Nealbarbital
 |
|---|
| Systematic (IUPAC) name |
|---|
| 5-allyl-5-(1,1-dimethylpropyl)pyrimidine-2,4,6(1H,3H,5H)-trione |
| Clinical data |
|---|
| Pregnancy cat. |
? |
|---|
| Legal status |
? |
|---|
| Identifiers |
|---|
| CAS number |
561-83-1 |
|---|
| ATC code |
None |
|---|
| PubChem |
CID 521716 |
|---|
| ChemSpider |
455089  Y |
|---|
| UNII |
25ATP958PA Y |
|---|
| Synonyms |
Nealbarbital, Censedal |
|---|
| Chemical data |
|---|
| Formula |
C12H18N2O3 |
|---|
| Mol. mass |
238.28 g/mol |
|---|
- O=C1NC(=O)NC(=O)C1(CC(C)(C)C)C\C=C
|
-
InChI=1S/C12H18N2O3/c1-5-6-12(7-11(2,3)4)8(15)13-10(17)14-9(12)16/h5H,1,6-7H2,2-4H3,(H2,13,14,15,16,17) Y
Key:YHKPTICJRUESOY-UHFFFAOYSA-N Y
|
 Y (what is this?) (verify)
|
|---|
Nealbarbital (Censedal) is a barbiturate derivative developed by Aktiebolaget Pharmacia in the 1950s.[1] It has sedative and hypnotic effects, and was used for the treatment of insomnia.
(what is this?) (verify)
