 4, 5) (EDIT) User:JWBE (contribs, talk) edited Veratraldehyde (diff, hist)
Changed: 'ImageFile' ('Veratraldehyde.png' -> 'Veratrumaldehyd.svg', SET 'Veratraldehyde.png')
21:20:58 (2, 4, 5) (EDIT) User:JWBE (contribs, talk) edited Veratraldehyde (diff, hist)
Changed: 'ImageSize' ('200px' -> '150px', SET '200px')
21:28:36 (5, 5, 5) (EDIT) User:CheMoBot (contribs, talk) edited Retinal (diff, hist)
Changed: 'verifiedrevid' ('391588161' -> '415351310', SET '391588161')
21:37:12 (3, 2, 4) (EDIT) User:128.210.44.60 (contribs, talk) edited Arsenate (diff, hist)
Added links: http://www.sciencemag.org/content/early/recent, http://www.sciencemag.org/content/330/6006/912.2.full
22:57:18 (4, 4, 5) (EDIT) User:152.2.168.225 (contribs, talk) edited Acetonitrile (diff, hist)
Changed: 'Density' ('0.786 g/mL liquid' -> '0.777 g/mL liquid', SET '0.786 g/mL liquid')