Onchidal
 |
|---|
| Systematic (IUPAC) name |
|---|
| (1E,3E)-5-(2,2-Dimethyl-6-methylenecyclohexyl)-3-formylpenta-1,3-dien-1-yl acetate |
| Clinical data |
|---|
| Pregnancy cat. |
? |
|---|
| Legal status |
? |
|---|
| Identifiers |
|---|
| CAS number |
67656-42-2 |
|---|
| ATC code |
None |
|---|
| PubChem |
CID 6441116 |
|---|
| ChemSpider |
4945331 Y |
|---|
| Chemical data |
|---|
| Formula |
C17H24O3 |
|---|
| Mol. mass |
276.371 g/mol |
|---|
- CC(=O)O\C=C\C(=C/CC1C(=C)CCCC1(C)C)\C=O
|
-
InChI=1S/C17H24O3/c1-13-6-5-10-17(3,4)16(13)8-7-15(12-18)9-11-20-14(2)19/h7,9,11-12,16H,1,5-6,8,10H2,2-4H3/b11-9+,15-7+ Y
Key:BEKQPDFPPJFVJP-AHSQCEKMSA-N Y
|
Y (what is this?) (verify)
|
|---|
Onchidal is a naturally occurring toxin produced as a defensive secretion by the mollusc Onchidella binneyi and several other related species in Onchidella,a genus of small, air-breathing sea slugs. It acts as an irreversible acetylcholinesterase inhibitor, the same mechanism of action as that of the deadly nerve agents, however onchidal is not an organophosphorus or carbamate compound and bears little resemblance to other compounds of this nature.[1]