Cyclopentobarbital
 |
|---|
| Systematic (IUPAC) name |
|---|
5-(1-cyclopent-2-enyl)-5-prop-2-enyl-1,3-
diazinane-2,4,6-trione |
| Clinical data |
|---|
| Pregnancy cat. |
? |
|---|
| Legal status |
? |
|---|
| Identifiers |
|---|
| CAS number |
76-68-6
302-34-1 (sodium) |
|---|
| ATC code |
None |
|---|
| PubChem |
CID 6454 |
|---|
| ChemSpider |
6212 Y |
|---|
| Synonyms |
Allylpental, Cyclopental, 5-Allyl-5-Δ2-Cyclopentenyl Barbituric Acid |
|---|
| Chemical data |
|---|
| Formula |
C12H14N2O3 |
|---|
| Mol. mass |
234.251 g/mol |
|---|
- O=C1NC(=O)NC(=O)C1(C2/C=C\CC2)C\C=C
|
-
InChI=1S/C12H14N2O3/c1-2-7-12(8-5-3-4-6-8)9(15)13-11(17)14-10(12)16/h2-3,5,8H,1,4,6-7H2,(H2,13,14,15,16,17) Y
Key:XOVJAYNMQDTIJD-UHFFFAOYSA-N Y
|
Y (what is this?) (verify)
|
|---|
Cyclopentobarbital sodium (Cyclopal, Dormisan) is a barbiturate derivative invented in the 1940s.[1] It has sedative and anticonvulsant properties, and was used primarily as an anaesthetic in veterinary medicine.[2] Cyclopal is considered similar in effects to phenobarbital but lasts almost three times as long, and is considered a long-acting barbiturate with a fairly slow onset of action.