Rosiridin is a chemical compound that has been isolated from Rhodiola sachalinensis.[1] Rosiridin can inhibit monoamine oxidases A and B, possibly meaning that the compound could help in the treatment of depression and senile dementia.[2][3]

Rosiridin
Names
IUPAC name
(2R,3R,4S,5S,6R)-2-{[(2E,4S)-4-Hydroxy-3,7-dimethylocta-2,6-dien-1-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol
Identifiers
3D model (JSmol)
UNII
  • CC(=CC[C@@H](/C(=C/CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)/C)O)C
Properties
C16H28O7
Molar mass 332.393 g·mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).

References edit

  1. ^ Yoshikawa, Masayuki; Nakamura, Seikou; Li, Xuezheng; Matsuda, Hisashi (2008). "Reinvestigation of absolute stereostructure of (−)-rosiridol: Structures of monoterpene glycosides, rosiridin, rosiridosides A, B, and C, from Rhodiola sachalinesnsis". Chemical and Pharmaceutical Bulletin. 56 (5): 695–700. doi:10.1248/cpb.56.695. PMID 18451561.
  2. ^ Panossian, Alexander; Wikman, Georg (2010). "Effects of adaptogens on the central nervous system and the molecular mechanisms associated with their stress-protective activity". Pharmaceuticals. 3 (1): 188–224. doi:10.3390/ph3010188. PMC 3991026. PMID 27713248.
  3. ^ van Diermen, Daphne; Marston, Andrew; Bravo, Juan; Reist, Marianne; Carrupt, Pierre-Alain; Hostettmann, Kurt (2009-03-18). "Monoamine oxidase inhibition by Rhodiola rosea L. roots". Journal of Ethnopharmacology. 122 (2): 397–401. doi:10.1016/j.jep.2009.01.007. ISSN 0378-8741.